/usr/include/firefox-esr-52/jsapi.h is in firefox-esr-dev 52.8.1esr-1~deb8u1.
This file is owned by root:root, with mode 0o644.
The actual contents of the file can be viewed below.
1 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20 21 22 23 24 25 26 27 28 29 30 31 32 33 34 35 36 37 38 39 40 41 42 43 44 45 46 47 48 49 50 51 52 53 54 55 56 57 58 59 60 61 62 63 64 65 66 67 68 69 70 71 72 73 74 75 76 77 78 79 80 81 82 83 84 85 86 87 88 89 90 91 92 93 94 95 96 97 98 99 100 101 102 103 104 105 106 107 108 109 110 111 112 113 114 115 116 117 118 119 120 121 122 123 124 125 126 127 128 129 130 131 132 133 134 135 136 137 138 139 140 141 142 143 144 145 146 147 148 149 150 151 152 153 154 155 156 157 158 159 160 161 162 163 164 165 166 167 168 169 170 171 172 173 174 175 176 177 178 179 180 181 182 183 184 185 186 187 188 189 190 191 192 193 194 195 196 197 198 199 200 201 202 203 204 205 206 207 208 209 210 211 212 213 214 215 216 217 218 219 220 221 222 223 224 225 226 227 228 229 230 231 232 233 234 235 236 237 238 239 240 241 242 243 244 245 246 247 248 249 250 251 252 253 254 255 256 257 258 259 260 261 262 263 264 265 266 267 268 269 270 271 272 273 274 275 276 277 278 279 280 281 282 283 284 285 286 287 288 289 290 291 292 293 294 295 296 297 298 299 300 301 302 303 304 305 306 307 308 309 310 311 312 313 314 315 316 317 318 319 320 321 322 323 324 325 326 327 328 329 330 331 332 333 334 335 336 337 338 339 340 341 342 343 344 345 346 347 348 349 350 351 352 353 354 355 356 357 358 359 360 361 362 363 364 365 366 367 368 369 370 371 372 373 374 375 376 377 378 379 380 381 382 383 384 385 386 387 388 389 390 391 392 393 394 395 396 397 398 399 400 401 402 403 404 405 406 407 408 409 410 411 412 413 414 415 416 417 418 419 420 421 422 423 424 425 426 427 428 429 430 431 432 433 434 435 436 437 438 439 440 441 442 443 444 445 446 447 448 449 450 451 452 453 454 455 456 457 458 459 460 461 462 463 464 465 466 467 468 469 470 471 472 473 474 475 476 477 478 479 480 481 482 483 484 485 486 487 488 489 490 491 492 493 494 495 496 497 498 499 500 501 502 503 504 505 506 507 508 509 510 511 512 513 514 515 516 517 518 519 520 521 522 523 524 525 526 527 528 529 530 531 532 533 534 535 536 537 538 539 540 541 542 543 544 545 546 547 548 549 550 551 552 553 554 555 556 557 558 559 560 561 562 563 564 565 566 567 568 569 570 571 572 573 574 575 576 577 578 579 580 581 582 583 584 585 586 587 588 589 590 591 592 593 594 595 596 597 598 599 600 601 602 603 604 605 606 607 608 609 610 611 612 613 614 615 616 617 618 619 620 621 622 623 624 625 626 627 628 629 630 631 632 633 634 635 636 637 638 639 640 641 642 643 644 645 646 647 648 649 650 651 652 653 654 655 656 657 658 659 660 661 662 663 664 665 666 667 668 669 670 671 672 673 674 675 676 677 678 679 680 681 682 683 684 685 686 687 688 689 690 691 692 693 694 695 696 697 698 699 700 701 702 703 704 705 706 707 708 709 710 711 712 713 714 715 716 717 718 719 720 721 722 723 724 725 726 727 728 729 730 731 732 733 734 735 736 737 738 739 740 741 742 743 744 745 746 747 748 749 750 751 752 753 754 755 756 757 758 759 760 761 762 763 764 765 766 767 768 769 770 771 772 773 774 775 776 777 778 779 780 781 782 783 784 785 786 787 788 789 790 791 792 793 794 795 796 797 798 799 800 801 802 803 804 805 806 807 808 809 810 811 812 813 814 815 816 817 818 819 820 821 822 823 824 825 826 827 828 829 830 831 832 833 834 835 836 837 838 839 840 841 842 843 844 845 846 847 848 849 850 851 852 853 854 855 856 857 858 859 860 861 862 863 864 865 866 867 868 869 870 871 872 873 874 875 876 877 878 879 880 881 882 883 884 885 886 887 888 889 890 891 892 893 894 895 896 897 898 899 900 901 902 903 904 905 906 907 908 909 910 911 912 913 914 915 916 917 918 919 920 921 922 923 924 925 926 927 928 929 930 931 932 933 934 935 936 937 938 939 940 941 942 943 944 945 946 947 948 949 950 951 952 953 954 955 956 957 958 959 960 961 962 963 964 965 966 967 968 969 970 971 972 973 974 975 976 977 978 979 980 981 982 983 984 985 986 987 988 989 990 991 992 993 994 995 996 997 998 999 1000 1001 1002 1003 1004 1005 1006 1007 1008 1009 1010 1011 1012 1013 1014 1015 1016 1017 1018 1019 1020 1021 1022 1023 1024 1025 1026 1027 1028 1029 1030 1031 1032 1033 1034 1035 1036 1037 1038 1039 1040 1041 1042 1043 1044 1045 1046 1047 1048 1049 1050 1051 1052 1053 1054 1055 1056 1057 1058 1059 1060 1061 1062 1063 1064 1065 1066 1067 1068 1069 1070 1071 1072 1073 1074 1075 1076 1077 1078 1079 1080 1081 1082 1083 1084 1085 1086 1087 1088 1089 1090 1091 1092 1093 1094 1095 1096 1097 1098 1099 1100 1101 1102 1103 1104 1105 1106 1107 1108 1109 1110 1111 1112 1113 1114 1115 1116 1117 1118 1119 1120 1121 1122 1123 1124 1125 1126 1127 1128 1129 1130 1131 1132 1133 1134 1135 1136 1137 1138 1139 1140 1141 1142 1143 1144 1145 1146 1147 1148 1149 1150 1151 1152 1153 1154 1155 1156 1157 1158 1159 1160 1161 1162 1163 1164 1165 1166 1167 1168 1169 1170 1171 1172 1173 1174 1175 1176 1177 1178 1179 1180 1181 1182 1183 1184 1185 1186 1187 1188 1189 1190 1191 1192 1193 1194 1195 1196 1197 1198 1199 1200 1201 1202 1203 1204 1205 1206 1207 1208 1209 1210 1211 1212 1213 1214 1215 1216 1217 1218 1219 1220 1221 1222 1223 1224 1225 1226 1227 1228 1229 1230 1231 1232 1233 1234 1235 1236 1237 1238 1239 1240 1241 1242 1243 1244 1245 1246 1247 1248 1249 1250 1251 1252 1253 1254 1255 1256 1257 1258 1259 1260 1261 1262 1263 1264 1265 1266 1267 1268 1269 1270 1271 1272 1273 1274 1275 1276 1277 1278 1279 1280 1281 1282 1283 1284 1285 1286 1287 1288 1289 1290 1291 1292 1293 1294 1295 1296 1297 1298 1299 1300 1301 1302 1303 1304 1305 1306 1307 1308 1309 1310 1311 1312 1313 1314 1315 1316 1317 1318 1319 1320 1321 1322 1323 1324 1325 1326 1327 1328 1329 1330 1331 1332 1333 1334 1335 1336 1337 1338 1339 1340 1341 1342 1343 1344 1345 1346 1347 1348 1349 1350 1351 1352 1353 1354 1355 1356 1357 1358 1359 1360 1361 1362 1363 1364 1365 1366 1367 1368 1369 1370 1371 1372 1373 1374 1375 1376 1377 1378 1379 1380 1381 1382 1383 1384 1385 1386 1387 1388 1389 1390 1391 1392 1393 1394 1395 1396 1397 1398 1399 1400 1401 1402 1403 1404 1405 1406 1407 1408 1409 1410 1411 1412 1413 1414 1415 1416 1417 1418 1419 1420 1421 1422 1423 1424 1425 1426 1427 1428 1429 1430 1431 1432 1433 1434 1435 1436 1437 1438 1439 1440 1441 1442 1443 1444 1445 1446 1447 1448 1449 1450 1451 1452 1453 1454 1455 1456 1457 1458 1459 1460 1461 1462 1463 1464 1465 1466 1467 1468 1469 1470 1471 1472 1473 1474 1475 1476 1477 1478 1479 1480 1481 1482 1483 1484 1485 1486 1487 1488 1489 1490 1491 1492 1493 1494 1495 1496 1497 1498 1499 1500 1501 1502 1503 1504 1505 1506 1507 1508 1509 1510 1511 1512 1513 1514 1515 1516 1517 1518 1519 1520 1521 1522 1523 1524 1525 1526 1527 1528 1529 1530 1531 1532 1533 1534 1535 1536 1537 1538 1539 1540 1541 1542 1543 1544 1545 1546 1547 1548 1549 1550 1551 1552 1553 1554 1555 1556 1557 1558 1559 1560 1561 1562 1563 1564 1565 1566 1567 1568 1569 1570 1571 1572 1573 1574 1575 1576 1577 1578 1579 1580 1581 1582 1583 1584 1585 1586 1587 1588 1589 1590 1591 1592 1593 1594 1595 1596 1597 1598 1599 1600 1601 1602 1603 1604 1605 1606 1607 1608 1609 1610 1611 1612 1613 1614 1615 1616 1617 1618 1619 1620 1621 1622 1623 1624 1625 1626 1627 1628 1629 1630 1631 1632 1633 1634 1635 1636 1637 1638 1639 1640 1641 1642 1643 1644 1645 1646 1647 1648 1649 1650 1651 1652 1653 1654 1655 1656 1657 1658 1659 1660 1661 1662 1663 1664 1665 1666 1667 1668 1669 1670 1671 1672 1673 1674 1675 1676 1677 1678 1679 1680 1681 1682 1683 1684 1685 1686 1687 1688 1689 1690 1691 1692 1693 1694 1695 1696 1697 1698 1699 1700 1701 1702 1703 1704 1705 1706 1707 1708 1709 1710 1711 1712 1713 1714 1715 1716 1717 1718 1719 1720 1721 1722 1723 1724 1725 1726 1727 1728 1729 1730 1731 1732 1733 1734 1735 1736 1737 1738 1739 1740 1741 1742 1743 1744 1745 1746 1747 1748 1749 1750 1751 1752 1753 1754 1755 1756 1757 1758 1759 1760 1761 1762 1763 1764 1765 1766 1767 1768 1769 1770 1771 1772 1773 1774 1775 1776 1777 1778 1779 1780 1781 1782 1783 1784 1785 1786 1787 1788 1789 1790 1791 1792 1793 1794 1795 1796 1797 1798 1799 1800 1801 1802 1803 1804 1805 1806 1807 1808 1809 1810 1811 1812 1813 1814 1815 1816 1817 1818 1819 1820 1821 1822 1823 1824 1825 1826 1827 1828 1829 1830 1831 1832 1833 1834 1835 1836 1837 1838 1839 1840 1841 1842 1843 1844 1845 1846 1847 1848 1849 1850 1851 1852 1853 1854 1855 1856 1857 1858 1859 1860 1861 1862 1863 1864 1865 1866 1867 1868 1869 1870 1871 1872 1873 1874 1875 1876 1877 1878 1879 1880 1881 1882 1883 1884 1885 1886 1887 1888 1889 1890 1891 1892 1893 1894 1895 1896 1897 1898 1899 1900 1901 1902 1903 1904 1905 1906 1907 1908 1909 1910 1911 1912 1913 1914 1915 1916 1917 1918 1919 1920 1921 1922 1923 1924 1925 1926 1927 1928 1929 1930 1931 1932 1933 1934 1935 1936 1937 1938 1939 1940 1941 1942 1943 1944 1945 1946 1947 1948 1949 1950 1951 1952 1953 1954 1955 1956 1957 1958 1959 1960 1961 1962 1963 1964 1965 1966 1967 1968 1969 1970 1971 1972 1973 1974 1975 1976 1977 1978 1979 1980 1981 1982 1983 1984 1985 1986 1987 1988 1989 1990 1991 1992 1993 1994 1995 1996 1997 1998 1999 2000 2001 2002 2003 2004 2005 2006 2007 2008 2009 2010 2011 2012 2013 2014 2015 2016 2017 2018 2019 2020 2021 2022 2023 2024 2025 2026 2027 2028 2029 2030 2031 2032 2033 2034 2035 2036 2037 2038 2039 2040 2041 2042 2043 2044 2045 2046 2047 2048 2049 2050 2051 2052 2053 2054 2055 2056 2057 2058 2059 2060 2061 2062 2063 2064 2065 2066 2067 2068 2069 2070 2071 2072 2073 2074 2075 2076 2077 2078 2079 2080 2081 2082 2083 2084 2085 2086 2087 2088 2089 2090 2091 2092 2093 2094 2095 2096 2097 2098 2099 2100 2101 2102 2103 2104 2105 2106 2107 2108 2109 2110 2111 2112 2113 2114 2115 2116 2117 2118 2119 2120 2121 2122 2123 2124 2125 2126 2127 2128 2129 2130 2131 2132 2133 2134 2135 2136 2137 2138 2139 2140 2141 2142 2143 2144 2145 2146 2147 2148 2149 2150 2151 2152 2153 2154 2155 2156 2157 2158 2159 2160 2161 2162 2163 2164 2165 2166 2167 2168 2169 2170 2171 2172 2173 2174 2175 2176 2177 2178 2179 2180 2181 2182 2183 2184 2185 2186 2187 2188 2189 2190 2191 2192 2193 2194 2195 2196 2197 2198 2199 2200 2201 2202 2203 2204 2205 2206 2207 2208 2209 2210 2211 2212 2213 2214 2215 2216 2217 2218 2219 2220 2221 2222 2223 2224 2225 2226 2227 2228 2229 2230 2231 2232 2233 2234 2235 2236 2237 2238 2239 2240 2241 2242 2243 2244 2245 2246 2247 2248 2249 2250 2251 2252 2253 2254 2255 2256 2257 2258 2259 2260 2261 2262 2263 2264 2265 2266 2267 2268 2269 2270 2271 2272 2273 2274 2275 2276 2277 2278 2279 2280 2281 2282 2283 2284 2285 2286 2287 2288 2289 2290 2291 2292 2293 2294 2295 2296 2297 2298 2299 2300 2301 2302 2303 2304 2305 2306 2307 2308 2309 2310 2311 2312 2313 2314 2315 2316 2317 2318 2319 2320 2321 2322 2323 2324 2325 2326 2327 2328 2329 2330 2331 2332 2333 2334 2335 2336 2337 2338 2339 2340 2341 2342 2343 2344 2345 2346 2347 2348 2349 2350 2351 2352 2353 2354 2355 2356 2357 2358 2359 2360 2361 2362 2363 2364 2365 2366 2367 2368 2369 2370 2371 2372 2373 2374 2375 2376 2377 2378 2379 2380 2381 2382 2383 2384 2385 2386 2387 2388 2389 2390 2391 2392 2393 2394 2395 2396 2397 2398 2399 2400 2401 2402 2403 2404 2405 2406 2407 2408 2409 2410 2411 2412 2413 2414 2415 2416 2417 2418 2419 2420 2421 2422 2423 2424 2425 2426 2427 2428 2429 2430 2431 2432 2433 2434 2435 2436 2437 2438 2439 2440 2441 2442 2443 2444 2445 2446 2447 2448 2449 2450 2451 2452 2453 2454 2455 2456 2457 2458 2459 2460 2461 2462 2463 2464 2465 2466 2467 2468 2469 2470 2471 2472 2473 2474 2475 2476 2477 2478 2479 2480 2481 2482 2483 2484 2485 2486 2487 2488 2489 2490 2491 2492 2493 2494 2495 2496 2497 2498 2499 2500 2501 2502 2503 2504 2505 2506 2507 2508 2509 2510 2511 2512 2513 2514 2515 2516 2517 2518 2519 2520 2521 2522 2523 2524 2525 2526 2527 2528 2529 2530 2531 2532 2533 2534 2535 2536 2537 2538 2539 2540 2541 2542 2543 2544 2545 2546 2547 2548 2549 2550 2551 2552 2553 2554 2555 2556 2557 2558 2559 2560 2561 2562 2563 2564 2565 2566 2567 2568 2569 2570 2571 2572 2573 2574 2575 2576 2577 2578 2579 2580 2581 2582 2583 2584 2585 2586 2587 2588 2589 2590 2591 2592 2593 2594 2595 2596 2597 2598 2599 2600 2601 2602 2603 2604 2605 2606 2607 2608 2609 2610 2611 2612 2613 2614 2615 2616 2617 2618 2619 2620 2621 2622 2623 2624 2625 2626 2627 2628 2629 2630 2631 2632 2633 2634 2635 2636 2637 2638 2639 2640 2641 2642 2643 2644 2645 2646 2647 2648 2649 2650 2651 2652 2653 2654 2655 2656 2657 2658 2659 2660 2661 2662 2663 2664 2665 2666 2667 2668 2669 2670 2671 2672 2673 2674 2675 2676 2677 2678 2679 2680 2681 2682 2683 2684 2685 2686 2687 2688 2689 2690 2691 2692 2693 2694 2695 2696 2697 2698 2699 2700 2701 2702 2703 2704 2705 2706 2707 2708 2709 2710 2711 2712 2713 2714 2715 2716 2717 2718 2719 2720 2721 2722 2723 2724 2725 2726 2727 2728 2729 2730 2731 2732 2733 2734 2735 2736 2737 2738 2739 2740 2741 2742 2743 2744 2745 2746 2747 2748 2749 2750 2751 2752 2753 2754 2755 2756 2757 2758 2759 2760 2761 2762 2763 2764 2765 2766 2767 2768 2769 2770 2771 2772 2773 2774 2775 2776 2777 2778 2779 2780 2781 2782 2783 2784 2785 2786 2787 2788 2789 2790 2791 2792 2793 2794 2795 2796 2797 2798 2799 2800 2801 2802 2803 2804 2805 2806 2807 2808 2809 2810 2811 2812 2813 2814 2815 2816 2817 2818 2819 2820 2821 2822 2823 2824 2825 2826 2827 2828 2829 2830 2831 2832 2833 2834 2835 2836 2837 2838 2839 2840 2841 2842 2843 2844 2845 2846 2847 2848 2849 2850 2851 2852 2853 2854 2855 2856 2857 2858 2859 2860 2861 2862 2863 2864 2865 2866 2867 2868 2869 2870 2871 2872 2873 2874 2875 2876 2877 2878 2879 2880 2881 2882 2883 2884 2885 2886 2887 2888 2889 2890 2891 2892 2893 2894 2895 2896 2897 2898 2899 2900 2901 2902 2903 2904 2905 2906 2907 2908 2909 2910 2911 2912 2913 2914 2915 2916 2917 2918 2919 2920 2921 2922 2923 2924 2925 2926 2927 2928 2929 2930 2931 2932 2933 2934 2935 2936 2937 2938 2939 2940 2941 2942 2943 2944 2945 2946 2947 2948 2949 2950 2951 2952 2953 2954 2955 2956 2957 2958 2959 2960 2961 2962 2963 2964 2965 2966 2967 2968 2969 2970 2971 2972 2973 2974 2975 2976 2977 2978 2979 2980 2981 2982 2983 2984 2985 2986 2987 2988 2989 2990 2991 2992 2993 2994 2995 2996 2997 2998 2999 3000 3001 3002 3003 3004 3005 3006 3007 3008 3009 3010 3011 3012 3013 3014 3015 3016 3017 3018 3019 3020 3021 3022 3023 3024 3025 3026 3027 3028 3029 3030 3031 3032 3033 3034 3035 3036 3037 3038 3039 3040 3041 3042 3043 3044 3045 3046 3047 3048 3049 3050 3051 3052 3053 3054 3055 3056 3057 3058 3059 3060 3061 3062 3063 3064 3065 3066 3067 3068 3069 3070 3071 3072 3073 3074 3075 3076 3077 3078 3079 3080 3081 3082 3083 3084 3085 3086 3087 3088 3089 3090 3091 3092 3093 3094 3095 3096 3097 3098 3099 3100 3101 3102 3103 3104 3105 3106 3107 3108 3109 3110 3111 3112 3113 3114 3115 3116 3117 3118 3119 3120 3121 3122 3123 3124 3125 3126 3127 3128 3129 3130 3131 3132 3133 3134 3135 3136 3137 3138 3139 3140 3141 3142 3143 3144 3145 3146 3147 3148 3149 3150 3151 3152 3153 3154 3155 3156 3157 3158 3159 3160 3161 3162 3163 3164 3165 3166 3167 3168 3169 3170 3171 3172 3173 3174 3175 3176 3177 3178 3179 3180 3181 3182 3183 3184 3185 3186 3187 3188 3189 3190 3191 3192 3193 3194 3195 3196 3197 3198 3199 3200 3201 3202 3203 3204 3205 3206 3207 3208 3209 3210 3211 3212 3213 3214 3215 3216 3217 3218 3219 3220 3221 3222 3223 3224 3225 3226 3227 3228 3229 3230 3231 3232 3233 3234 3235 3236 3237 3238 3239 3240 3241 3242 3243 3244 3245 3246 3247 3248 3249 3250 3251 3252 3253 3254 3255 3256 3257 3258 3259 3260 3261 3262 3263 3264 3265 3266 3267 3268 3269 3270 3271 3272 3273 3274 3275 3276 3277 3278 3279 3280 3281 3282 3283 3284 3285 3286 3287 3288 3289 3290 3291 3292 3293 3294 3295 3296 3297 3298 3299 3300 3301 3302 3303 3304 3305 3306 3307 3308 3309 3310 3311 3312 3313 3314 3315 3316 3317 3318 3319 3320 3321 3322 3323 3324 3325 3326 3327 3328 3329 3330 3331 3332 3333 3334 3335 3336 3337 3338 3339 3340 3341 3342 3343 3344 3345 3346 3347 3348 3349 3350 3351 3352 3353 3354 3355 3356 3357 3358 3359 3360 3361 3362 3363 3364 3365 3366 3367 3368 3369 3370 3371 3372 3373 3374 3375 3376 3377 3378 3379 3380 3381 3382 3383 3384 3385 3386 3387 3388 3389 3390 3391 3392 3393 3394 3395 3396 3397 3398 3399 3400 3401 3402 3403 3404 3405 3406 3407 3408 3409 3410 3411 3412 3413 3414 3415 3416 3417 3418 3419 3420 3421 3422 3423 3424 3425 3426 3427 3428 3429 3430 3431 3432 3433 3434 3435 3436 3437 3438 3439 3440 3441 3442 3443 3444 3445 3446 3447 3448 3449 3450 3451 3452 3453 3454 3455 3456 3457 3458 3459 3460 3461 3462 3463 3464 3465 3466 3467 3468 3469 3470 3471 3472 3473 3474 3475 3476 3477 3478 3479 3480 3481 3482 3483 3484 3485 3486 3487 3488 3489 3490 3491 3492 3493 3494 3495 3496 3497 3498 3499 3500 3501 3502 3503 3504 3505 3506 3507 3508 3509 3510 3511 3512 3513 3514 3515 3516 3517 3518 3519 3520 3521 3522 3523 3524 3525 3526 3527 3528 3529 3530 3531 3532 3533 3534 3535 3536 3537 3538 3539 3540 3541 3542 3543 3544 3545 3546 3547 3548 3549 3550 3551 3552 3553 3554 3555 3556 3557 3558 3559 3560 3561 3562 3563 3564 3565 3566 3567 3568 3569 3570 3571 3572 3573 3574 3575 3576 3577 3578 3579 3580 3581 3582 3583 3584 3585 3586 3587 3588 3589 3590 3591 3592 3593 3594 3595 3596 3597 3598 3599 3600 3601 3602 3603 3604 3605 3606 3607 3608 3609 3610 3611 3612 3613 3614 3615 3616 3617 3618 3619 3620 3621 3622 3623 3624 3625 3626 3627 3628 3629 3630 3631 3632 3633 3634 3635 3636 3637 3638 3639 3640 3641 3642 3643 3644 3645 3646 3647 3648 3649 3650 3651 3652 3653 3654 3655 3656 3657 3658 3659 3660 3661 3662 3663 3664 3665 3666 3667 3668 3669 3670 3671 3672 3673 3674 3675 3676 3677 3678 3679 3680 3681 3682 3683 3684 3685 3686 3687 3688 3689 3690 3691 3692 3693 3694 3695 3696 3697 3698 3699 3700 3701 3702 3703 3704 3705 3706 3707 3708 3709 3710 3711 3712 3713 3714 3715 3716 3717 3718 3719 3720 3721 3722 3723 3724 3725 3726 3727 3728 3729 3730 3731 3732 3733 3734 3735 3736 3737 3738 3739 3740 3741 3742 3743 3744 3745 3746 3747 3748 3749 3750 3751 3752 3753 3754 3755 3756 3757 3758 3759 3760 3761 3762 3763 3764 3765 3766 3767 3768 3769 3770 3771 3772 3773 3774 3775 3776 3777 3778 3779 3780 3781 3782 3783 3784 3785 3786 3787 3788 3789 3790 3791 3792 3793 3794 3795 3796 3797 3798 3799 3800 3801 3802 3803 3804 3805 3806 3807 3808 3809 3810 3811 3812 3813 3814 3815 3816 3817 3818 3819 3820 3821 3822 3823 3824 3825 3826 3827 3828 3829 3830 3831 3832 3833 3834 3835 3836 3837 3838 3839 3840 3841 3842 3843 3844 3845 3846 3847 3848 3849 3850 3851 3852 3853 3854 3855 3856 3857 3858 3859 3860 3861 3862 3863 3864 3865 3866 3867 3868 3869 3870 3871 3872 3873 3874 3875 3876 3877 3878 3879 3880 3881 3882 3883 3884 3885 3886 3887 3888 3889 3890 3891 3892 3893 3894 3895 3896 3897 3898 3899 3900 3901 3902 3903 3904 3905 3906 3907 3908 3909 3910 3911 3912 3913 3914 3915 3916 3917 3918 3919 3920 3921 3922 3923 3924 3925 3926 3927 3928 3929 3930 3931 3932 3933 3934 3935 3936 3937 3938 3939 3940 3941 3942 3943 3944 3945 3946 3947 3948 3949 3950 3951 3952 3953 3954 3955 3956 3957 3958 3959 3960 3961 3962 3963 3964 3965 3966 3967 3968 3969 3970 3971 3972 3973 3974 3975 3976 3977 3978 3979 3980 3981 3982 3983 3984 3985 3986 3987 3988 3989 3990 3991 3992 3993 3994 3995 3996 3997 3998 3999 4000 4001 4002 4003 4004 4005 4006 4007 4008 4009 4010 4011 4012 4013 4014 4015 4016 4017 4018 4019 4020 4021 4022 4023 4024 4025 4026 4027 4028 4029 4030 4031 4032 4033 4034 4035 4036 4037 4038 4039 4040 4041 4042 4043 4044 4045 4046 4047 4048 4049 4050 4051 4052 4053 4054 4055 4056 4057 4058 4059 4060 4061 4062 4063 4064 4065 4066 4067 4068 4069 4070 4071 4072 4073 4074 4075 4076 4077 4078 4079 4080 4081 4082 4083 4084 4085 4086 4087 4088 4089 4090 4091 4092 4093 4094 4095 4096 4097 4098 4099 4100 4101 4102 4103 4104 4105 4106 4107 4108 4109 4110 4111 4112 4113 4114 4115 4116 4117 4118 4119 4120 4121 4122 4123 4124 4125 4126 4127 4128 4129 4130 4131 4132 4133 4134 4135 4136 4137 4138 4139 4140 4141 4142 4143 4144 4145 4146 4147 4148 4149 4150 4151 4152 4153 4154 4155 4156 4157 4158 4159 4160 4161 4162 4163 4164 4165 4166 4167 4168 4169 4170 4171 4172 4173 4174 4175 4176 4177 4178 4179 4180 4181 4182 4183 4184 4185 4186 4187 4188 4189 4190 4191 4192 4193 4194 4195 4196 4197 4198 4199 4200 4201 4202 4203 4204 4205 4206 4207 4208 4209 4210 4211 4212 4213 4214 4215 4216 4217 4218 4219 4220 4221 4222 4223 4224 4225 4226 4227 4228 4229 4230 4231 4232 4233 4234 4235 4236 4237 4238 4239 4240 4241 4242 4243 4244 4245 4246 4247 4248 4249 4250 4251 4252 4253 4254 4255 4256 4257 4258 4259 4260 4261 4262 4263 4264 4265 4266 4267 4268 4269 4270 4271 4272 4273 4274 4275 4276 4277 4278 4279 4280 4281 4282 4283 4284 4285 4286 4287 4288 4289 4290 4291 4292 4293 4294 4295 4296 4297 4298 4299 4300 4301 4302 4303 4304 4305 4306 4307 4308 4309 4310 4311 4312 4313 4314 4315 4316 4317 4318 4319 4320 4321 4322 4323 4324 4325 4326 4327 4328 4329 4330 4331 4332 4333 4334 4335 4336 4337 4338 4339 4340 4341 4342 4343 4344 4345 4346 4347 4348 4349 4350 4351 4352 4353 4354 4355 4356 4357 4358 4359 4360 4361 4362 4363 4364 4365 4366 4367 4368 4369 4370 4371 4372 4373 4374 4375 4376 4377 4378 4379 4380 4381 4382 4383 4384 4385 4386 4387 4388 4389 4390 4391 4392 4393 4394 4395 4396 4397 4398 4399 4400 4401 4402 4403 4404 4405 4406 4407 4408 4409 4410 4411 4412 4413 4414 4415 4416 4417 4418 4419 4420 4421 4422 4423 4424 4425 4426 4427 4428 4429 4430 4431 4432 4433 4434 4435 4436 4437 4438 4439 4440 4441 4442 4443 4444 4445 4446 4447 4448 4449 4450 4451 4452 4453 4454 4455 4456 4457 4458 4459 4460 4461 4462 4463 4464 4465 4466 4467 4468 4469 4470 4471 4472 4473 4474 4475 4476 4477 4478 4479 4480 4481 4482 4483 4484 4485 4486 4487 4488 4489 4490 4491 4492 4493 4494 4495 4496 4497 4498 4499 4500 4501 4502 4503 4504 4505 4506 4507 4508 4509 4510 4511 4512 4513 4514 4515 4516 4517 4518 4519 4520 4521 4522 4523 4524 4525 4526 4527 4528 4529 4530 4531 4532 4533 4534 4535 4536 4537 4538 4539 4540 4541 4542 4543 4544 4545 4546 4547 4548 4549 4550 4551 4552 4553 4554 4555 4556 4557 4558 4559 4560 4561 4562 4563 4564 4565 4566 4567 4568 4569 4570 4571 4572 4573 4574 4575 4576 4577 4578 4579 4580 4581 4582 4583 4584 4585 4586 4587 4588 4589 4590 4591 4592 4593 4594 4595 4596 4597 4598 4599 4600 4601 4602 4603 4604 4605 4606 4607 4608 4609 4610 4611 4612 4613 4614 4615 4616 4617 4618 4619 4620 4621 4622 4623 4624 4625 4626 4627 4628 4629 4630 4631 4632 4633 4634 4635 4636 4637 4638 4639 4640 4641 4642 4643 4644 4645 4646 4647 4648 4649 4650 4651 4652 4653 4654 4655 4656 4657 4658 4659 4660 4661 4662 4663 4664 4665 4666 4667 4668 4669 4670 4671 4672 4673 4674 4675 4676 4677 4678 4679 4680 4681 4682 4683 4684 4685 4686 4687 4688 4689 4690 4691 4692 4693 4694 4695 4696 4697 4698 4699 4700 4701 4702 4703 4704 4705 4706 4707 4708 4709 4710 4711 4712 4713 4714 4715 4716 4717 4718 4719 4720 4721 4722 4723 4724 4725 4726 4727 4728 4729 4730 4731 4732 4733 4734 4735 4736 4737 4738 4739 4740 4741 4742 4743 4744 4745 4746 4747 4748 4749 4750 4751 4752 4753 4754 4755 4756 4757 4758 4759 4760 4761 4762 4763 4764 4765 4766 4767 4768 4769 4770 4771 4772 4773 4774 4775 4776 4777 4778 4779 4780 4781 4782 4783 4784 4785 4786 4787 4788 4789 4790 4791 4792 4793 4794 4795 4796 4797 4798 4799 4800 4801 4802 4803 4804 4805 4806 4807 4808 4809 4810 4811 4812 4813 4814 4815 4816 4817 4818 4819 4820 4821 4822 4823 4824 4825 4826 4827 4828 4829 4830 4831 4832 4833 4834 4835 4836 4837 4838 4839 4840 4841 4842 4843 4844 4845 4846 4847 4848 4849 4850 4851 4852 4853 4854 4855 4856 4857 4858 4859 4860 4861 4862 4863 4864 4865 4866 4867 4868 4869 4870 4871 4872 4873 4874 4875 4876 4877 4878 4879 4880 4881 4882 4883 4884 4885 4886 4887 4888 4889 4890 4891 4892 4893 4894 4895 4896 4897 4898 4899 4900 4901 4902 4903 4904 4905 4906 4907 4908 4909 4910 4911 4912 4913 4914 4915 4916 4917 4918 4919 4920 4921 4922 4923 4924 4925 4926 4927 4928 4929 4930 4931 4932 4933 4934 4935 4936 4937 4938 4939 4940 4941 4942 4943 4944 4945 4946 4947 4948 4949 4950 4951 4952 4953 4954 4955 4956 4957 4958 4959 4960 4961 4962 4963 4964 4965 4966 4967 4968 4969 4970 4971 4972 4973 4974 4975 4976 4977 4978 4979 4980 4981 4982 4983 4984 4985 4986 4987 4988 4989 4990 4991 4992 4993 4994 4995 4996 4997 4998 4999 5000 5001 5002 5003 5004 5005 5006 5007 5008 5009 5010 5011 5012 5013 5014 5015 5016 5017 5018 5019 5020 5021 5022 5023 5024 5025 5026 5027 5028 5029 5030 5031 5032 5033 5034 5035 5036 5037 5038 5039 5040 5041 5042 5043 5044 5045 5046 5047 5048 5049 5050 5051 5052 5053 5054 5055 5056 5057 5058 5059 5060 5061 5062 5063 5064 5065 5066 5067 5068 5069 5070 5071 5072 5073 5074 5075 5076 5077 5078 5079 5080 5081 5082 5083 5084 5085 5086 5087 5088 5089 5090 5091 5092 5093 5094 5095 5096 5097 5098 5099 5100 5101 5102 5103 5104 5105 5106 5107 5108 5109 5110 5111 5112 5113 5114 5115 5116 5117 5118 5119 5120 5121 5122 5123 5124 5125 5126 5127 5128 5129 5130 5131 5132 5133 5134 5135 5136 5137 5138 5139 5140 5141 5142 5143 5144 5145 5146 5147 5148 5149 5150 5151 5152 5153 5154 5155 5156 5157 5158 5159 5160 5161 5162 5163 5164 5165 5166 5167 5168 5169 5170 5171 5172 5173 5174 5175 5176 5177 5178 5179 5180 5181 5182 5183 5184 5185 5186 5187 5188 5189 5190 5191 5192 5193 5194 5195 5196 5197 5198 5199 5200 5201 5202 5203 5204 5205 5206 5207 5208 5209 5210 5211 5212 5213 5214 5215 5216 5217 5218 5219 5220 5221 5222 5223 5224 5225 5226 5227 5228 5229 5230 5231 5232 5233 5234 5235 5236 5237 5238 5239 5240 5241 5242 5243 5244 5245 5246 5247 5248 5249 5250 5251 5252 5253 5254 5255 5256 5257 5258 5259 5260 5261 5262 5263 5264 5265 5266 5267 5268 5269 5270 5271 5272 5273 5274 5275 5276 5277 5278 5279 5280 5281 5282 5283 5284 5285 5286 5287 5288 5289 5290 5291 5292 5293 5294 5295 5296 5297 5298 5299 5300 5301 5302 5303 5304 5305 5306 5307 5308 5309 5310 5311 5312 5313 5314 5315 5316 5317 5318 5319 5320 5321 5322 5323 5324 5325 5326 5327 5328 5329 5330 5331 5332 5333 5334 5335 5336 5337 5338 5339 5340 5341 5342 5343 5344 5345 5346 5347 5348 5349 5350 5351 5352 5353 5354 5355 5356 5357 5358 5359 5360 5361 5362 5363 5364 5365 5366 5367 5368 5369 5370 5371 5372 5373 5374 5375 5376 5377 5378 5379 5380 5381 5382 5383 5384 5385 5386 5387 5388 5389 5390 5391 5392 5393 5394 5395 5396 5397 5398 5399 5400 5401 5402 5403 5404 5405 5406 5407 5408 5409 5410 5411 5412 5413 5414 5415 5416 5417 5418 5419 5420 5421 5422 5423 5424 5425 5426 5427 5428 5429 5430 5431 5432 5433 5434 5435 5436 5437 5438 5439 5440 5441 5442 5443 5444 5445 5446 5447 5448 5449 5450 5451 5452 5453 5454 5455 5456 5457 5458 5459 5460 5461 5462 5463 5464 5465 5466 5467 5468 5469 5470 5471 5472 5473 5474 5475 5476 5477 5478 5479 5480 5481 5482 5483 5484 5485 5486 5487 5488 5489 5490 5491 5492 5493 5494 5495 5496 5497 5498 5499 5500 5501 5502 5503 5504 5505 5506 5507 5508 5509 5510 5511 5512 5513 5514 5515 5516 5517 5518 5519 5520 5521 5522 5523 5524 5525 5526 5527 5528 5529 5530 5531 5532 5533 5534 5535 5536 5537 5538 5539 5540 5541 5542 5543 5544 5545 5546 5547 5548 5549 5550 5551 5552 5553 5554 5555 5556 5557 5558 5559 5560 5561 5562 5563 5564 5565 5566 5567 5568 5569 5570 5571 5572 5573 5574 5575 5576 5577 5578 5579 5580 5581 5582 5583 5584 5585 5586 5587 5588 5589 5590 5591 5592 5593 5594 5595 5596 5597 5598 5599 5600 5601 5602 5603 5604 5605 5606 5607 5608 5609 5610 5611 5612 5613 5614 5615 5616 5617 5618 5619 5620 5621 5622 5623 5624 5625 5626 5627 5628 5629 5630 5631 5632 5633 5634 5635 5636 5637 5638 5639 5640 5641 5642 5643 5644 5645 5646 5647 5648 5649 5650 5651 5652 5653 5654 5655 5656 5657 5658 5659 5660 5661 5662 5663 5664 5665 5666 5667 5668 5669 5670 5671 5672 5673 5674 5675 5676 5677 5678 5679 5680 5681 5682 5683 5684 5685 5686 5687 5688 5689 5690 5691 5692 5693 5694 5695 5696 5697 5698 5699 5700 5701 5702 5703 5704 5705 5706 5707 5708 5709 5710 5711 5712 5713 5714 5715 5716 5717 5718 5719 5720 5721 5722 5723 5724 5725 5726 5727 5728 5729 5730 5731 5732 5733 5734 5735 5736 5737 5738 5739 5740 5741 5742 5743 5744 5745 5746 5747 5748 5749 5750 5751 5752 5753 5754 5755 5756 5757 5758 5759 5760 5761 5762 5763 5764 5765 5766 5767 5768 5769 5770 5771 5772 5773 5774 5775 5776 5777 5778 5779 5780 5781 5782 5783 5784 5785 5786 5787 5788 5789 5790 5791 5792 5793 5794 5795 5796 5797 5798 5799 5800 5801 5802 5803 5804 5805 5806 5807 5808 5809 5810 5811 5812 5813 5814 5815 5816 5817 5818 5819 5820 5821 5822 5823 5824 5825 5826 5827 5828 5829 5830 5831 5832 5833 5834 5835 5836 5837 5838 5839 5840 5841 5842 5843 5844 5845 5846 5847 5848 5849 5850 5851 5852 5853 5854 5855 5856 5857 5858 5859 5860 5861 5862 5863 5864 5865 5866 5867 5868 5869 5870 5871 5872 5873 5874 5875 5876 5877 5878 5879 5880 5881 5882 5883 5884 5885 5886 5887 5888 5889 5890 5891 5892 5893 5894 5895 5896 5897 5898 5899 5900 5901 5902 5903 5904 5905 5906 5907 5908 5909 5910 5911 5912 5913 5914 5915 5916 5917 5918 5919 5920 5921 5922 5923 5924 5925 5926 5927 5928 5929 5930 5931 5932 5933 5934 5935 5936 5937 5938 5939 5940 5941 5942 5943 5944 5945 5946 5947 5948 5949 5950 5951 5952 5953 5954 5955 5956 5957 5958 5959 5960 5961 5962 5963 5964 5965 5966 5967 5968 5969 5970 5971 5972 5973 5974 5975 5976 5977 5978 5979 5980 5981 5982 5983 5984 5985 5986 5987 5988 5989 5990 5991 5992 5993 5994 5995 5996 5997 5998 5999 6000 6001 6002 6003 6004 6005 6006 6007 6008 6009 6010 6011 6012 6013 6014 6015 6016 6017 6018 6019 6020 6021 6022 6023 6024 6025 6026 6027 6028 6029 6030 6031 6032 6033 6034 6035 6036 6037 6038 6039 6040 6041 6042 6043 6044 6045 6046 6047 6048 6049 6050 6051 6052 6053 6054 6055 6056 6057 6058 6059 6060 6061 6062 6063 6064 6065 6066 6067 6068 6069 6070 6071 6072 6073 6074 6075 6076 6077 6078 6079 6080 6081 6082 6083 6084 6085 6086 6087 6088 6089 6090 6091 6092 6093 6094 6095 6096 6097 6098 6099 6100 6101 6102 6103 6104 6105 6106 6107 6108 6109 6110 6111 6112 6113 6114 6115 6116 6117 6118 6119 6120 6121 6122 6123 6124 6125 6126 6127 6128 6129 6130 6131 6132 6133 6134 6135 6136 6137 6138 6139 6140 6141 6142 6143 6144 6145 6146 6147 6148 6149 6150 6151 6152 6153 6154 6155 6156 6157 6158 6159 6160 6161 6162 6163 6164 6165 6166 6167 6168 6169 6170 6171 6172 6173 6174 6175 6176 6177 6178 6179 6180 6181 6182 6183 6184 6185 6186 6187 6188 6189 6190 6191 6192 6193 6194 6195 6196 6197 6198 6199 6200 6201 6202 6203 6204 6205 6206 6207 6208 6209 6210 6211 6212 6213 6214 6215 6216 6217 6218 6219 6220 6221 6222 6223 6224 6225 6226 6227 6228 6229 6230 6231 6232 6233 6234 6235 6236 6237 6238 6239 6240 6241 6242 6243 6244 6245 6246 6247 6248 6249 6250 6251 6252 6253 6254 6255 6256 6257 6258 6259 6260 6261 6262 6263 6264 6265 6266 6267 6268 6269 6270 6271 6272 6273 6274 6275 6276 6277 6278 6279 6280 6281 6282 6283 6284 6285 6286 6287 6288 6289 6290 6291 6292 6293 6294 6295 6296 6297 6298 6299 6300 6301 6302 6303 6304 6305 6306 6307 6308 6309 6310 6311 6312 6313 6314 6315 6316 6317 6318 6319 6320 6321 6322 6323 6324 6325 6326 6327 6328 6329 6330 6331 6332 6333 6334 6335 6336 6337 6338 6339 6340 6341 6342 6343 6344 6345 6346 6347 6348 6349 6350 6351 6352 6353 6354 6355 6356 6357 6358 6359 6360 6361 6362 6363 6364 6365 6366 6367 6368 6369 6370 6371 6372 6373 6374 6375 6376 6377 6378 6379 6380 6381 6382 6383 6384 6385 6386 6387 6388 6389 6390 6391 6392 6393 6394 6395 6396 6397 6398 6399 6400 6401 6402 6403 6404 6405 6406 6407 6408 6409 6410 6411 6412 6413 6414 6415 6416 6417 6418 6419 6420 6421 6422 6423 6424 6425 6426 6427 6428 6429 6430 6431 6432 6433 6434 6435 6436 6437 6438 6439 6440 6441 6442 6443 6444 6445 6446 6447 6448 6449 6450 6451 6452 6453 6454 6455 6456 6457 6458 6459 6460 6461 6462 6463 6464 6465 6466 6467 6468 6469 6470 6471 6472 6473 6474 6475 6476 6477 6478 6479 6480 6481 6482 6483 6484 6485 6486 6487 6488 6489 6490 6491 6492 6493 6494 6495 6496 6497 6498 6499 6500 6501 6502 6503 6504 6505 6506 6507 6508 6509 6510 6511 6512 6513 6514 6515 6516 6517 6518 6519 6520 6521 6522 6523 6524 6525 6526 6527 6528 6529 6530 6531 6532 6533 6534 6535 6536 6537 6538 6539 6540 6541 6542 6543 6544 6545 6546 6547 6548 6549 6550 6551 6552 6553 6554 6555 6556 6557 6558 6559 6560 6561 6562 6563 6564 6565 6566 6567 6568 6569 6570 6571 6572 6573 6574 6575 6576 6577 6578 6579 6580 6581 6582 6583 6584 6585 6586 6587 6588 6589 6590 6591 6592 6593 6594 6595 6596 6597 6598 6599 6600 6601 6602 6603 6604 6605 6606 6607 6608 6609 6610 6611 6612 6613 6614 6615 6616 6617 6618 6619 6620 6621 6622 6623 6624 6625 6626 6627 6628 6629 6630 6631 6632 6633 6634 | /* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
* vim: set ts=8 sts=4 et sw=4 tw=99:
* This Source Code Form is subject to the terms of the Mozilla Public
* License, v. 2.0. If a copy of the MPL was not distributed with this
* file, You can obtain one at http://mozilla.org/MPL/2.0/. */
/* JavaScript API. */
#ifndef jsapi_h
#define jsapi_h
#include "mozilla/AlreadyAddRefed.h"
#include "mozilla/FloatingPoint.h"
#include "mozilla/MemoryReporting.h"
#include "mozilla/Range.h"
#include "mozilla/RangedPtr.h"
#include "mozilla/RefCounted.h"
#include "mozilla/RefPtr.h"
#include "mozilla/Variant.h"
#include <stdarg.h>
#include <stddef.h>
#include <stdint.h>
#include <stdio.h>
#include "jsalloc.h"
#include "jspubtd.h"
#include "js/CallArgs.h"
#include "js/CharacterEncoding.h"
#include "js/Class.h"
#include "js/GCVector.h"
#include "js/HashTable.h"
#include "js/Id.h"
#include "js/Principals.h"
#include "js/Realm.h"
#include "js/RootingAPI.h"
#include "js/TracingAPI.h"
#include "js/Utility.h"
#include "js/Value.h"
#include "js/Vector.h"
/************************************************************************/
namespace JS {
class TwoByteChars;
#ifdef JS_DEBUG
class JS_PUBLIC_API(AutoCheckRequestDepth)
{
JSContext* cx;
public:
explicit AutoCheckRequestDepth(JSContext* cx);
explicit AutoCheckRequestDepth(js::ContextFriendFields* cx);
~AutoCheckRequestDepth();
};
# define CHECK_REQUEST(cx) \
JS::AutoCheckRequestDepth _autoCheckRequestDepth(cx)
#else
# define CHECK_REQUEST(cx) \
((void) 0)
#endif /* JS_DEBUG */
/** AutoValueArray roots an internal fixed-size array of Values. */
template <size_t N>
class MOZ_RAII AutoValueArray : public AutoGCRooter
{
const size_t length_;
Value elements_[N];
public:
explicit AutoValueArray(JSContext* cx
MOZ_GUARD_OBJECT_NOTIFIER_PARAM)
: AutoGCRooter(cx, VALARRAY), length_(N)
{
/* Always initialize in case we GC before assignment. */
mozilla::PodArrayZero(elements_);
MOZ_GUARD_OBJECT_NOTIFIER_INIT;
}
unsigned length() const { return length_; }
const Value* begin() const { return elements_; }
Value* begin() { return elements_; }
HandleValue operator[](unsigned i) const {
MOZ_ASSERT(i < N);
return HandleValue::fromMarkedLocation(&elements_[i]);
}
MutableHandleValue operator[](unsigned i) {
MOZ_ASSERT(i < N);
return MutableHandleValue::fromMarkedLocation(&elements_[i]);
}
MOZ_DECL_USE_GUARD_OBJECT_NOTIFIER
};
template<class T>
class MOZ_RAII AutoVectorRooterBase : protected AutoGCRooter
{
typedef js::Vector<T, 8> VectorImpl;
VectorImpl vector;
public:
explicit AutoVectorRooterBase(JSContext* cx, ptrdiff_t tag
MOZ_GUARD_OBJECT_NOTIFIER_PARAM)
: AutoGCRooter(cx, tag), vector(cx)
{
MOZ_GUARD_OBJECT_NOTIFIER_INIT;
}
explicit AutoVectorRooterBase(js::ContextFriendFields* cx, ptrdiff_t tag
MOZ_GUARD_OBJECT_NOTIFIER_PARAM)
: AutoGCRooter(cx, tag), vector(cx)
{
MOZ_GUARD_OBJECT_NOTIFIER_INIT;
}
typedef T ElementType;
typedef typename VectorImpl::Range Range;
size_t length() const { return vector.length(); }
bool empty() const { return vector.empty(); }
MOZ_MUST_USE bool append(const T& v) { return vector.append(v); }
MOZ_MUST_USE bool appendN(const T& v, size_t len) { return vector.appendN(v, len); }
MOZ_MUST_USE bool append(const T* ptr, size_t len) { return vector.append(ptr, len); }
MOZ_MUST_USE bool appendAll(const AutoVectorRooterBase<T>& other) {
return vector.appendAll(other.vector);
}
MOZ_MUST_USE bool insert(T* p, const T& val) { return vector.insert(p, val); }
/* For use when space has already been reserved. */
void infallibleAppend(const T& v) { vector.infallibleAppend(v); }
void popBack() { vector.popBack(); }
T popCopy() { return vector.popCopy(); }
MOZ_MUST_USE bool growBy(size_t inc) {
size_t oldLength = vector.length();
if (!vector.growByUninitialized(inc))
return false;
makeRangeGCSafe(oldLength);
return true;
}
MOZ_MUST_USE bool resize(size_t newLength) {
size_t oldLength = vector.length();
if (newLength <= oldLength) {
vector.shrinkBy(oldLength - newLength);
return true;
}
if (!vector.growByUninitialized(newLength - oldLength))
return false;
makeRangeGCSafe(oldLength);
return true;
}
void clear() { vector.clear(); }
MOZ_MUST_USE bool reserve(size_t newLength) {
return vector.reserve(newLength);
}
JS::MutableHandle<T> operator[](size_t i) {
return JS::MutableHandle<T>::fromMarkedLocation(&vector[i]);
}
JS::Handle<T> operator[](size_t i) const {
return JS::Handle<T>::fromMarkedLocation(&vector[i]);
}
const T* begin() const { return vector.begin(); }
T* begin() { return vector.begin(); }
const T* end() const { return vector.end(); }
T* end() { return vector.end(); }
Range all() { return vector.all(); }
const T& back() const { return vector.back(); }
friend void AutoGCRooter::trace(JSTracer* trc);
private:
void makeRangeGCSafe(size_t oldLength) {
T* t = vector.begin() + oldLength;
for (size_t i = oldLength; i < vector.length(); ++i, ++t)
memset(t, 0, sizeof(T));
}
MOZ_DECL_USE_GUARD_OBJECT_NOTIFIER
};
template <typename T>
class MOZ_RAII AutoVectorRooter : public AutoVectorRooterBase<T>
{
public:
explicit AutoVectorRooter(JSContext* cx
MOZ_GUARD_OBJECT_NOTIFIER_PARAM)
: AutoVectorRooterBase<T>(cx, this->GetTag(T()))
{
MOZ_GUARD_OBJECT_NOTIFIER_INIT;
}
explicit AutoVectorRooter(js::ContextFriendFields* cx
MOZ_GUARD_OBJECT_NOTIFIER_PARAM)
: AutoVectorRooterBase<T>(cx, this->GetTag(T()))
{
MOZ_GUARD_OBJECT_NOTIFIER_INIT;
}
MOZ_DECL_USE_GUARD_OBJECT_NOTIFIER
};
class AutoValueVector : public Rooted<GCVector<Value, 8>> {
using Vec = GCVector<Value, 8>;
using Base = Rooted<Vec>;
public:
explicit AutoValueVector(JSContext* cx) : Base(cx, Vec(cx)) {}
explicit AutoValueVector(js::ContextFriendFields* cx) : Base(cx, Vec(cx)) {}
};
class AutoIdVector : public Rooted<GCVector<jsid, 8>> {
using Vec = GCVector<jsid, 8>;
using Base = Rooted<Vec>;
public:
explicit AutoIdVector(JSContext* cx) : Base(cx, Vec(cx)) {}
explicit AutoIdVector(js::ContextFriendFields* cx) : Base(cx, Vec(cx)) {}
bool appendAll(const AutoIdVector& other) { return this->Base::appendAll(other.get()); }
};
class AutoObjectVector : public Rooted<GCVector<JSObject*, 8>> {
using Vec = GCVector<JSObject*, 8>;
using Base = Rooted<Vec>;
public:
explicit AutoObjectVector(JSContext* cx) : Base(cx, Vec(cx)) {}
explicit AutoObjectVector(js::ContextFriendFields* cx) : Base(cx, Vec(cx)) {}
};
using ValueVector = JS::GCVector<JS::Value>;
using IdVector = JS::GCVector<jsid>;
using ScriptVector = JS::GCVector<JSScript*>;
using StringVector = JS::GCVector<JSString*>;
template<class Key, class Value>
class MOZ_RAII AutoHashMapRooter : protected AutoGCRooter
{
private:
typedef js::HashMap<Key, Value> HashMapImpl;
public:
explicit AutoHashMapRooter(JSContext* cx, ptrdiff_t tag
MOZ_GUARD_OBJECT_NOTIFIER_PARAM)
: AutoGCRooter(cx, tag), map(cx)
{
MOZ_GUARD_OBJECT_NOTIFIER_INIT;
}
typedef Key KeyType;
typedef Value ValueType;
typedef typename HashMapImpl::Entry Entry;
typedef typename HashMapImpl::Lookup Lookup;
typedef typename HashMapImpl::Ptr Ptr;
typedef typename HashMapImpl::AddPtr AddPtr;
bool init(uint32_t len = 16) {
return map.init(len);
}
bool initialized() const {
return map.initialized();
}
Ptr lookup(const Lookup& l) const {
return map.lookup(l);
}
void remove(Ptr p) {
map.remove(p);
}
AddPtr lookupForAdd(const Lookup& l) const {
return map.lookupForAdd(l);
}
template<typename KeyInput, typename ValueInput>
bool add(AddPtr& p, const KeyInput& k, const ValueInput& v) {
return map.add(p, k, v);
}
bool add(AddPtr& p, const Key& k) {
return map.add(p, k);
}
template<typename KeyInput, typename ValueInput>
bool relookupOrAdd(AddPtr& p, const KeyInput& k, const ValueInput& v) {
return map.relookupOrAdd(p, k, v);
}
typedef typename HashMapImpl::Range Range;
Range all() const {
return map.all();
}
typedef typename HashMapImpl::Enum Enum;
void clear() {
map.clear();
}
void finish() {
map.finish();
}
bool empty() const {
return map.empty();
}
uint32_t count() const {
return map.count();
}
size_t capacity() const {
return map.capacity();
}
size_t sizeOfExcludingThis(mozilla::MallocSizeOf mallocSizeOf) const {
return map.sizeOfExcludingThis(mallocSizeOf);
}
size_t sizeOfIncludingThis(mozilla::MallocSizeOf mallocSizeOf) const {
return map.sizeOfIncludingThis(mallocSizeOf);
}
/************************************************** Shorthand operations */
bool has(const Lookup& l) const {
return map.has(l);
}
template<typename KeyInput, typename ValueInput>
bool put(const KeyInput& k, const ValueInput& v) {
return map.put(k, v);
}
template<typename KeyInput, typename ValueInput>
bool putNew(const KeyInput& k, const ValueInput& v) {
return map.putNew(k, v);
}
Ptr lookupWithDefault(const Key& k, const Value& defaultValue) {
return map.lookupWithDefault(k, defaultValue);
}
void remove(const Lookup& l) {
map.remove(l);
}
friend void AutoGCRooter::trace(JSTracer* trc);
private:
AutoHashMapRooter(const AutoHashMapRooter& hmr) = delete;
AutoHashMapRooter& operator=(const AutoHashMapRooter& hmr) = delete;
HashMapImpl map;
MOZ_DECL_USE_GUARD_OBJECT_NOTIFIER
};
template<class T>
class MOZ_RAII AutoHashSetRooter : protected AutoGCRooter
{
private:
typedef js::HashSet<T> HashSetImpl;
public:
explicit AutoHashSetRooter(JSContext* cx, ptrdiff_t tag
MOZ_GUARD_OBJECT_NOTIFIER_PARAM)
: AutoGCRooter(cx, tag), set(cx)
{
MOZ_GUARD_OBJECT_NOTIFIER_INIT;
}
typedef typename HashSetImpl::Lookup Lookup;
typedef typename HashSetImpl::Ptr Ptr;
typedef typename HashSetImpl::AddPtr AddPtr;
bool init(uint32_t len = 16) {
return set.init(len);
}
bool initialized() const {
return set.initialized();
}
Ptr lookup(const Lookup& l) const {
return set.lookup(l);
}
void remove(Ptr p) {
set.remove(p);
}
AddPtr lookupForAdd(const Lookup& l) const {
return set.lookupForAdd(l);
}
bool add(AddPtr& p, const T& t) {
return set.add(p, t);
}
bool relookupOrAdd(AddPtr& p, const Lookup& l, const T& t) {
return set.relookupOrAdd(p, l, t);
}
typedef typename HashSetImpl::Range Range;
Range all() const {
return set.all();
}
typedef typename HashSetImpl::Enum Enum;
void clear() {
set.clear();
}
void finish() {
set.finish();
}
bool empty() const {
return set.empty();
}
uint32_t count() const {
return set.count();
}
size_t capacity() const {
return set.capacity();
}
size_t sizeOfExcludingThis(mozilla::MallocSizeOf mallocSizeOf) const {
return set.sizeOfExcludingThis(mallocSizeOf);
}
size_t sizeOfIncludingThis(mozilla::MallocSizeOf mallocSizeOf) const {
return set.sizeOfIncludingThis(mallocSizeOf);
}
/************************************************** Shorthand operations */
bool has(const Lookup& l) const {
return set.has(l);
}
bool put(const T& t) {
return set.put(t);
}
bool putNew(const T& t) {
return set.putNew(t);
}
void remove(const Lookup& l) {
set.remove(l);
}
friend void AutoGCRooter::trace(JSTracer* trc);
private:
AutoHashSetRooter(const AutoHashSetRooter& hmr) = delete;
AutoHashSetRooter& operator=(const AutoHashSetRooter& hmr) = delete;
HashSetImpl set;
MOZ_DECL_USE_GUARD_OBJECT_NOTIFIER
};
/**
* Custom rooting behavior for internal and external clients.
*/
class MOZ_RAII JS_PUBLIC_API(CustomAutoRooter) : private AutoGCRooter
{
public:
template <typename CX>
explicit CustomAutoRooter(const CX& cx MOZ_GUARD_OBJECT_NOTIFIER_PARAM)
: AutoGCRooter(cx, CUSTOM)
{
MOZ_GUARD_OBJECT_NOTIFIER_INIT;
}
friend void AutoGCRooter::trace(JSTracer* trc);
protected:
virtual ~CustomAutoRooter() {}
/** Supplied by derived class to trace roots. */
virtual void trace(JSTracer* trc) = 0;
private:
MOZ_DECL_USE_GUARD_OBJECT_NOTIFIER
};
/** A handle to an array of rooted values. */
class HandleValueArray
{
const size_t length_;
const Value * const elements_;
HandleValueArray(size_t len, const Value* elements) : length_(len), elements_(elements) {}
public:
explicit HandleValueArray(const RootedValue& value) : length_(1), elements_(value.address()) {}
MOZ_IMPLICIT HandleValueArray(const AutoValueVector& values)
: length_(values.length()), elements_(values.begin()) {}
template <size_t N>
MOZ_IMPLICIT HandleValueArray(const AutoValueArray<N>& values) : length_(N), elements_(values.begin()) {}
/** CallArgs must already be rooted somewhere up the stack. */
MOZ_IMPLICIT HandleValueArray(const JS::CallArgs& args) : length_(args.length()), elements_(args.array()) {}
/** Use with care! Only call this if the data is guaranteed to be marked. */
static HandleValueArray fromMarkedLocation(size_t len, const Value* elements) {
return HandleValueArray(len, elements);
}
static HandleValueArray subarray(const HandleValueArray& values, size_t startIndex, size_t len) {
MOZ_ASSERT(startIndex + len <= values.length());
return HandleValueArray(len, values.begin() + startIndex);
}
static HandleValueArray empty() {
return HandleValueArray(0, nullptr);
}
size_t length() const { return length_; }
const Value* begin() const { return elements_; }
HandleValue operator[](size_t i) const {
MOZ_ASSERT(i < length_);
return HandleValue::fromMarkedLocation(&elements_[i]);
}
};
} /* namespace JS */
/************************************************************************/
struct JSFreeOp {
protected:
JSRuntime* runtime_;
explicit JSFreeOp(JSRuntime* rt)
: runtime_(rt) { }
public:
JSRuntime* runtime() const {
MOZ_ASSERT(runtime_);
return runtime_;
}
};
/* Callbacks and their arguments. */
/************************************************************************/
typedef enum JSGCStatus {
JSGC_BEGIN,
JSGC_END
} JSGCStatus;
typedef void
(* JSGCCallback)(JSContext* cx, JSGCStatus status, void* data);
typedef void
(* JSObjectsTenuredCallback)(JSContext* cx, void* data);
typedef enum JSFinalizeStatus {
/**
* Called when preparing to sweep a group of zones, before anything has been
* swept. The collector will not yield to the mutator before calling the
* callback with JSFINALIZE_GROUP_END status.
*/
JSFINALIZE_GROUP_START,
/**
* Called when preparing to sweep a group of zones. Weak references to
* unmarked things have been removed and things that are not swept
* incrementally have been finalized at this point. The collector may yield
* to the mutator after this point.
*/
JSFINALIZE_GROUP_END,
/**
* Called at the end of collection when everything has been swept.
*/
JSFINALIZE_COLLECTION_END
} JSFinalizeStatus;
typedef void
(* JSFinalizeCallback)(JSFreeOp* fop, JSFinalizeStatus status, bool isZoneGC, void* data);
typedef void
(* JSWeakPointerZoneGroupCallback)(JSContext* cx, void* data);
typedef void
(* JSWeakPointerCompartmentCallback)(JSContext* cx, JSCompartment* comp, void* data);
typedef bool
(* JSInterruptCallback)(JSContext* cx);
typedef JSObject*
(* JSGetIncumbentGlobalCallback)(JSContext* cx);
typedef bool
(* JSEnqueuePromiseJobCallback)(JSContext* cx, JS::HandleObject job,
JS::HandleObject allocationSite, JS::HandleObject incumbentGlobal,
void* data);
enum class PromiseRejectionHandlingState {
Unhandled,
Handled
};
typedef void
(* JSPromiseRejectionTrackerCallback)(JSContext* cx, JS::HandleObject promise,
PromiseRejectionHandlingState state, void* data);
typedef void
(* JSProcessPromiseCallback)(JSContext* cx, JS::HandleObject promise);
/**
* Possible exception types. These types are part of a JSErrorFormatString
* structure. They define which error to throw in case of a runtime error.
*
* JSEXN_WARN is used for warnings in js.msg files (for instance because we
* don't want to prepend 'Error:' to warning messages). This value can go away
* if we ever decide to use an entirely separate mechanism for warnings.
*/
typedef enum JSExnType {
JSEXN_ERR,
JSEXN_FIRST = JSEXN_ERR,
JSEXN_INTERNALERR,
JSEXN_EVALERR,
JSEXN_RANGEERR,
JSEXN_REFERENCEERR,
JSEXN_SYNTAXERR,
JSEXN_TYPEERR,
JSEXN_URIERR,
JSEXN_DEBUGGEEWOULDRUN,
JSEXN_WASMCOMPILEERROR,
JSEXN_WASMRUNTIMEERROR,
JSEXN_WARN,
JSEXN_LIMIT
} JSExnType;
typedef struct JSErrorFormatString {
/** The error message name in ASCII. */
const char* name;
/** The error format string in ASCII. */
const char* format;
/** The number of arguments to expand in the formatted error message. */
uint16_t argCount;
/** One of the JSExnType constants above. */
int16_t exnType;
} JSErrorFormatString;
typedef const JSErrorFormatString*
(* JSErrorCallback)(void* userRef, const unsigned errorNumber);
typedef bool
(* JSLocaleToUpperCase)(JSContext* cx, JS::HandleString src, JS::MutableHandleValue rval);
typedef bool
(* JSLocaleToLowerCase)(JSContext* cx, JS::HandleString src, JS::MutableHandleValue rval);
typedef bool
(* JSLocaleCompare)(JSContext* cx, JS::HandleString src1, JS::HandleString src2,
JS::MutableHandleValue rval);
typedef bool
(* JSLocaleToUnicode)(JSContext* cx, const char* src, JS::MutableHandleValue rval);
/**
* Callback used to ask the embedding for the cross compartment wrapper handler
* that implements the desired prolicy for this kind of object in the
* destination compartment. |obj| is the object to be wrapped. If |existing| is
* non-nullptr, it will point to an existing wrapper object that should be
* re-used if possible. |existing| is guaranteed to be a cross-compartment
* wrapper with a lazily-defined prototype and the correct global. It is
* guaranteed not to wrap a function.
*/
typedef JSObject*
(* JSWrapObjectCallback)(JSContext* cx, JS::HandleObject existing, JS::HandleObject obj);
/**
* Callback used by the wrap hook to ask the embedding to prepare an object
* for wrapping in a context. This might include unwrapping other wrappers
* or even finding a more suitable object for the new compartment.
*/
typedef void
(* JSPreWrapCallback)(JSContext* cx, JS::HandleObject scope, JS::HandleObject obj,
JS::HandleObject objectPassedToWrap,
JS::MutableHandleObject retObj);
struct JSWrapObjectCallbacks
{
JSWrapObjectCallback wrap;
JSPreWrapCallback preWrap;
};
typedef void
(* JSDestroyCompartmentCallback)(JSFreeOp* fop, JSCompartment* compartment);
typedef size_t
(* JSSizeOfIncludingThisCompartmentCallback)(mozilla::MallocSizeOf mallocSizeOf,
JSCompartment* compartment);
typedef void
(* JSZoneCallback)(JS::Zone* zone);
typedef void
(* JSCompartmentNameCallback)(JSContext* cx, JSCompartment* compartment,
char* buf, size_t bufsize);
/************************************************************************/
static MOZ_ALWAYS_INLINE JS::Value
JS_NumberValue(double d)
{
int32_t i;
d = JS::CanonicalizeNaN(d);
if (mozilla::NumberIsInt32(d, &i))
return JS::Int32Value(i);
return JS::DoubleValue(d);
}
/************************************************************************/
JS_PUBLIC_API(bool)
JS_StringHasBeenPinned(JSContext* cx, JSString* str);
namespace JS {
/**
* Container class for passing in script source buffers to the JS engine. This
* not only groups the buffer and length values, it also provides a way to
* optionally pass ownership of the buffer to the JS engine without copying.
* Rules for use:
*
* 1) The data array must be allocated with js_malloc() or js_realloc() if
* ownership is being granted to the SourceBufferHolder.
* 2) If ownership is not given to the SourceBufferHolder, then the memory
* must be kept alive until the JS compilation is complete.
* 3) Any code calling SourceBufferHolder::take() must guarantee to keep the
* memory alive until JS compilation completes. Normally only the JS
* engine should be calling take().
*
* Example use:
*
* size_t length = 512;
* char16_t* chars = static_cast<char16_t*>(js_malloc(sizeof(char16_t) * length));
* JS::SourceBufferHolder srcBuf(chars, length, JS::SourceBufferHolder::GiveOwnership);
* JS::Compile(cx, options, srcBuf);
*/
class MOZ_STACK_CLASS SourceBufferHolder final
{
public:
enum Ownership {
NoOwnership,
GiveOwnership
};
SourceBufferHolder(const char16_t* data, size_t dataLength, Ownership ownership)
: data_(data),
length_(dataLength),
ownsChars_(ownership == GiveOwnership)
{
// Ensure that null buffers properly return an unowned, empty,
// null-terminated string.
static const char16_t NullChar_ = 0;
if (!get()) {
data_ = &NullChar_;
length_ = 0;
ownsChars_ = false;
}
}
SourceBufferHolder(SourceBufferHolder&& other)
: data_(other.data_),
length_(other.length_),
ownsChars_(other.ownsChars_)
{
other.data_ = nullptr;
other.length_ = 0;
other.ownsChars_ = false;
}
~SourceBufferHolder() {
if (ownsChars_)
js_free(const_cast<char16_t*>(data_));
}
// Access the underlying source buffer without affecting ownership.
const char16_t* get() const { return data_; }
// Length of the source buffer in char16_t code units (not bytes)
size_t length() const { return length_; }
// Returns true if the SourceBufferHolder owns the buffer and will free
// it upon destruction. If true, it is legal to call take().
bool ownsChars() const { return ownsChars_; }
// Retrieve and take ownership of the underlying data buffer. The caller
// is now responsible for calling js_free() on the returned value, *but only
// after JS script compilation has completed*.
//
// After the buffer has been taken the SourceBufferHolder functions as if
// it had been constructed on an unowned buffer; get() and length() still
// work. In order for this to be safe the taken buffer must be kept alive
// until after JS script compilation completes as noted above.
//
// Note, it's the caller's responsibility to check ownsChars() before taking
// the buffer. Taking and then free'ing an unowned buffer will have dire
// consequences.
char16_t* take() {
MOZ_ASSERT(ownsChars_);
ownsChars_ = false;
return const_cast<char16_t*>(data_);
}
private:
SourceBufferHolder(SourceBufferHolder&) = delete;
SourceBufferHolder& operator=(SourceBufferHolder&) = delete;
const char16_t* data_;
size_t length_;
bool ownsChars_;
};
} /* namespace JS */
/************************************************************************/
/* Property attributes, set in JSPropertySpec and passed to API functions.
*
* NB: The data structure in which some of these values are stored only uses
* a uint8_t to store the relevant information. Proceed with caution if
* trying to reorder or change the the first byte worth of flags.
*/
#define JSPROP_ENUMERATE 0x01 /* property is visible to for/in loop */
#define JSPROP_READONLY 0x02 /* not settable: assignment is no-op.
This flag is only valid when neither
JSPROP_GETTER nor JSPROP_SETTER is
set. */
#define JSPROP_PERMANENT 0x04 /* property cannot be deleted */
#define JSPROP_PROPOP_ACCESSORS 0x08 /* Passed to JS_Define(UC)Property* and
JS_DefineElement if getters/setters
are JSGetterOp/JSSetterOp */
#define JSPROP_GETTER 0x10 /* property holds getter function */
#define JSPROP_SETTER 0x20 /* property holds setter function */
#define JSPROP_SHARED 0x40 /* don't allocate a value slot for this
property; don't copy the property on
set of the same-named property in an
object that delegates to a prototype
containing this property */
#define JSPROP_INTERNAL_USE_BIT 0x80 /* internal JS engine use only */
#define JSFUN_STUB_GSOPS 0x200 /* use JS_PropertyStub getter/setter
instead of defaulting to class gsops
for property holding function */
#define JSFUN_CONSTRUCTOR 0x400 /* native that can be called as a ctor */
// 0x800 /* Unused */
#define JSFUN_HAS_REST 0x1000 /* function has ...rest parameter. */
#define JSFUN_FLAGS_MASK 0x1e00 /* | of all the JSFUN_* flags */
/*
* If set, will allow redefining a non-configurable property, but only on a
* non-DOM global. This is a temporary hack that will need to go away in bug
* 1105518.
*/
#define JSPROP_REDEFINE_NONCONFIGURABLE 0x1000
/*
* Resolve hooks and enumerate hooks must pass this flag when calling
* JS_Define* APIs to reify lazily-defined properties.
*
* JSPROP_RESOLVING is used only with property-defining APIs. It tells the
* engine to skip the resolve hook when performing the lookup at the beginning
* of property definition. This keeps the resolve hook from accidentally
* triggering itself: unchecked recursion.
*
* For enumerate hooks, triggering the resolve hook would be merely silly, not
* fatal, except in some cases involving non-configurable properties.
*/
#define JSPROP_RESOLVING 0x2000
#define JSPROP_IGNORE_ENUMERATE 0x4000 /* ignore the value in JSPROP_ENUMERATE.
This flag only valid when defining over
an existing property. */
#define JSPROP_IGNORE_READONLY 0x8000 /* ignore the value in JSPROP_READONLY.
This flag only valid when defining over
an existing property. */
#define JSPROP_IGNORE_PERMANENT 0x10000 /* ignore the value in JSPROP_PERMANENT.
This flag only valid when defining over
an existing property. */
#define JSPROP_IGNORE_VALUE 0x20000 /* ignore the Value in the descriptor. Nothing was
specified when passed to Object.defineProperty
from script. */
/** Microseconds since the epoch, midnight, January 1, 1970 UTC. */
extern JS_PUBLIC_API(int64_t)
JS_Now(void);
/** Don't want to export data, so provide accessors for non-inline Values. */
extern JS_PUBLIC_API(JS::Value)
JS_GetNaNValue(JSContext* cx);
extern JS_PUBLIC_API(JS::Value)
JS_GetNegativeInfinityValue(JSContext* cx);
extern JS_PUBLIC_API(JS::Value)
JS_GetPositiveInfinityValue(JSContext* cx);
extern JS_PUBLIC_API(JS::Value)
JS_GetEmptyStringValue(JSContext* cx);
extern JS_PUBLIC_API(JSString*)
JS_GetEmptyString(JSContext* cx);
extern JS_PUBLIC_API(bool)
JS_ValueToObject(JSContext* cx, JS::HandleValue v, JS::MutableHandleObject objp);
extern JS_PUBLIC_API(JSFunction*)
JS_ValueToFunction(JSContext* cx, JS::HandleValue v);
extern JS_PUBLIC_API(JSFunction*)
JS_ValueToConstructor(JSContext* cx, JS::HandleValue v);
extern JS_PUBLIC_API(JSString*)
JS_ValueToSource(JSContext* cx, JS::Handle<JS::Value> v);
extern JS_PUBLIC_API(bool)
JS_DoubleIsInt32(double d, int32_t* ip);
extern JS_PUBLIC_API(JSType)
JS_TypeOfValue(JSContext* cx, JS::Handle<JS::Value> v);
namespace JS {
extern JS_PUBLIC_API(const char*)
InformalValueTypeName(const JS::Value& v);
} /* namespace JS */
extern JS_PUBLIC_API(bool)
JS_StrictlyEqual(JSContext* cx, JS::Handle<JS::Value> v1, JS::Handle<JS::Value> v2, bool* equal);
extern JS_PUBLIC_API(bool)
JS_LooselyEqual(JSContext* cx, JS::Handle<JS::Value> v1, JS::Handle<JS::Value> v2, bool* equal);
extern JS_PUBLIC_API(bool)
JS_SameValue(JSContext* cx, JS::Handle<JS::Value> v1, JS::Handle<JS::Value> v2, bool* same);
/** True iff fun is the global eval function. */
extern JS_PUBLIC_API(bool)
JS_IsBuiltinEvalFunction(JSFunction* fun);
/** True iff fun is the Function constructor. */
extern JS_PUBLIC_API(bool)
JS_IsBuiltinFunctionConstructor(JSFunction* fun);
/************************************************************************/
/*
* Locking, contexts, and memory allocation.
*
* It is important that SpiderMonkey be initialized, and the first context
* be created, in a single-threaded fashion. Otherwise the behavior of the
* library is undefined.
* See: http://developer.mozilla.org/en/docs/Category:JSAPI_Reference
*/
extern JS_PUBLIC_API(JSContext*)
JS_NewContext(uint32_t maxbytes,
uint32_t maxNurseryBytes = JS::DefaultNurseryBytes,
JSContext* parentContext = nullptr);
extern JS_PUBLIC_API(void)
JS_DestroyContext(JSContext* cx);
typedef double (*JS_CurrentEmbedderTimeFunction)();
/**
* The embedding can specify a time function that will be used in some
* situations. The function can return the time however it likes; but
* the norm is to return times in units of milliseconds since an
* arbitrary, but consistent, epoch. If the time function is not set,
* a built-in default will be used.
*/
JS_PUBLIC_API(void)
JS_SetCurrentEmbedderTimeFunction(JS_CurrentEmbedderTimeFunction timeFn);
/**
* Return the time as computed using the current time function, or a
* suitable default if one has not been set.
*/
JS_PUBLIC_API(double)
JS_GetCurrentEmbedderTime();
JS_PUBLIC_API(void*)
JS_GetContextPrivate(JSContext* cx);
JS_PUBLIC_API(void)
JS_SetContextPrivate(JSContext* cx, void* data);
extern JS_PUBLIC_API(JSContext*)
JS_GetParentContext(JSContext* cx);
extern JS_PUBLIC_API(void)
JS_BeginRequest(JSContext* cx);
extern JS_PUBLIC_API(void)
JS_EndRequest(JSContext* cx);
extern JS_PUBLIC_API(void)
JS_SetFutexCanWait(JSContext* cx);
namespace js {
void
AssertHeapIsIdle(JSRuntime* rt);
} /* namespace js */
class MOZ_RAII JSAutoRequest
{
public:
explicit JSAutoRequest(JSContext* cx
MOZ_GUARD_OBJECT_NOTIFIER_PARAM)
: mContext(cx)
{
MOZ_GUARD_OBJECT_NOTIFIER_INIT;
JS_BeginRequest(mContext);
}
~JSAutoRequest() {
JS_EndRequest(mContext);
}
protected:
JSContext* mContext;
MOZ_DECL_USE_GUARD_OBJECT_NOTIFIER
#if 0
private:
static void* operator new(size_t) CPP_THROW_NEW { return 0; }
static void operator delete(void*, size_t) { }
#endif
};
extern JS_PUBLIC_API(JSVersion)
JS_GetVersion(JSContext* cx);
/**
* Mutate the version on the compartment. This is generally discouraged, but
* necessary to support the version mutation in the js and xpc shell command
* set.
*
* It would be nice to put this in jsfriendapi, but the linkage requirements
* of the shells make that impossible.
*/
JS_PUBLIC_API(void)
JS_SetVersionForCompartment(JSCompartment* compartment, JSVersion version);
extern JS_PUBLIC_API(const char*)
JS_VersionToString(JSVersion version);
extern JS_PUBLIC_API(JSVersion)
JS_StringToVersion(const char* string);
namespace JS {
class JS_PUBLIC_API(ContextOptions) {
public:
ContextOptions()
: baseline_(true),
ion_(true),
asmJS_(true),
wasm_(false),
wasmAlwaysBaseline_(false),
throwOnAsmJSValidationFailure_(false),
nativeRegExp_(true),
unboxedArrays_(false),
asyncStack_(true),
throwOnDebuggeeWouldRun_(true),
dumpStackOnDebuggeeWouldRun_(false),
werror_(false),
strictMode_(false),
extraWarnings_(false)
{
}
bool baseline() const { return baseline_; }
ContextOptions& setBaseline(bool flag) {
baseline_ = flag;
return *this;
}
ContextOptions& toggleBaseline() {
baseline_ = !baseline_;
return *this;
}
bool ion() const { return ion_; }
ContextOptions& setIon(bool flag) {
ion_ = flag;
return *this;
}
ContextOptions& toggleIon() {
ion_ = !ion_;
return *this;
}
bool asmJS() const { return asmJS_; }
ContextOptions& setAsmJS(bool flag) {
asmJS_ = flag;
return *this;
}
ContextOptions& toggleAsmJS() {
asmJS_ = !asmJS_;
return *this;
}
bool wasm() const { return wasm_; }
ContextOptions& setWasm(bool flag) {
wasm_ = flag;
return *this;
}
ContextOptions& toggleWasm() {
wasm_ = !wasm_;
return *this;
}
bool wasmAlwaysBaseline() const { return wasmAlwaysBaseline_; }
ContextOptions& setWasmAlwaysBaseline(bool flag) {
wasmAlwaysBaseline_ = flag;
return *this;
}
ContextOptions& toggleWasmAlwaysBaseline() {
wasmAlwaysBaseline_ = !wasmAlwaysBaseline_;
return *this;
}
bool throwOnAsmJSValidationFailure() const { return throwOnAsmJSValidationFailure_; }
ContextOptions& setThrowOnAsmJSValidationFailure(bool flag) {
throwOnAsmJSValidationFailure_ = flag;
return *this;
}
ContextOptions& toggleThrowOnAsmJSValidationFailure() {
throwOnAsmJSValidationFailure_ = !throwOnAsmJSValidationFailure_;
return *this;
}
bool nativeRegExp() const { return nativeRegExp_; }
ContextOptions& setNativeRegExp(bool flag) {
nativeRegExp_ = flag;
return *this;
}
bool unboxedArrays() const { return unboxedArrays_; }
ContextOptions& setUnboxedArrays(bool flag) {
unboxedArrays_ = flag;
return *this;
}
bool asyncStack() const { return asyncStack_; }
ContextOptions& setAsyncStack(bool flag) {
asyncStack_ = flag;
return *this;
}
bool throwOnDebuggeeWouldRun() const { return throwOnDebuggeeWouldRun_; }
ContextOptions& setThrowOnDebuggeeWouldRun(bool flag) {
throwOnDebuggeeWouldRun_ = flag;
return *this;
}
bool dumpStackOnDebuggeeWouldRun() const { return dumpStackOnDebuggeeWouldRun_; }
ContextOptions& setDumpStackOnDebuggeeWouldRun(bool flag) {
dumpStackOnDebuggeeWouldRun_ = flag;
return *this;
}
bool werror() const { return werror_; }
ContextOptions& setWerror(bool flag) {
werror_ = flag;
return *this;
}
ContextOptions& toggleWerror() {
werror_ = !werror_;
return *this;
}
bool strictMode() const { return strictMode_; }
ContextOptions& setStrictMode(bool flag) {
strictMode_ = flag;
return *this;
}
ContextOptions& toggleStrictMode() {
strictMode_ = !strictMode_;
return *this;
}
bool extraWarnings() const { return extraWarnings_; }
ContextOptions& setExtraWarnings(bool flag) {
extraWarnings_ = flag;
return *this;
}
ContextOptions& toggleExtraWarnings() {
extraWarnings_ = !extraWarnings_;
return *this;
}
private:
bool baseline_ : 1;
bool ion_ : 1;
bool asmJS_ : 1;
bool wasm_ : 1;
bool wasmAlwaysBaseline_ : 1;
bool throwOnAsmJSValidationFailure_ : 1;
bool nativeRegExp_ : 1;
bool unboxedArrays_ : 1;
bool asyncStack_ : 1;
bool throwOnDebuggeeWouldRun_ : 1;
bool dumpStackOnDebuggeeWouldRun_ : 1;
bool werror_ : 1;
bool strictMode_ : 1;
bool extraWarnings_ : 1;
};
JS_PUBLIC_API(ContextOptions&)
ContextOptionsRef(JSContext* cx);
/**
* Initialize the runtime's self-hosted code. Embeddings should call this
* exactly once per runtime/context, before the first JS_NewGlobalObject
* call.
*/
JS_PUBLIC_API(bool)
InitSelfHostedCode(JSContext* cx);
/**
* Asserts (in debug and release builds) that `obj` belongs to the current
* thread's context.
*/
JS_PUBLIC_API(void)
AssertObjectBelongsToCurrentThread(JSObject* obj);
} /* namespace JS */
extern JS_PUBLIC_API(const char*)
JS_GetImplementationVersion(void);
extern JS_PUBLIC_API(void)
JS_SetDestroyCompartmentCallback(JSContext* cx, JSDestroyCompartmentCallback callback);
extern JS_PUBLIC_API(void)
JS_SetSizeOfIncludingThisCompartmentCallback(JSContext* cx,
JSSizeOfIncludingThisCompartmentCallback callback);
extern JS_PUBLIC_API(void)
JS_SetDestroyZoneCallback(JSContext* cx, JSZoneCallback callback);
extern JS_PUBLIC_API(void)
JS_SetSweepZoneCallback(JSContext* cx, JSZoneCallback callback);
extern JS_PUBLIC_API(void)
JS_SetCompartmentNameCallback(JSContext* cx, JSCompartmentNameCallback callback);
extern JS_PUBLIC_API(void)
JS_SetWrapObjectCallbacks(JSContext* cx, const JSWrapObjectCallbacks* callbacks);
extern JS_PUBLIC_API(void)
JS_SetCompartmentPrivate(JSCompartment* compartment, void* data);
extern JS_PUBLIC_API(void*)
JS_GetCompartmentPrivate(JSCompartment* compartment);
extern JS_PUBLIC_API(void)
JS_SetZoneUserData(JS::Zone* zone, void* data);
extern JS_PUBLIC_API(void*)
JS_GetZoneUserData(JS::Zone* zone);
extern JS_PUBLIC_API(bool)
JS_WrapObject(JSContext* cx, JS::MutableHandleObject objp);
extern JS_PUBLIC_API(bool)
JS_WrapValue(JSContext* cx, JS::MutableHandleValue vp);
extern JS_PUBLIC_API(JSObject*)
JS_TransplantObject(JSContext* cx, JS::HandleObject origobj, JS::HandleObject target);
extern JS_PUBLIC_API(bool)
JS_RefreshCrossCompartmentWrappers(JSContext* cx, JS::Handle<JSObject*> obj);
/*
* At any time, a JSContext has a current (possibly-nullptr) compartment.
* Compartments are described in:
*
* developer.mozilla.org/en-US/docs/SpiderMonkey/SpiderMonkey_compartments
*
* The current compartment of a context may be changed. The preferred way to do
* this is with JSAutoCompartment:
*
* void foo(JSContext* cx, JSObject* obj) {
* // in some compartment 'c'
* {
* JSAutoCompartment ac(cx, obj); // constructor enters
* // in the compartment of 'obj'
* } // destructor leaves
* // back in compartment 'c'
* }
*
* For more complicated uses that don't neatly fit in a C++ stack frame, the
* compartment can entered and left using separate function calls:
*
* void foo(JSContext* cx, JSObject* obj) {
* // in 'oldCompartment'
* JSCompartment* oldCompartment = JS_EnterCompartment(cx, obj);
* // in the compartment of 'obj'
* JS_LeaveCompartment(cx, oldCompartment);
* // back in 'oldCompartment'
* }
*
* Note: these calls must still execute in a LIFO manner w.r.t all other
* enter/leave calls on the context. Furthermore, only the return value of a
* JS_EnterCompartment call may be passed as the 'oldCompartment' argument of
* the corresponding JS_LeaveCompartment call.
*/
class MOZ_RAII JS_PUBLIC_API(JSAutoCompartment)
{
JSContext* cx_;
JSCompartment* oldCompartment_;
public:
JSAutoCompartment(JSContext* cx, JSObject* target
MOZ_GUARD_OBJECT_NOTIFIER_PARAM);
JSAutoCompartment(JSContext* cx, JSScript* target
MOZ_GUARD_OBJECT_NOTIFIER_PARAM);
~JSAutoCompartment();
MOZ_DECL_USE_GUARD_OBJECT_NOTIFIER
};
class MOZ_RAII JS_PUBLIC_API(JSAutoNullableCompartment)
{
JSContext* cx_;
JSCompartment* oldCompartment_;
public:
explicit JSAutoNullableCompartment(JSContext* cx, JSObject* targetOrNull
MOZ_GUARD_OBJECT_NOTIFIER_PARAM);
~JSAutoNullableCompartment();
MOZ_DECL_USE_GUARD_OBJECT_NOTIFIER
};
/** NB: This API is infallible; a nullptr return value does not indicate error. */
extern JS_PUBLIC_API(JSCompartment*)
JS_EnterCompartment(JSContext* cx, JSObject* target);
extern JS_PUBLIC_API(void)
JS_LeaveCompartment(JSContext* cx, JSCompartment* oldCompartment);
typedef void (*JSIterateCompartmentCallback)(JSContext* cx, void* data, JSCompartment* compartment);
/**
* This function calls |compartmentCallback| on every compartment. Beware that
* there is no guarantee that the compartment will survive after the callback
* returns. Also, barriers are disabled via the TraceSession.
*/
extern JS_PUBLIC_API(void)
JS_IterateCompartments(JSContext* cx, void* data,
JSIterateCompartmentCallback compartmentCallback);
/**
* Initialize standard JS class constructors, prototypes, and any top-level
* functions and constants associated with the standard classes (e.g. isNaN
* for Number).
*
* NB: This sets cx's global object to obj if it was null.
*/
extern JS_PUBLIC_API(bool)
JS_InitStandardClasses(JSContext* cx, JS::Handle<JSObject*> obj);
/**
* Resolve id, which must contain either a string or an int, to a standard
* class name in obj if possible, defining the class's constructor and/or
* prototype and storing true in *resolved. If id does not name a standard
* class or a top-level property induced by initializing a standard class,
* store false in *resolved and just return true. Return false on error,
* as usual for bool result-typed API entry points.
*
* This API can be called directly from a global object class's resolve op,
* to define standard classes lazily. The class's enumerate op should call
* JS_EnumerateStandardClasses(cx, obj), to define eagerly during for..in
* loops any classes not yet resolved lazily.
*/
extern JS_PUBLIC_API(bool)
JS_ResolveStandardClass(JSContext* cx, JS::HandleObject obj, JS::HandleId id, bool* resolved);
extern JS_PUBLIC_API(bool)
JS_MayResolveStandardClass(const JSAtomState& names, jsid id, JSObject* maybeObj);
extern JS_PUBLIC_API(bool)
JS_EnumerateStandardClasses(JSContext* cx, JS::HandleObject obj);
extern JS_PUBLIC_API(bool)
JS_GetClassObject(JSContext* cx, JSProtoKey key, JS::MutableHandle<JSObject*> objp);
extern JS_PUBLIC_API(bool)
JS_GetClassPrototype(JSContext* cx, JSProtoKey key, JS::MutableHandle<JSObject*> objp);
namespace JS {
/*
* Determine if the given object is an instance/prototype/constructor for a standard
* class. If so, return the associated JSProtoKey. If not, return JSProto_Null.
*/
extern JS_PUBLIC_API(JSProtoKey)
IdentifyStandardInstance(JSObject* obj);
extern JS_PUBLIC_API(JSProtoKey)
IdentifyStandardPrototype(JSObject* obj);
extern JS_PUBLIC_API(JSProtoKey)
IdentifyStandardInstanceOrPrototype(JSObject* obj);
extern JS_PUBLIC_API(JSProtoKey)
IdentifyStandardConstructor(JSObject* obj);
extern JS_PUBLIC_API(void)
ProtoKeyToId(JSContext* cx, JSProtoKey key, JS::MutableHandleId idp);
} /* namespace JS */
extern JS_PUBLIC_API(JSProtoKey)
JS_IdToProtoKey(JSContext* cx, JS::HandleId id);
/**
* Returns the original value of |Function.prototype| from the global object in
* which |forObj| was created.
*/
extern JS_PUBLIC_API(JSObject*)
JS_GetFunctionPrototype(JSContext* cx, JS::HandleObject forObj);
/**
* Returns the original value of |Object.prototype| from the global object in
* which |forObj| was created.
*/
extern JS_PUBLIC_API(JSObject*)
JS_GetObjectPrototype(JSContext* cx, JS::HandleObject forObj);
/**
* Returns the original value of |Array.prototype| from the global object in
* which |forObj| was created.
*/
extern JS_PUBLIC_API(JSObject*)
JS_GetArrayPrototype(JSContext* cx, JS::HandleObject forObj);
/**
* Returns the original value of |Error.prototype| from the global
* object of the current compartment of cx.
*/
extern JS_PUBLIC_API(JSObject*)
JS_GetErrorPrototype(JSContext* cx);
/**
* Returns the %IteratorPrototype% object that all built-in iterator prototype
* chains go through for the global object of the current compartment of cx.
*/
extern JS_PUBLIC_API(JSObject*)
JS_GetIteratorPrototype(JSContext* cx);
extern JS_PUBLIC_API(JSObject*)
JS_GetGlobalForObject(JSContext* cx, JSObject* obj);
extern JS_PUBLIC_API(bool)
JS_IsGlobalObject(JSObject* obj);
extern JS_PUBLIC_API(JSObject*)
JS_GlobalLexicalEnvironment(JSObject* obj);
extern JS_PUBLIC_API(bool)
JS_HasExtensibleLexicalEnvironment(JSObject* obj);
extern JS_PUBLIC_API(JSObject*)
JS_ExtensibleLexicalEnvironment(JSObject* obj);
/**
* May return nullptr, if |c| never had a global (e.g. the atoms compartment),
* or if |c|'s global has been collected.
*/
extern JS_PUBLIC_API(JSObject*)
JS_GetGlobalForCompartmentOrNull(JSContext* cx, JSCompartment* c);
namespace JS {
extern JS_PUBLIC_API(JSObject*)
CurrentGlobalOrNull(JSContext* cx);
} // namespace JS
/**
* Add 'Reflect.parse', a SpiderMonkey extension, to the Reflect object on the
* given global.
*/
extern JS_PUBLIC_API(bool)
JS_InitReflectParse(JSContext* cx, JS::HandleObject global);
/**
* Add various profiling-related functions as properties of the given object.
* Defined in builtin/Profilers.cpp.
*/
extern JS_PUBLIC_API(bool)
JS_DefineProfilingFunctions(JSContext* cx, JS::HandleObject obj);
/* Defined in vm/Debugger.cpp. */
extern JS_PUBLIC_API(bool)
JS_DefineDebuggerObject(JSContext* cx, JS::HandleObject obj);
#ifdef JS_HAS_CTYPES
/**
* Initialize the 'ctypes' object on a global variable 'obj'. The 'ctypes'
* object will be sealed.
*/
extern JS_PUBLIC_API(bool)
JS_InitCTypesClass(JSContext* cx, JS::HandleObject global);
/**
* Convert a unicode string 'source' of length 'slen' to the platform native
* charset, returning a null-terminated string allocated with JS_malloc. On
* failure, this function should report an error.
*/
typedef char*
(* JSCTypesUnicodeToNativeFun)(JSContext* cx, const char16_t* source, size_t slen);
/**
* Set of function pointers that ctypes can use for various internal functions.
* See JS_SetCTypesCallbacks below. Providing nullptr for a function is safe,
* and will result in the applicable ctypes functionality not being available.
*/
struct JSCTypesCallbacks {
JSCTypesUnicodeToNativeFun unicodeToNative;
};
typedef struct JSCTypesCallbacks JSCTypesCallbacks;
/**
* Set the callbacks on the provided 'ctypesObj' object. 'callbacks' should be a
* pointer to static data that exists for the lifetime of 'ctypesObj', but it
* may safely be altered after calling this function and without having
* to call this function again.
*/
extern JS_PUBLIC_API(void)
JS_SetCTypesCallbacks(JSObject* ctypesObj, const JSCTypesCallbacks* callbacks);
#endif
extern JS_PUBLIC_API(void*)
JS_malloc(JSContext* cx, size_t nbytes);
extern JS_PUBLIC_API(void*)
JS_realloc(JSContext* cx, void* p, size_t oldBytes, size_t newBytes);
/**
* A wrapper for js_free(p) that may delay js_free(p) invocation as a
* performance optimization.
* cx may be nullptr.
*/
extern JS_PUBLIC_API(void)
JS_free(JSContext* cx, void* p);
/**
* A wrapper for js_free(p) that may delay js_free(p) invocation as a
* performance optimization as specified by the given JSFreeOp instance.
*/
extern JS_PUBLIC_API(void)
JS_freeop(JSFreeOp* fop, void* p);
extern JS_PUBLIC_API(void)
JS_updateMallocCounter(JSContext* cx, size_t nbytes);
extern JS_PUBLIC_API(char*)
JS_strdup(JSContext* cx, const char* s);
/**
* Register externally maintained GC roots.
*
* traceOp: the trace operation. For each root the implementation should call
* JS::TraceEdge whenever the root contains a traceable thing.
* data: the data argument to pass to each invocation of traceOp.
*/
extern JS_PUBLIC_API(bool)
JS_AddExtraGCRootsTracer(JSContext* cx, JSTraceDataOp traceOp, void* data);
/** Undo a call to JS_AddExtraGCRootsTracer. */
extern JS_PUBLIC_API(void)
JS_RemoveExtraGCRootsTracer(JSContext* cx, JSTraceDataOp traceOp, void* data);
/*
* Garbage collector API.
*/
extern JS_PUBLIC_API(void)
JS_GC(JSContext* cx);
extern JS_PUBLIC_API(void)
JS_MaybeGC(JSContext* cx);
extern JS_PUBLIC_API(void)
JS_SetGCCallback(JSContext* cx, JSGCCallback cb, void* data);
extern JS_PUBLIC_API(void)
JS_SetObjectsTenuredCallback(JSContext* cx, JSObjectsTenuredCallback cb,
void* data);
extern JS_PUBLIC_API(bool)
JS_AddFinalizeCallback(JSContext* cx, JSFinalizeCallback cb, void* data);
extern JS_PUBLIC_API(void)
JS_RemoveFinalizeCallback(JSContext* cx, JSFinalizeCallback cb);
/*
* Weak pointers and garbage collection
*
* Weak pointers are by their nature not marked as part of garbage collection,
* but they may need to be updated in two cases after a GC:
*
* 1) Their referent was found not to be live and is about to be finalized
* 2) Their referent has been moved by a compacting GC
*
* To handle this, any part of the system that maintain weak pointers to
* JavaScript GC things must register a callback with
* JS_(Add,Remove)WeakPointer{ZoneGroup,Compartment}Callback(). This callback
* must then call JS_UpdateWeakPointerAfterGC() on all weak pointers it knows
* about.
*
* Since sweeping is incremental, we have several callbacks to avoid repeatedly
* having to visit all embedder structures. The WeakPointerZoneGroupCallback is
* called once for each strongly connected group of zones, whereas the
* WeakPointerCompartmentCallback is called once for each compartment that is
* visited while sweeping. Structures that cannot contain references in more
* than one compartment should sweep the relevant per-compartment structures
* using the latter callback to minimizer per-slice overhead.
*
* The argument to JS_UpdateWeakPointerAfterGC() is an in-out param. If the
* referent is about to be finalized the pointer will be set to null. If the
* referent has been moved then the pointer will be updated to point to the new
* location.
*
* Callers of this method are responsible for updating any state that is
* dependent on the object's address. For example, if the object's address is
* used as a key in a hashtable, then the object must be removed and
* re-inserted with the correct hash.
*/
extern JS_PUBLIC_API(bool)
JS_AddWeakPointerZoneGroupCallback(JSContext* cx, JSWeakPointerZoneGroupCallback cb, void* data);
extern JS_PUBLIC_API(void)
JS_RemoveWeakPointerZoneGroupCallback(JSContext* cx, JSWeakPointerZoneGroupCallback cb);
extern JS_PUBLIC_API(bool)
JS_AddWeakPointerCompartmentCallback(JSContext* cx, JSWeakPointerCompartmentCallback cb,
void* data);
extern JS_PUBLIC_API(void)
JS_RemoveWeakPointerCompartmentCallback(JSContext* cx, JSWeakPointerCompartmentCallback cb);
extern JS_PUBLIC_API(void)
JS_UpdateWeakPointerAfterGC(JS::Heap<JSObject*>* objp);
extern JS_PUBLIC_API(void)
JS_UpdateWeakPointerAfterGCUnbarriered(JSObject** objp);
typedef enum JSGCParamKey {
/** Maximum nominal heap before last ditch GC. */
JSGC_MAX_BYTES = 0,
/** Number of JS_malloc bytes before last ditch GC. */
JSGC_MAX_MALLOC_BYTES = 1,
/** Amount of bytes allocated by the GC. */
JSGC_BYTES = 3,
/** Number of times GC has been invoked. Includes both major and minor GC. */
JSGC_NUMBER = 4,
/** Select GC mode. */
JSGC_MODE = 6,
/** Number of cached empty GC chunks. */
JSGC_UNUSED_CHUNKS = 7,
/** Total number of allocated GC chunks. */
JSGC_TOTAL_CHUNKS = 8,
/** Max milliseconds to spend in an incremental GC slice. */
JSGC_SLICE_TIME_BUDGET = 9,
/** Maximum size the GC mark stack can grow to. */
JSGC_MARK_STACK_LIMIT = 10,
/**
* GCs less than this far apart in time will be considered 'high-frequency GCs'.
* See setGCLastBytes in jsgc.cpp.
*/
JSGC_HIGH_FREQUENCY_TIME_LIMIT = 11,
/** Start of dynamic heap growth. */
JSGC_HIGH_FREQUENCY_LOW_LIMIT = 12,
/** End of dynamic heap growth. */
JSGC_HIGH_FREQUENCY_HIGH_LIMIT = 13,
/** Upper bound of heap growth. */
JSGC_HIGH_FREQUENCY_HEAP_GROWTH_MAX = 14,
/** Lower bound of heap growth. */
JSGC_HIGH_FREQUENCY_HEAP_GROWTH_MIN = 15,
/** Heap growth for low frequency GCs. */
JSGC_LOW_FREQUENCY_HEAP_GROWTH = 16,
/**
* If false, the heap growth factor is fixed at 3. If true, it is determined
* based on whether GCs are high- or low- frequency.
*/
JSGC_DYNAMIC_HEAP_GROWTH = 17,
/** If true, high-frequency GCs will use a longer mark slice. */
JSGC_DYNAMIC_MARK_SLICE = 18,
/** Lower limit after which we limit the heap growth. */
JSGC_ALLOCATION_THRESHOLD = 19,
/**
* We try to keep at least this many unused chunks in the free chunk pool at
* all times, even after a shrinking GC.
*/
JSGC_MIN_EMPTY_CHUNK_COUNT = 21,
/** We never keep more than this many unused chunks in the free chunk pool. */
JSGC_MAX_EMPTY_CHUNK_COUNT = 22,
/** Whether compacting GC is enabled. */
JSGC_COMPACTING_ENABLED = 23,
/** If true, painting can trigger IGC slices. */
JSGC_REFRESH_FRAME_SLICES_ENABLED = 24,
} JSGCParamKey;
extern JS_PUBLIC_API(void)
JS_SetGCParameter(JSContext* cx, JSGCParamKey key, uint32_t value);
extern JS_PUBLIC_API(uint32_t)
JS_GetGCParameter(JSContext* cx, JSGCParamKey key);
extern JS_PUBLIC_API(void)
JS_SetGCParametersBasedOnAvailableMemory(JSContext* cx, uint32_t availMem);
/**
* Create a new JSString whose chars member refers to external memory, i.e.,
* memory requiring application-specific finalization.
*/
extern JS_PUBLIC_API(JSString*)
JS_NewExternalString(JSContext* cx, const char16_t* chars, size_t length,
const JSStringFinalizer* fin);
/**
* Return whether 'str' was created with JS_NewExternalString or
* JS_NewExternalStringWithClosure.
*/
extern JS_PUBLIC_API(bool)
JS_IsExternalString(JSString* str);
/**
* Return the 'fin' arg passed to JS_NewExternalString.
*/
extern JS_PUBLIC_API(const JSStringFinalizer*)
JS_GetExternalStringFinalizer(JSString* str);
/**
* Set the size of the native stack that should not be exceed. To disable
* stack size checking pass 0.
*
* SpiderMonkey allows for a distinction between system code (such as GCs, which
* may incidentally be triggered by script but are not strictly performed on
* behalf of such script), trusted script (as determined by JS_SetTrustedPrincipals),
* and untrusted script. Each kind of code may have a different stack quota,
* allowing embedders to keep higher-priority machinery running in the face of
* scripted stack exhaustion by something else.
*
* The stack quotas for each kind of code should be monotonically descending,
* and may be specified with this function. If 0 is passed for a given kind
* of code, it defaults to the value of the next-highest-priority kind.
*
* This function may only be called immediately after the runtime is initialized
* and before any code is executed and/or interrupts requested.
*/
extern JS_PUBLIC_API(void)
JS_SetNativeStackQuota(JSContext* cx, size_t systemCodeStackSize,
size_t trustedScriptStackSize = 0,
size_t untrustedScriptStackSize = 0);
/************************************************************************/
extern JS_PUBLIC_API(bool)
JS_ValueToId(JSContext* cx, JS::HandleValue v, JS::MutableHandleId idp);
extern JS_PUBLIC_API(bool)
JS_StringToId(JSContext* cx, JS::HandleString s, JS::MutableHandleId idp);
extern JS_PUBLIC_API(bool)
JS_IdToValue(JSContext* cx, jsid id, JS::MutableHandle<JS::Value> vp);
namespace JS {
/**
* Convert obj to a primitive value. On success, store the result in vp and
* return true.
*
* The hint argument must be JSTYPE_STRING, JSTYPE_NUMBER, or JSTYPE_VOID (no
* hint).
*
* Implements: ES6 7.1.1 ToPrimitive(input, [PreferredType]).
*/
extern JS_PUBLIC_API(bool)
ToPrimitive(JSContext* cx, JS::HandleObject obj, JSType hint, JS::MutableHandleValue vp);
/**
* If args.get(0) is one of the strings "string", "number", or "default", set
* *result to JSTYPE_STRING, JSTYPE_NUMBER, or JSTYPE_VOID accordingly and
* return true. Otherwise, return false with a TypeError pending.
*
* This can be useful in implementing a @@toPrimitive method.
*/
extern JS_PUBLIC_API(bool)
GetFirstArgumentAsTypeHint(JSContext* cx, CallArgs args, JSType *result);
} /* namespace JS */
extern JS_PUBLIC_API(bool)
JS_PropertyStub(JSContext* cx, JS::HandleObject obj, JS::HandleId id,
JS::MutableHandleValue vp);
extern JS_PUBLIC_API(bool)
JS_StrictPropertyStub(JSContext* cx, JS::HandleObject obj, JS::HandleId id,
JS::MutableHandleValue vp, JS::ObjectOpResult& result);
template<typename T>
struct JSConstScalarSpec {
const char* name;
T val;
};
typedef JSConstScalarSpec<double> JSConstDoubleSpec;
typedef JSConstScalarSpec<int32_t> JSConstIntegerSpec;
struct JSJitInfo;
/**
* Wrapper to relace JSNative for JSPropertySpecs and JSFunctionSpecs. This will
* allow us to pass one JSJitInfo per function with the property/function spec,
* without additional field overhead.
*/
typedef struct JSNativeWrapper {
JSNative op;
const JSJitInfo* info;
} JSNativeWrapper;
/*
* Macro static initializers which make it easy to pass no JSJitInfo as part of a
* JSPropertySpec or JSFunctionSpec.
*/
#define JSNATIVE_WRAPPER(native) { {native, nullptr} }
/**
* Description of a property. JS_DefineProperties and JS_InitClass take arrays
* of these and define many properties at once. JS_PSG, JS_PSGS and JS_PS_END
* are helper macros for defining such arrays.
*/
struct JSPropertySpec {
struct SelfHostedWrapper {
void* unused;
const char* funname;
};
struct ValueWrapper {
uintptr_t type;
union {
const char* string;
int32_t int32;
};
};
const char* name;
uint8_t flags;
union {
struct {
union {
JSNativeWrapper native;
SelfHostedWrapper selfHosted;
} getter;
union {
JSNativeWrapper native;
SelfHostedWrapper selfHosted;
} setter;
} accessors;
ValueWrapper value;
};
bool isAccessor() const {
return !(flags & JSPROP_INTERNAL_USE_BIT);
}
JS_PUBLIC_API(bool) getValue(JSContext* cx, JS::MutableHandleValue value) const;
bool isSelfHosted() const {
MOZ_ASSERT(isAccessor());
#ifdef DEBUG
// Verify that our accessors match our JSPROP_GETTER flag.
if (flags & JSPROP_GETTER)
checkAccessorsAreSelfHosted();
else
checkAccessorsAreNative();
#endif
return (flags & JSPROP_GETTER);
}
static_assert(sizeof(SelfHostedWrapper) == sizeof(JSNativeWrapper),
"JSPropertySpec::getter/setter must be compact");
static_assert(offsetof(SelfHostedWrapper, funname) == offsetof(JSNativeWrapper, info),
"JS_SELF_HOSTED* macros below require that "
"SelfHostedWrapper::funname overlay "
"JSNativeWrapper::info");
private:
void checkAccessorsAreNative() const {
MOZ_ASSERT(accessors.getter.native.op);
// We may not have a setter at all. So all we can assert here, for the
// native case is that if we have a jitinfo for the setter then we have
// a setter op too. This is good enough to make sure we don't have a
// SelfHostedWrapper for the setter.
MOZ_ASSERT_IF(accessors.setter.native.info, accessors.setter.native.op);
}
void checkAccessorsAreSelfHosted() const {
MOZ_ASSERT(!accessors.getter.selfHosted.unused);
MOZ_ASSERT(!accessors.setter.selfHosted.unused);
}
};
namespace JS {
namespace detail {
/* NEVER DEFINED, DON'T USE. For use by JS_CAST_NATIVE_TO only. */
inline int CheckIsNative(JSNative native);
/* NEVER DEFINED, DON'T USE. For use by JS_CAST_STRING_TO only. */
template<size_t N>
inline int
CheckIsCharacterLiteral(const char (&arr)[N]);
/* NEVER DEFINED, DON'T USE. For use by JS_CAST_INT32_TO only. */
inline int CheckIsInt32(int32_t value);
/* NEVER DEFINED, DON'T USE. For use by JS_PROPERTYOP_GETTER only. */
inline int CheckIsGetterOp(JSGetterOp op);
/* NEVER DEFINED, DON'T USE. For use by JS_PROPERTYOP_SETTER only. */
inline int CheckIsSetterOp(JSSetterOp op);
} // namespace detail
} // namespace JS
#define JS_CAST_NATIVE_TO(v, To) \
(static_cast<void>(sizeof(JS::detail::CheckIsNative(v))), \
reinterpret_cast<To>(v))
#define JS_CAST_STRING_TO(s, To) \
(static_cast<void>(sizeof(JS::detail::CheckIsCharacterLiteral(s))), \
reinterpret_cast<To>(s))
#define JS_CAST_INT32_TO(s, To) \
(static_cast<void>(sizeof(JS::detail::CheckIsInt32(s))), \
reinterpret_cast<To>(s))
#define JS_CHECK_ACCESSOR_FLAGS(flags) \
(static_cast<mozilla::EnableIf<((flags) & ~(JSPROP_ENUMERATE | JSPROP_PERMANENT)) == 0>::Type>(0), \
(flags))
#define JS_PROPERTYOP_GETTER(v) \
(static_cast<void>(sizeof(JS::detail::CheckIsGetterOp(v))), \
reinterpret_cast<JSNative>(v))
#define JS_PROPERTYOP_SETTER(v) \
(static_cast<void>(sizeof(JS::detail::CheckIsSetterOp(v))), \
reinterpret_cast<JSNative>(v))
#define JS_STUBGETTER JS_PROPERTYOP_GETTER(JS_PropertyStub)
#define JS_STUBSETTER JS_PROPERTYOP_SETTER(JS_StrictPropertyStub)
#define JS_PS_ACCESSOR_SPEC(name, getter, setter, flags, extraFlags) \
{ name, uint8_t(JS_CHECK_ACCESSOR_FLAGS(flags) | extraFlags), \
{ { getter, setter } } }
#define JS_PS_VALUE_SPEC(name, value, flags) \
{ name, uint8_t(flags | JSPROP_INTERNAL_USE_BIT), \
{ { value, JSNATIVE_WRAPPER(nullptr) } } }
#define SELFHOSTED_WRAPPER(name) \
{ { nullptr, JS_CAST_STRING_TO(name, const JSJitInfo*) } }
#define STRINGVALUE_WRAPPER(value) \
{ { reinterpret_cast<JSNative>(JSVAL_TYPE_STRING), JS_CAST_STRING_TO(value, const JSJitInfo*) } }
#define INT32VALUE_WRAPPER(value) \
{ { reinterpret_cast<JSNative>(JSVAL_TYPE_INT32), JS_CAST_INT32_TO(value, const JSJitInfo*) } }
/*
* JSPropertySpec uses JSNativeWrapper. These macros encapsulate the definition
* of JSNative-backed JSPropertySpecs, by defining the JSNativeWrappers for
* them.
*/
#define JS_PSG(name, getter, flags) \
JS_PS_ACCESSOR_SPEC(name, JSNATIVE_WRAPPER(getter), JSNATIVE_WRAPPER(nullptr), flags, \
JSPROP_SHARED)
#define JS_PSGS(name, getter, setter, flags) \
JS_PS_ACCESSOR_SPEC(name, JSNATIVE_WRAPPER(getter), JSNATIVE_WRAPPER(setter), flags, \
JSPROP_SHARED)
#define JS_SELF_HOSTED_GET(name, getterName, flags) \
JS_PS_ACCESSOR_SPEC(name, SELFHOSTED_WRAPPER(getterName), JSNATIVE_WRAPPER(nullptr), flags, \
JSPROP_SHARED | JSPROP_GETTER)
#define JS_SELF_HOSTED_GETSET(name, getterName, setterName, flags) \
JS_PS_ACCESSOR_SPEC(name, SELFHOSTED_WRAPPER(getterName), SELFHOSTED_WRAPPER(setterName), \
flags, JSPROP_SHARED | JSPROP_GETTER | JSPROP_SETTER)
#define JS_SELF_HOSTED_SYM_GET(symbol, getterName, flags) \
JS_PS_ACCESSOR_SPEC(reinterpret_cast<const char*>(uint32_t(::JS::SymbolCode::symbol) + 1), \
SELFHOSTED_WRAPPER(getterName), JSNATIVE_WRAPPER(nullptr), flags, \
JSPROP_SHARED | JSPROP_GETTER)
#define JS_STRING_PS(name, string, flags) \
JS_PS_VALUE_SPEC(name, STRINGVALUE_WRAPPER(string), flags)
#define JS_STRING_SYM_PS(symbol, string, flags) \
JS_PS_VALUE_SPEC(reinterpret_cast<const char*>(uint32_t(::JS::SymbolCode::symbol) + 1), \
STRINGVALUE_WRAPPER(string), flags)
#define JS_INT32_PS(name, value, flags) \
JS_PS_VALUE_SPEC(name, INT32VALUE_WRAPPER(value), flags)
#define JS_PS_END \
JS_PS_ACCESSOR_SPEC(nullptr, JSNATIVE_WRAPPER(nullptr), JSNATIVE_WRAPPER(nullptr), 0, 0)
/**
* To define a native function, set call to a JSNativeWrapper. To define a
* self-hosted function, set selfHostedName to the name of a function
* compiled during JSRuntime::initSelfHosting.
*/
struct JSFunctionSpec {
const char* name;
JSNativeWrapper call;
uint16_t nargs;
uint16_t flags;
const char* selfHostedName;
};
/*
* Terminating sentinel initializer to put at the end of a JSFunctionSpec array
* that's passed to JS_DefineFunctions or JS_InitClass.
*/
#define JS_FS_END JS_FS(nullptr,nullptr,0,0)
/*
* Initializer macros for a JSFunctionSpec array element. JS_FN (whose name pays
* homage to the old JSNative/JSFastNative split) simply adds the flag
* JSFUN_STUB_GSOPS. JS_FNINFO allows the simple adding of
* JSJitInfos. JS_SELF_HOSTED_FN declares a self-hosted function.
* JS_INLINABLE_FN allows specifying an InlinableNative enum value for natives
* inlined or specialized by the JIT. Finally JS_FNSPEC has slots for all the
* fields.
*
* The _SYM variants allow defining a function with a symbol key rather than a
* string key. For example, use JS_SYM_FN(iterator, ...) to define an
* @@iterator method.
*/
#define JS_FS(name,call,nargs,flags) \
JS_FNSPEC(name, call, nullptr, nargs, flags, nullptr)
#define JS_FN(name,call,nargs,flags) \
JS_FNSPEC(name, call, nullptr, nargs, (flags) | JSFUN_STUB_GSOPS, nullptr)
#define JS_INLINABLE_FN(name,call,nargs,flags,native) \
JS_FNSPEC(name, call, &js::jit::JitInfo_##native, nargs, (flags) | JSFUN_STUB_GSOPS, nullptr)
#define JS_SYM_FN(symbol,call,nargs,flags) \
JS_SYM_FNSPEC(symbol, call, nullptr, nargs, (flags) | JSFUN_STUB_GSOPS, nullptr)
#define JS_FNINFO(name,call,info,nargs,flags) \
JS_FNSPEC(name, call, info, nargs, flags, nullptr)
#define JS_SELF_HOSTED_FN(name,selfHostedName,nargs,flags) \
JS_FNSPEC(name, nullptr, nullptr, nargs, flags, selfHostedName)
#define JS_SELF_HOSTED_SYM_FN(symbol, selfHostedName, nargs, flags) \
JS_SYM_FNSPEC(symbol, nullptr, nullptr, nargs, flags, selfHostedName)
#define JS_SYM_FNSPEC(symbol, call, info, nargs, flags, selfHostedName) \
JS_FNSPEC(reinterpret_cast<const char*>( \
uint32_t(::JS::SymbolCode::symbol) + 1), \
call, info, nargs, flags, selfHostedName)
#define JS_FNSPEC(name,call,info,nargs,flags,selfHostedName) \
{name, {call, info}, nargs, flags, selfHostedName}
extern JS_PUBLIC_API(JSObject*)
JS_InitClass(JSContext* cx, JS::HandleObject obj, JS::HandleObject parent_proto,
const JSClass* clasp, JSNative constructor, unsigned nargs,
const JSPropertySpec* ps, const JSFunctionSpec* fs,
const JSPropertySpec* static_ps, const JSFunctionSpec* static_fs);
/**
* Set up ctor.prototype = proto and proto.constructor = ctor with the
* right property flags.
*/
extern JS_PUBLIC_API(bool)
JS_LinkConstructorAndPrototype(JSContext* cx, JS::Handle<JSObject*> ctor,
JS::Handle<JSObject*> proto);
extern JS_PUBLIC_API(const JSClass*)
JS_GetClass(JSObject* obj);
extern JS_PUBLIC_API(bool)
JS_InstanceOf(JSContext* cx, JS::Handle<JSObject*> obj, const JSClass* clasp, JS::CallArgs* args);
extern JS_PUBLIC_API(bool)
JS_HasInstance(JSContext* cx, JS::Handle<JSObject*> obj, JS::Handle<JS::Value> v, bool* bp);
namespace JS {
// Implementation of
// http://www.ecma-international.org/ecma-262/6.0/#sec-ordinaryhasinstance. If
// you're looking for the equivalent of "instanceof", you want JS_HasInstance,
// not this function.
extern JS_PUBLIC_API(bool)
OrdinaryHasInstance(JSContext* cx, HandleObject objArg, HandleValue v, bool* bp);
} // namespace JS
extern JS_PUBLIC_API(void*)
JS_GetPrivate(JSObject* obj);
extern JS_PUBLIC_API(void)
JS_SetPrivate(JSObject* obj, void* data);
extern JS_PUBLIC_API(void*)
JS_GetInstancePrivate(JSContext* cx, JS::Handle<JSObject*> obj, const JSClass* clasp,
JS::CallArgs* args);
extern JS_PUBLIC_API(JSObject*)
JS_GetConstructor(JSContext* cx, JS::Handle<JSObject*> proto);
namespace JS {
enum ZoneSpecifier {
FreshZone = 0,
SystemZone = 1
};
/**
* CompartmentCreationOptions specifies options relevant to creating a new
* compartment, that are either immutable characteristics of that compartment
* or that are discarded after the compartment has been created.
*
* Access to these options on an existing compartment is read-only: if you
* need particular selections, make them before you create the compartment.
*/
class JS_PUBLIC_API(CompartmentCreationOptions)
{
public:
CompartmentCreationOptions()
: addonId_(nullptr),
traceGlobal_(nullptr),
invisibleToDebugger_(false),
mergeable_(false),
preserveJitCode_(false),
cloneSingletons_(false),
sharedMemoryAndAtomics_(false),
secureContext_(false)
{
zone_.spec = JS::FreshZone;
}
// A null add-on ID means that the compartment is not associated with an
// add-on.
JSAddonId* addonIdOrNull() const { return addonId_; }
CompartmentCreationOptions& setAddonId(JSAddonId* id) {
addonId_ = id;
return *this;
}
JSTraceOp getTrace() const {
return traceGlobal_;
}
CompartmentCreationOptions& setTrace(JSTraceOp op) {
traceGlobal_ = op;
return *this;
}
void* zonePointer() const {
MOZ_ASSERT(uintptr_t(zone_.pointer) > uintptr_t(JS::SystemZone));
return zone_.pointer;
}
ZoneSpecifier zoneSpecifier() const { return zone_.spec; }
CompartmentCreationOptions& setZone(ZoneSpecifier spec);
CompartmentCreationOptions& setSameZoneAs(JSObject* obj);
// Certain scopes (i.e. XBL compilation scopes) are implementation details
// of the embedding, and references to them should never leak out to script.
// This flag causes the this compartment to skip firing onNewGlobalObject
// and makes addDebuggee a no-op for this global.
bool invisibleToDebugger() const { return invisibleToDebugger_; }
CompartmentCreationOptions& setInvisibleToDebugger(bool flag) {
invisibleToDebugger_ = flag;
return *this;
}
// Compartments used for off-thread compilation have their contents merged
// into a target compartment when the compilation is finished. This is only
// allowed if this flag is set. The invisibleToDebugger flag must also be
// set for such compartments.
bool mergeable() const { return mergeable_; }
CompartmentCreationOptions& setMergeable(bool flag) {
mergeable_ = flag;
return *this;
}
// Determines whether this compartment should preserve JIT code on
// non-shrinking GCs.
bool preserveJitCode() const { return preserveJitCode_; }
CompartmentCreationOptions& setPreserveJitCode(bool flag) {
preserveJitCode_ = flag;
return *this;
}
bool cloneSingletons() const { return cloneSingletons_; }
CompartmentCreationOptions& setCloneSingletons(bool flag) {
cloneSingletons_ = flag;
return *this;
}
bool getSharedMemoryAndAtomicsEnabled() const;
CompartmentCreationOptions& setSharedMemoryAndAtomicsEnabled(bool flag);
// This flag doesn't affect JS engine behavior. It is used by Gecko to
// mark whether content windows and workers are "Secure Context"s. See
// https://w3c.github.io/webappsec-secure-contexts/
// https://bugzilla.mozilla.org/show_bug.cgi?id=1162772#c34
bool secureContext() const { return secureContext_; }
CompartmentCreationOptions& setSecureContext(bool flag) {
secureContext_ = flag;
return *this;
}
private:
JSAddonId* addonId_;
JSTraceOp traceGlobal_;
union {
ZoneSpecifier spec;
void* pointer; // js::Zone* is not exposed in the API.
} zone_;
bool invisibleToDebugger_;
bool mergeable_;
bool preserveJitCode_;
bool cloneSingletons_;
bool sharedMemoryAndAtomics_;
bool secureContext_;
};
/**
* CompartmentBehaviors specifies behaviors of a compartment that can be
* changed after the compartment's been created.
*/
class JS_PUBLIC_API(CompartmentBehaviors)
{
public:
class Override {
public:
Override() : mode_(Default) {}
bool get(bool defaultValue) const {
if (mode_ == Default)
return defaultValue;
return mode_ == ForceTrue;
}
void set(bool overrideValue) {
mode_ = overrideValue ? ForceTrue : ForceFalse;
}
void reset() {
mode_ = Default;
}
private:
enum Mode {
Default,
ForceTrue,
ForceFalse
};
Mode mode_;
};
CompartmentBehaviors()
: version_(JSVERSION_UNKNOWN)
, discardSource_(false)
, disableLazyParsing_(false)
, singletonsAsTemplates_(true)
{
}
JSVersion version() const { return version_; }
CompartmentBehaviors& setVersion(JSVersion aVersion) {
MOZ_ASSERT(aVersion != JSVERSION_UNKNOWN);
version_ = aVersion;
return *this;
}
// For certain globals, we know enough about the code that will run in them
// that we can discard script source entirely.
bool discardSource() const { return discardSource_; }
CompartmentBehaviors& setDiscardSource(bool flag) {
discardSource_ = flag;
return *this;
}
bool disableLazyParsing() const { return disableLazyParsing_; }
CompartmentBehaviors& setDisableLazyParsing(bool flag) {
disableLazyParsing_ = flag;
return *this;
}
bool extraWarnings(JSContext* cx) const;
Override& extraWarningsOverride() { return extraWarningsOverride_; }
bool getSingletonsAsTemplates() const {
return singletonsAsTemplates_;
}
CompartmentBehaviors& setSingletonsAsValues() {
singletonsAsTemplates_ = false;
return *this;
}
private:
JSVersion version_;
bool discardSource_;
bool disableLazyParsing_;
Override extraWarningsOverride_;
// To XDR singletons, we need to ensure that all singletons are all used as
// templates, by making JSOP_OBJECT return a clone of the JSScript
// singleton, instead of returning the value which is baked in the JSScript.
bool singletonsAsTemplates_;
};
/**
* CompartmentOptions specifies compartment characteristics: both those that
* can't be changed on a compartment once it's been created
* (CompartmentCreationOptions), and those that can be changed on an existing
* compartment (CompartmentBehaviors).
*/
class JS_PUBLIC_API(CompartmentOptions)
{
public:
explicit CompartmentOptions()
: creationOptions_(),
behaviors_()
{}
CompartmentOptions(const CompartmentCreationOptions& compartmentCreation,
const CompartmentBehaviors& compartmentBehaviors)
: creationOptions_(compartmentCreation),
behaviors_(compartmentBehaviors)
{}
// CompartmentCreationOptions specify fundamental compartment
// characteristics that must be specified when the compartment is created,
// that can't be changed after the compartment is created.
CompartmentCreationOptions& creationOptions() {
return creationOptions_;
}
const CompartmentCreationOptions& creationOptions() const {
return creationOptions_;
}
// CompartmentBehaviors specify compartment characteristics that can be
// changed after the compartment is created.
CompartmentBehaviors& behaviors() {
return behaviors_;
}
const CompartmentBehaviors& behaviors() const {
return behaviors_;
}
private:
CompartmentCreationOptions creationOptions_;
CompartmentBehaviors behaviors_;
};
JS_PUBLIC_API(const CompartmentCreationOptions&)
CompartmentCreationOptionsRef(JSCompartment* compartment);
JS_PUBLIC_API(const CompartmentCreationOptions&)
CompartmentCreationOptionsRef(JSObject* obj);
JS_PUBLIC_API(const CompartmentCreationOptions&)
CompartmentCreationOptionsRef(JSContext* cx);
JS_PUBLIC_API(CompartmentBehaviors&)
CompartmentBehaviorsRef(JSCompartment* compartment);
JS_PUBLIC_API(CompartmentBehaviors&)
CompartmentBehaviorsRef(JSObject* obj);
JS_PUBLIC_API(CompartmentBehaviors&)
CompartmentBehaviorsRef(JSContext* cx);
/**
* During global creation, we fire notifications to callbacks registered
* via the Debugger API. These callbacks are arbitrary script, and can touch
* the global in arbitrary ways. When that happens, the global should not be
* in a half-baked state. But this creates a problem for consumers that need
* to set slots on the global to put it in a consistent state.
*
* This API provides a way for consumers to set slots atomically (immediately
* after the global is created), before any debugger hooks are fired. It's
* unfortunately on the clunky side, but that's the way the cookie crumbles.
*
* If callers have no additional state on the global to set up, they may pass
* |FireOnNewGlobalHook| to JS_NewGlobalObject, which causes that function to
* fire the hook as its final act before returning. Otherwise, callers should
* pass |DontFireOnNewGlobalHook|, which means that they are responsible for
* invoking JS_FireOnNewGlobalObject upon successfully creating the global. If
* an error occurs and the operation aborts, callers should skip firing the
* hook. But otherwise, callers must take care to fire the hook exactly once
* before compiling any script in the global's scope (we have assertions in
* place to enforce this). This lets us be sure that debugger clients never miss
* breakpoints.
*/
enum OnNewGlobalHookOption {
FireOnNewGlobalHook,
DontFireOnNewGlobalHook
};
} /* namespace JS */
extern JS_PUBLIC_API(JSObject*)
JS_NewGlobalObject(JSContext* cx, const JSClass* clasp, JSPrincipals* principals,
JS::OnNewGlobalHookOption hookOption,
const JS::CompartmentOptions& options);
/**
* Spidermonkey does not have a good way of keeping track of what compartments should be marked on
* their own. We can mark the roots unconditionally, but marking GC things only relevant in live
* compartments is hard. To mitigate this, we create a static trace hook, installed on each global
* object, from which we can be sure the compartment is relevant, and mark it.
*
* It is still possible to specify custom trace hooks for global object classes. They can be
* provided via the CompartmentOptions passed to JS_NewGlobalObject.
*/
extern JS_PUBLIC_API(void)
JS_GlobalObjectTraceHook(JSTracer* trc, JSObject* global);
extern JS_PUBLIC_API(void)
JS_FireOnNewGlobalObject(JSContext* cx, JS::HandleObject global);
extern JS_PUBLIC_API(JSObject*)
JS_NewObject(JSContext* cx, const JSClass* clasp);
extern JS_PUBLIC_API(bool)
JS_IsNative(JSObject* obj);
/**
* Unlike JS_NewObject, JS_NewObjectWithGivenProto does not compute a default
* proto. If proto is nullptr, the JS object will have `null` as [[Prototype]].
*/
extern JS_PUBLIC_API(JSObject*)
JS_NewObjectWithGivenProto(JSContext* cx, const JSClass* clasp, JS::Handle<JSObject*> proto);
/** Creates a new plain object, like `new Object()`, with Object.prototype as [[Prototype]]. */
extern JS_PUBLIC_API(JSObject*)
JS_NewPlainObject(JSContext* cx);
/**
* Freeze obj, and all objects it refers to, recursively. This will not recurse
* through non-extensible objects, on the assumption that those are already
* deep-frozen.
*/
extern JS_PUBLIC_API(bool)
JS_DeepFreezeObject(JSContext* cx, JS::Handle<JSObject*> obj);
/**
* Freezes an object; see ES5's Object.freeze(obj) method.
*/
extern JS_PUBLIC_API(bool)
JS_FreezeObject(JSContext* cx, JS::Handle<JSObject*> obj);
/*** Property descriptors ************************************************************************/
namespace JS {
struct JS_PUBLIC_API(PropertyDescriptor) {
JSObject* obj;
unsigned attrs;
JSGetterOp getter;
JSSetterOp setter;
JS::Value value;
PropertyDescriptor()
: obj(nullptr), attrs(0), getter(nullptr), setter(nullptr), value(JS::UndefinedValue())
{}
static void trace(PropertyDescriptor* self, JSTracer* trc) { self->trace(trc); }
void trace(JSTracer* trc);
};
template <typename Outer>
class PropertyDescriptorOperations
{
const PropertyDescriptor& desc() const { return static_cast<const Outer*>(this)->get(); }
bool has(unsigned bit) const {
MOZ_ASSERT(bit != 0);
MOZ_ASSERT((bit & (bit - 1)) == 0); // only a single bit
return (desc().attrs & bit) != 0;
}
bool hasAny(unsigned bits) const {
return (desc().attrs & bits) != 0;
}
bool hasAll(unsigned bits) const {
return (desc().attrs & bits) == bits;
}
// Non-API attributes bit used internally for arguments objects.
enum { SHADOWABLE = JSPROP_INTERNAL_USE_BIT };
public:
// Descriptors with JSGetterOp/JSSetterOp are considered data
// descriptors. It's complicated.
bool isAccessorDescriptor() const { return hasAny(JSPROP_GETTER | JSPROP_SETTER); }
bool isGenericDescriptor() const {
return (desc().attrs&
(JSPROP_GETTER | JSPROP_SETTER | JSPROP_IGNORE_READONLY | JSPROP_IGNORE_VALUE)) ==
(JSPROP_IGNORE_READONLY | JSPROP_IGNORE_VALUE);
}
bool isDataDescriptor() const { return !isAccessorDescriptor() && !isGenericDescriptor(); }
bool hasConfigurable() const { return !has(JSPROP_IGNORE_PERMANENT); }
bool configurable() const { MOZ_ASSERT(hasConfigurable()); return !has(JSPROP_PERMANENT); }
bool hasEnumerable() const { return !has(JSPROP_IGNORE_ENUMERATE); }
bool enumerable() const { MOZ_ASSERT(hasEnumerable()); return has(JSPROP_ENUMERATE); }
bool hasValue() const { return !isAccessorDescriptor() && !has(JSPROP_IGNORE_VALUE); }
JS::HandleValue value() const {
return JS::HandleValue::fromMarkedLocation(&desc().value);
}
bool hasWritable() const { return !isAccessorDescriptor() && !has(JSPROP_IGNORE_READONLY); }
bool writable() const { MOZ_ASSERT(hasWritable()); return !has(JSPROP_READONLY); }
bool hasGetterObject() const { return has(JSPROP_GETTER); }
JS::HandleObject getterObject() const {
MOZ_ASSERT(hasGetterObject());
return JS::HandleObject::fromMarkedLocation(
reinterpret_cast<JSObject* const*>(&desc().getter));
}
bool hasSetterObject() const { return has(JSPROP_SETTER); }
JS::HandleObject setterObject() const {
MOZ_ASSERT(hasSetterObject());
return JS::HandleObject::fromMarkedLocation(
reinterpret_cast<JSObject* const*>(&desc().setter));
}
bool hasGetterOrSetter() const { return desc().getter || desc().setter; }
bool isShared() const { return has(JSPROP_SHARED); }
JS::HandleObject object() const {
return JS::HandleObject::fromMarkedLocation(&desc().obj);
}
unsigned attributes() const { return desc().attrs; }
JSGetterOp getter() const { return desc().getter; }
JSSetterOp setter() const { return desc().setter; }
void assertValid() const {
#ifdef DEBUG
MOZ_ASSERT((attributes() & ~(JSPROP_ENUMERATE | JSPROP_IGNORE_ENUMERATE |
JSPROP_PERMANENT | JSPROP_IGNORE_PERMANENT |
JSPROP_READONLY | JSPROP_IGNORE_READONLY |
JSPROP_IGNORE_VALUE |
JSPROP_GETTER |
JSPROP_SETTER |
JSPROP_SHARED |
JSPROP_REDEFINE_NONCONFIGURABLE |
JSPROP_RESOLVING |
SHADOWABLE)) == 0);
MOZ_ASSERT(!hasAll(JSPROP_IGNORE_ENUMERATE | JSPROP_ENUMERATE));
MOZ_ASSERT(!hasAll(JSPROP_IGNORE_PERMANENT | JSPROP_PERMANENT));
if (isAccessorDescriptor()) {
MOZ_ASSERT(has(JSPROP_SHARED));
MOZ_ASSERT(!has(JSPROP_READONLY));
MOZ_ASSERT(!has(JSPROP_IGNORE_READONLY));
MOZ_ASSERT(!has(JSPROP_IGNORE_VALUE));
MOZ_ASSERT(!has(SHADOWABLE));
MOZ_ASSERT(value().isUndefined());
MOZ_ASSERT_IF(!has(JSPROP_GETTER), !getter());
MOZ_ASSERT_IF(!has(JSPROP_SETTER), !setter());
} else {
MOZ_ASSERT(!hasAll(JSPROP_IGNORE_READONLY | JSPROP_READONLY));
MOZ_ASSERT_IF(has(JSPROP_IGNORE_VALUE), value().isUndefined());
}
MOZ_ASSERT(getter() != JS_PropertyStub);
MOZ_ASSERT(setter() != JS_StrictPropertyStub);
MOZ_ASSERT_IF(has(JSPROP_RESOLVING), !has(JSPROP_IGNORE_ENUMERATE));
MOZ_ASSERT_IF(has(JSPROP_RESOLVING), !has(JSPROP_IGNORE_PERMANENT));
MOZ_ASSERT_IF(has(JSPROP_RESOLVING), !has(JSPROP_IGNORE_READONLY));
MOZ_ASSERT_IF(has(JSPROP_RESOLVING), !has(JSPROP_IGNORE_VALUE));
MOZ_ASSERT_IF(has(JSPROP_RESOLVING), !has(JSPROP_REDEFINE_NONCONFIGURABLE));
#endif
}
void assertComplete() const {
#ifdef DEBUG
assertValid();
MOZ_ASSERT((attributes() & ~(JSPROP_ENUMERATE |
JSPROP_PERMANENT |
JSPROP_READONLY |
JSPROP_GETTER |
JSPROP_SETTER |
JSPROP_SHARED |
JSPROP_REDEFINE_NONCONFIGURABLE |
JSPROP_RESOLVING |
SHADOWABLE)) == 0);
MOZ_ASSERT_IF(isAccessorDescriptor(), has(JSPROP_GETTER) && has(JSPROP_SETTER));
#endif
}
void assertCompleteIfFound() const {
#ifdef DEBUG
if (object())
assertComplete();
#endif
}
};
template <typename Outer>
class MutablePropertyDescriptorOperations : public PropertyDescriptorOperations<Outer>
{
PropertyDescriptor& desc() { return static_cast<Outer*>(this)->get(); }
public:
void clear() {
object().set(nullptr);
setAttributes(0);
setGetter(nullptr);
setSetter(nullptr);
value().setUndefined();
}
void initFields(HandleObject obj, HandleValue v, unsigned attrs,
JSGetterOp getterOp, JSSetterOp setterOp) {
MOZ_ASSERT(getterOp != JS_PropertyStub);
MOZ_ASSERT(setterOp != JS_StrictPropertyStub);
object().set(obj);
value().set(v);
setAttributes(attrs);
setGetter(getterOp);
setSetter(setterOp);
}
void assign(PropertyDescriptor& other) {
object().set(other.obj);
setAttributes(other.attrs);
setGetter(other.getter);
setSetter(other.setter);
value().set(other.value);
}
void setDataDescriptor(HandleValue v, unsigned attrs) {
MOZ_ASSERT((attrs & ~(JSPROP_ENUMERATE |
JSPROP_PERMANENT |
JSPROP_READONLY |
JSPROP_IGNORE_ENUMERATE |
JSPROP_IGNORE_PERMANENT |
JSPROP_IGNORE_READONLY)) == 0);
object().set(nullptr);
setAttributes(attrs);
setGetter(nullptr);
setSetter(nullptr);
value().set(v);
}
JS::MutableHandleObject object() {
return JS::MutableHandleObject::fromMarkedLocation(&desc().obj);
}
unsigned& attributesRef() { return desc().attrs; }
JSGetterOp& getter() { return desc().getter; }
JSSetterOp& setter() { return desc().setter; }
JS::MutableHandleValue value() {
return JS::MutableHandleValue::fromMarkedLocation(&desc().value);
}
void setValue(JS::HandleValue v) {
MOZ_ASSERT(!(desc().attrs & (JSPROP_GETTER | JSPROP_SETTER)));
attributesRef() &= ~JSPROP_IGNORE_VALUE;
value().set(v);
}
void setConfigurable(bool configurable) {
setAttributes((desc().attrs & ~(JSPROP_IGNORE_PERMANENT | JSPROP_PERMANENT)) |
(configurable ? 0 : JSPROP_PERMANENT));
}
void setEnumerable(bool enumerable) {
setAttributes((desc().attrs & ~(JSPROP_IGNORE_ENUMERATE | JSPROP_ENUMERATE)) |
(enumerable ? JSPROP_ENUMERATE : 0));
}
void setWritable(bool writable) {
MOZ_ASSERT(!(desc().attrs & (JSPROP_GETTER | JSPROP_SETTER)));
setAttributes((desc().attrs & ~(JSPROP_IGNORE_READONLY | JSPROP_READONLY)) |
(writable ? 0 : JSPROP_READONLY));
}
void setAttributes(unsigned attrs) { desc().attrs = attrs; }
void setGetter(JSGetterOp op) {
MOZ_ASSERT(op != JS_PropertyStub);
desc().getter = op;
}
void setSetter(JSSetterOp op) {
MOZ_ASSERT(op != JS_StrictPropertyStub);
desc().setter = op;
}
void setGetterObject(JSObject* obj) {
desc().getter = reinterpret_cast<JSGetterOp>(obj);
desc().attrs &= ~(JSPROP_IGNORE_VALUE | JSPROP_IGNORE_READONLY | JSPROP_READONLY);
desc().attrs |= JSPROP_GETTER | JSPROP_SHARED;
}
void setSetterObject(JSObject* obj) {
desc().setter = reinterpret_cast<JSSetterOp>(obj);
desc().attrs &= ~(JSPROP_IGNORE_VALUE | JSPROP_IGNORE_READONLY | JSPROP_READONLY);
desc().attrs |= JSPROP_SETTER | JSPROP_SHARED;
}
JS::MutableHandleObject getterObject() {
MOZ_ASSERT(this->hasGetterObject());
return JS::MutableHandleObject::fromMarkedLocation(
reinterpret_cast<JSObject**>(&desc().getter));
}
JS::MutableHandleObject setterObject() {
MOZ_ASSERT(this->hasSetterObject());
return JS::MutableHandleObject::fromMarkedLocation(
reinterpret_cast<JSObject**>(&desc().setter));
}
};
} /* namespace JS */
namespace js {
template <>
class RootedBase<JS::PropertyDescriptor>
: public JS::MutablePropertyDescriptorOperations<JS::Rooted<JS::PropertyDescriptor>>
{};
template <>
class HandleBase<JS::PropertyDescriptor>
: public JS::PropertyDescriptorOperations<JS::Handle<JS::PropertyDescriptor>>
{};
template <>
class MutableHandleBase<JS::PropertyDescriptor>
: public JS::MutablePropertyDescriptorOperations<JS::MutableHandle<JS::PropertyDescriptor>>
{};
} /* namespace js */
namespace JS {
extern JS_PUBLIC_API(bool)
ObjectToCompletePropertyDescriptor(JSContext* cx,
JS::HandleObject obj,
JS::HandleValue descriptor,
JS::MutableHandle<PropertyDescriptor> desc);
/*
* ES6 draft rev 32 (2015 Feb 2) 6.2.4.4 FromPropertyDescriptor(Desc).
*
* If desc.object() is null, then vp is set to undefined.
*/
extern JS_PUBLIC_API(bool)
FromPropertyDescriptor(JSContext* cx,
JS::Handle<JS::PropertyDescriptor> desc,
JS::MutableHandleValue vp);
} // namespace JS
/*** Standard internal methods ********************************************************************
*
* The functions below are the fundamental operations on objects.
*
* ES6 specifies 14 internal methods that define how objects behave. The
* standard is actually quite good on this topic, though you may have to read
* it a few times. See ES6 sections 6.1.7.2 and 6.1.7.3.
*
* When 'obj' is an ordinary object, these functions have boring standard
* behavior as specified by ES6 section 9.1; see the section about internal
* methods in js/src/vm/NativeObject.h.
*
* Proxies override the behavior of internal methods. So when 'obj' is a proxy,
* any one of the functions below could do just about anything. See
* js/public/Proxy.h.
*/
/**
* Get the prototype of obj, storing it in result.
*
* Implements: ES6 [[GetPrototypeOf]] internal method.
*/
extern JS_PUBLIC_API(bool)
JS_GetPrototype(JSContext* cx, JS::HandleObject obj, JS::MutableHandleObject result);
/**
* If |obj| (underneath any functionally-transparent wrapper proxies) has as
* its [[GetPrototypeOf]] trap the ordinary [[GetPrototypeOf]] behavior defined
* for ordinary objects, set |*isOrdinary = true| and store |obj|'s prototype
* in |result|. Otherwise set |*isOrdinary = false|. In case of error, both
* outparams have unspecified value.
*/
extern JS_PUBLIC_API(bool)
JS_GetPrototypeIfOrdinary(JSContext* cx, JS::HandleObject obj, bool* isOrdinary,
JS::MutableHandleObject result);
/**
* Change the prototype of obj.
*
* Implements: ES6 [[SetPrototypeOf]] internal method.
*
* In cases where ES6 [[SetPrototypeOf]] returns false without an exception,
* JS_SetPrototype throws a TypeError and returns false.
*
* Performance warning: JS_SetPrototype is very bad for performance. It may
* cause compiled jit-code to be invalidated. It also causes not only obj but
* all other objects in the same "group" as obj to be permanently deoptimized.
* It's better to create the object with the right prototype from the start.
*/
extern JS_PUBLIC_API(bool)
JS_SetPrototype(JSContext* cx, JS::HandleObject obj, JS::HandleObject proto);
/**
* Determine whether obj is extensible. Extensible objects can have new
* properties defined on them. Inextensible objects can't, and their
* [[Prototype]] slot is fixed as well.
*
* Implements: ES6 [[IsExtensible]] internal method.
*/
extern JS_PUBLIC_API(bool)
JS_IsExtensible(JSContext* cx, JS::HandleObject obj, bool* extensible);
/**
* Attempt to make |obj| non-extensible.
*
* Not all failures are treated as errors. See the comment on
* JS::ObjectOpResult in js/public/Class.h.
*
* Implements: ES6 [[PreventExtensions]] internal method.
*/
extern JS_PUBLIC_API(bool)
JS_PreventExtensions(JSContext* cx, JS::HandleObject obj, JS::ObjectOpResult& result);
/**
* Attempt to make the [[Prototype]] of |obj| immutable, such that any attempt
* to modify it will fail. If an error occurs during the attempt, return false
* (with a pending exception set, depending upon the nature of the error). If
* no error occurs, return true with |*succeeded| set to indicate whether the
* attempt successfully made the [[Prototype]] immutable.
*
* This is a nonstandard internal method.
*/
extern JS_PUBLIC_API(bool)
JS_SetImmutablePrototype(JSContext* cx, JS::HandleObject obj, bool* succeeded);
/**
* Get a description of one of obj's own properties. If no such property exists
* on obj, return true with desc.object() set to null.
*
* Implements: ES6 [[GetOwnProperty]] internal method.
*/
extern JS_PUBLIC_API(bool)
JS_GetOwnPropertyDescriptorById(JSContext* cx, JS::HandleObject obj, JS::HandleId id,
JS::MutableHandle<JS::PropertyDescriptor> desc);
extern JS_PUBLIC_API(bool)
JS_GetOwnPropertyDescriptor(JSContext* cx, JS::HandleObject obj, const char* name,
JS::MutableHandle<JS::PropertyDescriptor> desc);
extern JS_PUBLIC_API(bool)
JS_GetOwnUCPropertyDescriptor(JSContext* cx, JS::HandleObject obj, const char16_t* name,
JS::MutableHandle<JS::PropertyDescriptor> desc);
/**
* Like JS_GetOwnPropertyDescriptorById, but also searches the prototype chain
* if no own property is found directly on obj. The object on which the
* property is found is returned in desc.object(). If the property is not found
* on the prototype chain, this returns true with desc.object() set to null.
*/
extern JS_PUBLIC_API(bool)
JS_GetPropertyDescriptorById(JSContext* cx, JS::HandleObject obj, JS::HandleId id,
JS::MutableHandle<JS::PropertyDescriptor> desc);
extern JS_PUBLIC_API(bool)
JS_GetPropertyDescriptor(JSContext* cx, JS::HandleObject obj, const char* name,
JS::MutableHandle<JS::PropertyDescriptor> desc);
/**
* Define a property on obj.
*
* This function uses JS::ObjectOpResult to indicate conditions that ES6
* specifies as non-error failures. This is inconvenient at best, so use this
* function only if you are implementing a proxy handler's defineProperty()
* method. For all other purposes, use one of the many DefineProperty functions
* below that throw an exception in all failure cases.
*
* Implements: ES6 [[DefineOwnProperty]] internal method.
*/
extern JS_PUBLIC_API(bool)
JS_DefinePropertyById(JSContext* cx, JS::HandleObject obj, JS::HandleId id,
JS::Handle<JS::PropertyDescriptor> desc,
JS::ObjectOpResult& result);
/**
* Define a property on obj, throwing a TypeError if the attempt fails.
* This is the C++ equivalent of `Object.defineProperty(obj, id, desc)`.
*/
extern JS_PUBLIC_API(bool)
JS_DefinePropertyById(JSContext* cx, JS::HandleObject obj, JS::HandleId id,
JS::Handle<JS::PropertyDescriptor> desc);
extern JS_PUBLIC_API(bool)
JS_DefinePropertyById(JSContext* cx, JS::HandleObject obj, JS::HandleId id, JS::HandleValue value,
unsigned attrs, JSNative getter = nullptr, JSNative setter = nullptr);
extern JS_PUBLIC_API(bool)
JS_DefinePropertyById(JSContext* cx, JS::HandleObject obj, JS::HandleId id, JS::HandleObject value,
unsigned attrs, JSNative getter = nullptr, JSNative setter = nullptr);
extern JS_PUBLIC_API(bool)
JS_DefinePropertyById(JSContext* cx, JS::HandleObject obj, JS::HandleId id, JS::HandleString value,
unsigned attrs, JSNative getter = nullptr, JSNative setter = nullptr);
extern JS_PUBLIC_API(bool)
JS_DefinePropertyById(JSContext* cx, JS::HandleObject obj, JS::HandleId id, int32_t value,
unsigned attrs, JSNative getter = nullptr, JSNative setter = nullptr);
extern JS_PUBLIC_API(bool)
JS_DefinePropertyById(JSContext* cx, JS::HandleObject obj, JS::HandleId id, uint32_t value,
unsigned attrs, JSNative getter = nullptr, JSNative setter = nullptr);
extern JS_PUBLIC_API(bool)
JS_DefinePropertyById(JSContext* cx, JS::HandleObject obj, JS::HandleId id, double value,
unsigned attrs, JSNative getter = nullptr, JSNative setter = nullptr);
extern JS_PUBLIC_API(bool)
JS_DefineProperty(JSContext* cx, JS::HandleObject obj, const char* name, JS::HandleValue value,
unsigned attrs, JSNative getter = nullptr, JSNative setter = nullptr);
extern JS_PUBLIC_API(bool)
JS_DefineProperty(JSContext* cx, JS::HandleObject obj, const char* name, JS::HandleObject value,
unsigned attrs, JSNative getter = nullptr, JSNative setter = nullptr);
extern JS_PUBLIC_API(bool)
JS_DefineProperty(JSContext* cx, JS::HandleObject obj, const char* name, JS::HandleString value,
unsigned attrs, JSNative getter = nullptr, JSNative setter = nullptr);
extern JS_PUBLIC_API(bool)
JS_DefineProperty(JSContext* cx, JS::HandleObject obj, const char* name, int32_t value,
unsigned attrs, JSNative getter = nullptr, JSNative setter = nullptr);
extern JS_PUBLIC_API(bool)
JS_DefineProperty(JSContext* cx, JS::HandleObject obj, const char* name, uint32_t value,
unsigned attrs, JSNative getter = nullptr, JSNative setter = nullptr);
extern JS_PUBLIC_API(bool)
JS_DefineProperty(JSContext* cx, JS::HandleObject obj, const char* name, double value,
unsigned attrs, JSNative getter = nullptr, JSNative setter = nullptr);
extern JS_PUBLIC_API(bool)
JS_DefineUCProperty(JSContext* cx, JS::HandleObject obj, const char16_t* name, size_t namelen,
JS::Handle<JS::PropertyDescriptor> desc,
JS::ObjectOpResult& result);
extern JS_PUBLIC_API(bool)
JS_DefineUCProperty(JSContext* cx, JS::HandleObject obj, const char16_t* name, size_t namelen,
JS::Handle<JS::PropertyDescriptor> desc);
extern JS_PUBLIC_API(bool)
JS_DefineUCProperty(JSContext* cx, JS::HandleObject obj, const char16_t* name, size_t namelen,
JS::HandleValue value, unsigned attrs,
JSNative getter = nullptr, JSNative setter = nullptr);
extern JS_PUBLIC_API(bool)
JS_DefineUCProperty(JSContext* cx, JS::HandleObject obj, const char16_t* name, size_t namelen,
JS::HandleObject value, unsigned attrs,
JSNative getter = nullptr, JSNative setter = nullptr);
extern JS_PUBLIC_API(bool)
JS_DefineUCProperty(JSContext* cx, JS::HandleObject obj, const char16_t* name, size_t namelen,
JS::HandleString value, unsigned attrs,
JSNative getter = nullptr, JSNative setter = nullptr);
extern JS_PUBLIC_API(bool)
JS_DefineUCProperty(JSContext* cx, JS::HandleObject obj, const char16_t* name, size_t namelen,
int32_t value, unsigned attrs,
JSNative getter = nullptr, JSNative setter = nullptr);
extern JS_PUBLIC_API(bool)
JS_DefineUCProperty(JSContext* cx, JS::HandleObject obj, const char16_t* name, size_t namelen,
uint32_t value, unsigned attrs,
JSNative getter = nullptr, JSNative setter = nullptr);
extern JS_PUBLIC_API(bool)
JS_DefineUCProperty(JSContext* cx, JS::HandleObject obj, const char16_t* name, size_t namelen,
double value, unsigned attrs,
JSNative getter = nullptr, JSNative setter = nullptr);
extern JS_PUBLIC_API(bool)
JS_DefineElement(JSContext* cx, JS::HandleObject obj, uint32_t index, JS::HandleValue value,
unsigned attrs, JSNative getter = nullptr, JSNative setter = nullptr);
extern JS_PUBLIC_API(bool)
JS_DefineElement(JSContext* cx, JS::HandleObject obj, uint32_t index, JS::HandleObject value,
unsigned attrs, JSNative getter = nullptr, JSNative setter = nullptr);
extern JS_PUBLIC_API(bool)
JS_DefineElement(JSContext* cx, JS::HandleObject obj, uint32_t index, JS::HandleString value,
unsigned attrs, JSNative getter = nullptr, JSNative setter = nullptr);
extern JS_PUBLIC_API(bool)
JS_DefineElement(JSContext* cx, JS::HandleObject obj, uint32_t index, int32_t value,
unsigned attrs, JSNative getter = nullptr, JSNative setter = nullptr);
extern JS_PUBLIC_API(bool)
JS_DefineElement(JSContext* cx, JS::HandleObject obj, uint32_t index, uint32_t value,
unsigned attrs, JSNative getter = nullptr, JSNative setter = nullptr);
extern JS_PUBLIC_API(bool)
JS_DefineElement(JSContext* cx, JS::HandleObject obj, uint32_t index, double value,
unsigned attrs, JSNative getter = nullptr, JSNative setter = nullptr);
/**
* Compute the expression `id in obj`.
*
* If obj has an own or inherited property obj[id], set *foundp = true and
* return true. If not, set *foundp = false and return true. On error, return
* false with an exception pending.
*
* Implements: ES6 [[Has]] internal method.
*/
extern JS_PUBLIC_API(bool)
JS_HasPropertyById(JSContext* cx, JS::HandleObject obj, JS::HandleId id, bool* foundp);
extern JS_PUBLIC_API(bool)
JS_HasProperty(JSContext* cx, JS::HandleObject obj, const char* name, bool* foundp);
extern JS_PUBLIC_API(bool)
JS_HasUCProperty(JSContext* cx, JS::HandleObject obj, const char16_t* name, size_t namelen,
bool* vp);
extern JS_PUBLIC_API(bool)
JS_HasElement(JSContext* cx, JS::HandleObject obj, uint32_t index, bool* foundp);
/**
* Determine whether obj has an own property with the key `id`.
*
* Implements: ES6 7.3.11 HasOwnProperty(O, P).
*/
extern JS_PUBLIC_API(bool)
JS_HasOwnPropertyById(JSContext* cx, JS::HandleObject obj, JS::HandleId id, bool* foundp);
extern JS_PUBLIC_API(bool)
JS_HasOwnProperty(JSContext* cx, JS::HandleObject obj, const char* name, bool* foundp);
/**
* Get the value of the property `obj[id]`, or undefined if no such property
* exists. This is the C++ equivalent of `vp = Reflect.get(obj, id, receiver)`.
*
* Most callers don't need the `receiver` argument. Consider using
* JS_GetProperty instead. (But if you're implementing a proxy handler's set()
* method, it's often correct to call this function and pass the receiver
* through.)
*
* Implements: ES6 [[Get]] internal method.
*/
extern JS_PUBLIC_API(bool)
JS_ForwardGetPropertyTo(JSContext* cx, JS::HandleObject obj, JS::HandleId id,
JS::HandleValue receiver, JS::MutableHandleValue vp);
extern JS_PUBLIC_API(bool)
JS_ForwardGetElementTo(JSContext* cx, JS::HandleObject obj, uint32_t index,
JS::HandleObject receiver, JS::MutableHandleValue vp);
/**
* Get the value of the property `obj[id]`, or undefined if no such property
* exists. The result is stored in vp.
*
* Implements: ES6 7.3.1 Get(O, P).
*/
extern JS_PUBLIC_API(bool)
JS_GetPropertyById(JSContext* cx, JS::HandleObject obj, JS::HandleId id,
JS::MutableHandleValue vp);
extern JS_PUBLIC_API(bool)
JS_GetProperty(JSContext* cx, JS::HandleObject obj, const char* name, JS::MutableHandleValue vp);
extern JS_PUBLIC_API(bool)
JS_GetUCProperty(JSContext* cx, JS::HandleObject obj, const char16_t* name, size_t namelen,
JS::MutableHandleValue vp);
extern JS_PUBLIC_API(bool)
JS_GetElement(JSContext* cx, JS::HandleObject obj, uint32_t index, JS::MutableHandleValue vp);
/**
* Perform the same property assignment as `Reflect.set(obj, id, v, receiver)`.
*
* This function has a `receiver` argument that most callers don't need.
* Consider using JS_SetProperty instead.
*
* Implements: ES6 [[Set]] internal method.
*/
extern JS_PUBLIC_API(bool)
JS_ForwardSetPropertyTo(JSContext* cx, JS::HandleObject obj, JS::HandleId id, JS::HandleValue v,
JS::HandleValue receiver, JS::ObjectOpResult& result);
/**
* Perform the assignment `obj[id] = v`.
*
* This function performs non-strict assignment, so if the property is
* read-only, nothing happens and no error is thrown.
*/
extern JS_PUBLIC_API(bool)
JS_SetPropertyById(JSContext* cx, JS::HandleObject obj, JS::HandleId id, JS::HandleValue v);
extern JS_PUBLIC_API(bool)
JS_SetProperty(JSContext* cx, JS::HandleObject obj, const char* name, JS::HandleValue v);
extern JS_PUBLIC_API(bool)
JS_SetUCProperty(JSContext* cx, JS::HandleObject obj, const char16_t* name, size_t namelen,
JS::HandleValue v);
extern JS_PUBLIC_API(bool)
JS_SetElement(JSContext* cx, JS::HandleObject obj, uint32_t index, JS::HandleValue v);
extern JS_PUBLIC_API(bool)
JS_SetElement(JSContext* cx, JS::HandleObject obj, uint32_t index, JS::HandleObject v);
extern JS_PUBLIC_API(bool)
JS_SetElement(JSContext* cx, JS::HandleObject obj, uint32_t index, JS::HandleString v);
extern JS_PUBLIC_API(bool)
JS_SetElement(JSContext* cx, JS::HandleObject obj, uint32_t index, int32_t v);
extern JS_PUBLIC_API(bool)
JS_SetElement(JSContext* cx, JS::HandleObject obj, uint32_t index, uint32_t v);
extern JS_PUBLIC_API(bool)
JS_SetElement(JSContext* cx, JS::HandleObject obj, uint32_t index, double v);
/**
* Delete a property. This is the C++ equivalent of
* `result = Reflect.deleteProperty(obj, id)`.
*
* This function has a `result` out parameter that most callers don't need.
* Unless you can pass through an ObjectOpResult provided by your caller, it's
* probably best to use the JS_DeletePropertyById signature with just 3
* arguments.
*
* Implements: ES6 [[Delete]] internal method.
*/
extern JS_PUBLIC_API(bool)
JS_DeletePropertyById(JSContext* cx, JS::HandleObject obj, JS::HandleId id,
JS::ObjectOpResult& result);
extern JS_PUBLIC_API(bool)
JS_DeleteProperty(JSContext* cx, JS::HandleObject obj, const char* name,
JS::ObjectOpResult& result);
extern JS_PUBLIC_API(bool)
JS_DeleteUCProperty(JSContext* cx, JS::HandleObject obj, const char16_t* name, size_t namelen,
JS::ObjectOpResult& result);
extern JS_PUBLIC_API(bool)
JS_DeleteElement(JSContext* cx, JS::HandleObject obj, uint32_t index, JS::ObjectOpResult& result);
/**
* Delete a property, ignoring strict failures. This is the C++ equivalent of
* the JS `delete obj[id]` in non-strict mode code.
*/
extern JS_PUBLIC_API(bool)
JS_DeletePropertyById(JSContext* cx, JS::HandleObject obj, jsid id);
extern JS_PUBLIC_API(bool)
JS_DeleteProperty(JSContext* cx, JS::HandleObject obj, const char* name);
extern JS_PUBLIC_API(bool)
JS_DeleteElement(JSContext* cx, JS::HandleObject obj, uint32_t index);
/**
* Get an array of the non-symbol enumerable properties of obj.
* This function is roughly equivalent to:
*
* var result = [];
* for (key in obj)
* result.push(key);
* return result;
*
* This is the closest thing we currently have to the ES6 [[Enumerate]]
* internal method.
*
* The array of ids returned by JS_Enumerate must be rooted to protect its
* contents from garbage collection. Use JS::Rooted<JS::IdVector>.
*/
extern JS_PUBLIC_API(bool)
JS_Enumerate(JSContext* cx, JS::HandleObject obj, JS::MutableHandle<JS::IdVector> props);
/*
* API for determining callability and constructability. [[Call]] and
* [[Construct]] are internal methods that aren't present on all objects, so it
* is useful to ask if they are there or not. The standard itself asks these
* questions routinely.
*/
namespace JS {
/**
* Return true if the given object is callable. In ES6 terms, an object is
* callable if it has a [[Call]] internal method.
*
* Implements: ES6 7.2.3 IsCallable(argument).
*
* Functions are callable. A scripted proxy or wrapper is callable if its
* target is callable. Most other objects aren't callable.
*/
extern JS_PUBLIC_API(bool)
IsCallable(JSObject* obj);
/**
* Return true if the given object is a constructor. In ES6 terms, an object is
* a constructor if it has a [[Construct]] internal method. The expression
* `new obj()` throws a TypeError if obj is not a constructor.
*
* Implements: ES6 7.2.4 IsConstructor(argument).
*
* JS functions and classes are constructors. Arrow functions and most builtin
* functions are not. A scripted proxy or wrapper is a constructor if its
* target is a constructor.
*/
extern JS_PUBLIC_API(bool)
IsConstructor(JSObject* obj);
} /* namespace JS */
/**
* Call a function, passing a this-value and arguments. This is the C++
* equivalent of `rval = Reflect.apply(fun, obj, args)`.
*
* Implements: ES6 7.3.12 Call(F, V, [argumentsList]).
* Use this function to invoke the [[Call]] internal method.
*/
extern JS_PUBLIC_API(bool)
JS_CallFunctionValue(JSContext* cx, JS::HandleObject obj, JS::HandleValue fval,
const JS::HandleValueArray& args, JS::MutableHandleValue rval);
extern JS_PUBLIC_API(bool)
JS_CallFunction(JSContext* cx, JS::HandleObject obj, JS::HandleFunction fun,
const JS::HandleValueArray& args, JS::MutableHandleValue rval);
/**
* Perform the method call `rval = obj[name](args)`.
*/
extern JS_PUBLIC_API(bool)
JS_CallFunctionName(JSContext* cx, JS::HandleObject obj, const char* name,
const JS::HandleValueArray& args, JS::MutableHandleValue rval);
namespace JS {
static inline bool
Call(JSContext* cx, JS::HandleObject thisObj, JS::HandleFunction fun,
const JS::HandleValueArray& args, MutableHandleValue rval)
{
return !!JS_CallFunction(cx, thisObj, fun, args, rval);
}
static inline bool
Call(JSContext* cx, JS::HandleObject thisObj, JS::HandleValue fun, const JS::HandleValueArray& args,
MutableHandleValue rval)
{
return !!JS_CallFunctionValue(cx, thisObj, fun, args, rval);
}
static inline bool
Call(JSContext* cx, JS::HandleObject thisObj, const char* name, const JS::HandleValueArray& args,
MutableHandleValue rval)
{
return !!JS_CallFunctionName(cx, thisObj, name, args, rval);
}
extern JS_PUBLIC_API(bool)
Call(JSContext* cx, JS::HandleValue thisv, JS::HandleValue fun, const JS::HandleValueArray& args,
MutableHandleValue rval);
static inline bool
Call(JSContext* cx, JS::HandleValue thisv, JS::HandleObject funObj, const JS::HandleValueArray& args,
MutableHandleValue rval)
{
MOZ_ASSERT(funObj);
JS::RootedValue fun(cx, JS::ObjectValue(*funObj));
return Call(cx, thisv, fun, args, rval);
}
/**
* Invoke a constructor. This is the C++ equivalent of
* `rval = Reflect.construct(fun, args, newTarget)`.
*
* JS::Construct() takes a `newTarget` argument that most callers don't need.
* Consider using the four-argument Construct signature instead. (But if you're
* implementing a subclass or a proxy handler's construct() method, this is the
* right function to call.)
*
* Implements: ES6 7.3.13 Construct(F, [argumentsList], [newTarget]).
* Use this function to invoke the [[Construct]] internal method.
*/
extern JS_PUBLIC_API(bool)
Construct(JSContext* cx, JS::HandleValue fun, HandleObject newTarget,
const JS::HandleValueArray &args, MutableHandleObject objp);
/**
* Invoke a constructor. This is the C++ equivalent of
* `rval = new fun(...args)`.
*
* Implements: ES6 7.3.13 Construct(F, [argumentsList], [newTarget]), when
* newTarget is omitted.
*/
extern JS_PUBLIC_API(bool)
Construct(JSContext* cx, JS::HandleValue fun, const JS::HandleValueArray& args,
MutableHandleObject objp);
} /* namespace JS */
/**
* Invoke a constructor, like the JS expression `new ctor(...args)`. Returns
* the new object, or null on error.
*/
extern JS_PUBLIC_API(JSObject*)
JS_New(JSContext* cx, JS::HandleObject ctor, const JS::HandleValueArray& args);
/*** Other property-defining functions ***********************************************************/
extern JS_PUBLIC_API(JSObject*)
JS_DefineObject(JSContext* cx, JS::HandleObject obj, const char* name,
const JSClass* clasp = nullptr, unsigned attrs = 0);
extern JS_PUBLIC_API(bool)
JS_DefineConstDoubles(JSContext* cx, JS::HandleObject obj, const JSConstDoubleSpec* cds);
extern JS_PUBLIC_API(bool)
JS_DefineConstIntegers(JSContext* cx, JS::HandleObject obj, const JSConstIntegerSpec* cis);
extern JS_PUBLIC_API(bool)
JS_DefineProperties(JSContext* cx, JS::HandleObject obj, const JSPropertySpec* ps);
/* * */
extern JS_PUBLIC_API(bool)
JS_AlreadyHasOwnPropertyById(JSContext* cx, JS::HandleObject obj, JS::HandleId id,
bool* foundp);
extern JS_PUBLIC_API(bool)
JS_AlreadyHasOwnProperty(JSContext* cx, JS::HandleObject obj, const char* name,
bool* foundp);
extern JS_PUBLIC_API(bool)
JS_AlreadyHasOwnUCProperty(JSContext* cx, JS::HandleObject obj, const char16_t* name,
size_t namelen, bool* foundp);
extern JS_PUBLIC_API(bool)
JS_AlreadyHasOwnElement(JSContext* cx, JS::HandleObject obj, uint32_t index, bool* foundp);
extern JS_PUBLIC_API(JSObject*)
JS_NewArrayObject(JSContext* cx, const JS::HandleValueArray& contents);
extern JS_PUBLIC_API(JSObject*)
JS_NewArrayObject(JSContext* cx, size_t length);
/**
* Returns true and sets |*isArray| indicating whether |value| is an Array
* object or a wrapper around one, otherwise returns false on failure.
*
* This method returns true with |*isArray == false| when passed a proxy whose
* target is an Array, or when passed a revoked proxy.
*/
extern JS_PUBLIC_API(bool)
JS_IsArrayObject(JSContext* cx, JS::HandleValue value, bool* isArray);
/**
* Returns true and sets |*isArray| indicating whether |obj| is an Array object
* or a wrapper around one, otherwise returns false on failure.
*
* This method returns true with |*isArray == false| when passed a proxy whose
* target is an Array, or when passed a revoked proxy.
*/
extern JS_PUBLIC_API(bool)
JS_IsArrayObject(JSContext* cx, JS::HandleObject obj, bool* isArray);
extern JS_PUBLIC_API(bool)
JS_GetArrayLength(JSContext* cx, JS::Handle<JSObject*> obj, uint32_t* lengthp);
extern JS_PUBLIC_API(bool)
JS_SetArrayLength(JSContext* cx, JS::Handle<JSObject*> obj, uint32_t length);
namespace JS {
/**
* Returns true and sets |*isMap| indicating whether |obj| is an Map object
* or a wrapper around one, otherwise returns false on failure.
*
* This method returns true with |*isMap == false| when passed a proxy whose
* target is an Map, or when passed a revoked proxy.
*/
extern JS_PUBLIC_API(bool)
IsMapObject(JSContext* cx, JS::HandleObject obj, bool* isMap);
/**
* Returns true and sets |*isSet| indicating whether |obj| is an Set object
* or a wrapper around one, otherwise returns false on failure.
*
* This method returns true with |*isSet == false| when passed a proxy whose
* target is an Set, or when passed a revoked proxy.
*/
extern JS_PUBLIC_API(bool)
IsSetObject(JSContext* cx, JS::HandleObject obj, bool* isSet);
} /* namespace JS */
/**
* Assign 'undefined' to all of the object's non-reserved slots. Note: this is
* done for all slots, regardless of the associated property descriptor.
*/
JS_PUBLIC_API(void)
JS_SetAllNonReservedSlotsToUndefined(JSContext* cx, JSObject* objArg);
/**
* Create a new array buffer with the given contents. It must be legal to pass
* these contents to free(). On success, the ownership is transferred to the
* new array buffer.
*/
extern JS_PUBLIC_API(JSObject*)
JS_NewArrayBufferWithContents(JSContext* cx, size_t nbytes, void* contents);
/**
* Create a new array buffer with the given contents. The array buffer does not take ownership of
* contents, and JS_DetachArrayBuffer must be called before the contents are disposed of.
*/
extern JS_PUBLIC_API(JSObject*)
JS_NewArrayBufferWithExternalContents(JSContext* cx, size_t nbytes, void* contents);
/**
* Steal the contents of the given array buffer. The array buffer has its
* length set to 0 and its contents array cleared. The caller takes ownership
* of the return value and must free it or transfer ownership via
* JS_NewArrayBufferWithContents when done using it.
*/
extern JS_PUBLIC_API(void*)
JS_StealArrayBufferContents(JSContext* cx, JS::HandleObject obj);
/**
* Returns a pointer to the ArrayBuffer |obj|'s data. |obj| and its views will store and expose
* the data in the returned pointer: assigning into the returned pointer will affect values exposed
* by views of |obj| and vice versa.
*
* The caller must ultimately deallocate the returned pointer to avoid leaking. The memory is
* *not* garbage-collected with |obj|. These steps must be followed to deallocate:
*
* 1. The ArrayBuffer |obj| must be detached using JS_DetachArrayBuffer.
* 2. The returned pointer must be freed using JS_free.
*
* To perform step 1, callers *must* hold a reference to |obj| until they finish using the returned
* pointer. They *must not* attempt to let |obj| be GC'd, then JS_free the pointer.
*
* If |obj| isn't an ArrayBuffer, this function returns null and reports an error.
*/
extern JS_PUBLIC_API(void*)
JS_ExternalizeArrayBufferContents(JSContext* cx, JS::HandleObject obj);
/**
* Create a new mapped array buffer with the given memory mapped contents. It
* must be legal to free the contents pointer by unmapping it. On success,
* ownership is transferred to the new mapped array buffer.
*/
extern JS_PUBLIC_API(JSObject*)
JS_NewMappedArrayBufferWithContents(JSContext* cx, size_t nbytes, void* contents);
/**
* Create memory mapped array buffer contents.
* Caller must take care of closing fd after calling this function.
*/
extern JS_PUBLIC_API(void*)
JS_CreateMappedArrayBufferContents(int fd, size_t offset, size_t length);
/**
* Release the allocated resource of mapped array buffer contents before the
* object is created.
* If a new object has been created by JS_NewMappedArrayBufferWithContents()
* with this content, then JS_DetachArrayBuffer() should be used instead to
* release the resource used by the object.
*/
extern JS_PUBLIC_API(void)
JS_ReleaseMappedArrayBufferContents(void* contents, size_t length);
extern JS_PUBLIC_API(JS::Value)
JS_GetReservedSlot(JSObject* obj, uint32_t index);
extern JS_PUBLIC_API(void)
JS_SetReservedSlot(JSObject* obj, uint32_t index, const JS::Value& v);
/************************************************************************/
/*
* Functions and scripts.
*/
extern JS_PUBLIC_API(JSFunction*)
JS_NewFunction(JSContext* cx, JSNative call, unsigned nargs, unsigned flags,
const char* name);
namespace JS {
extern JS_PUBLIC_API(JSFunction*)
GetSelfHostedFunction(JSContext* cx, const char* selfHostedName, HandleId id,
unsigned nargs);
/**
* Create a new function based on the given JSFunctionSpec, *fs.
* id is the result of a successful call to
* `PropertySpecNameToPermanentId(cx, fs->name, &id)`.
*
* Unlike JS_DefineFunctions, this does not treat fs as an array.
* *fs must not be JS_FS_END.
*/
extern JS_PUBLIC_API(JSFunction*)
NewFunctionFromSpec(JSContext* cx, const JSFunctionSpec* fs, HandleId id);
} /* namespace JS */
extern JS_PUBLIC_API(JSObject*)
JS_GetFunctionObject(JSFunction* fun);
/**
* Return the function's identifier as a JSString, or null if fun is unnamed.
* The returned string lives as long as fun, so you don't need to root a saved
* reference to it if fun is well-connected or rooted, and provided you bound
* the use of the saved reference by fun's lifetime.
*/
extern JS_PUBLIC_API(JSString*)
JS_GetFunctionId(JSFunction* fun);
/**
* Return a function's display name. This is the defined name if one was given
* where the function was defined, or it could be an inferred name by the JS
* engine in the case that the function was defined to be anonymous. This can
* still return nullptr if a useful display name could not be inferred. The
* same restrictions on rooting as those in JS_GetFunctionId apply.
*/
extern JS_PUBLIC_API(JSString*)
JS_GetFunctionDisplayId(JSFunction* fun);
/*
* Return the arity (length) of fun.
*/
extern JS_PUBLIC_API(uint16_t)
JS_GetFunctionArity(JSFunction* fun);
/**
* Infallible predicate to test whether obj is a function object (faster than
* comparing obj's class name to "Function", but equivalent unless someone has
* overwritten the "Function" identifier with a different constructor and then
* created instances using that constructor that might be passed in as obj).
*/
extern JS_PUBLIC_API(bool)
JS_ObjectIsFunction(JSContext* cx, JSObject* obj);
extern JS_PUBLIC_API(bool)
JS_IsNativeFunction(JSObject* funobj, JSNative call);
/** Return whether the given function is a valid constructor. */
extern JS_PUBLIC_API(bool)
JS_IsConstructor(JSFunction* fun);
extern JS_PUBLIC_API(bool)
JS_DefineFunctions(JSContext* cx, JS::Handle<JSObject*> obj, const JSFunctionSpec* fs);
extern JS_PUBLIC_API(JSFunction*)
JS_DefineFunction(JSContext* cx, JS::Handle<JSObject*> obj, const char* name, JSNative call,
unsigned nargs, unsigned attrs);
extern JS_PUBLIC_API(JSFunction*)
JS_DefineUCFunction(JSContext* cx, JS::Handle<JSObject*> obj,
const char16_t* name, size_t namelen, JSNative call,
unsigned nargs, unsigned attrs);
extern JS_PUBLIC_API(JSFunction*)
JS_DefineFunctionById(JSContext* cx, JS::Handle<JSObject*> obj, JS::Handle<jsid> id, JSNative call,
unsigned nargs, unsigned attrs);
extern JS_PUBLIC_API(bool)
JS_IsFunctionBound(JSFunction* fun);
extern JS_PUBLIC_API(JSObject*)
JS_GetBoundFunctionTarget(JSFunction* fun);
namespace JS {
/**
* Clone a top-level function into cx's global. This function will dynamically
* fail if funobj was lexically nested inside some other function.
*/
extern JS_PUBLIC_API(JSObject*)
CloneFunctionObject(JSContext* cx, HandleObject funobj);
/**
* As above, but providing an explicit scope chain. scopeChain must not include
* the global object on it; that's implicit. It needs to contain the other
* objects that should end up on the clone's scope chain.
*/
extern JS_PUBLIC_API(JSObject*)
CloneFunctionObject(JSContext* cx, HandleObject funobj, AutoObjectVector& scopeChain);
} // namespace JS
/**
* Given a buffer, return false if the buffer might become a valid
* javascript statement with the addition of more lines. Otherwise return
* true. The intent is to support interactive compilation - accumulate
* lines in a buffer until JS_BufferIsCompilableUnit is true, then pass it to
* the compiler.
*/
extern JS_PUBLIC_API(bool)
JS_BufferIsCompilableUnit(JSContext* cx, JS::Handle<JSObject*> obj, const char* utf8,
size_t length);
/**
* |script| will always be set. On failure, it will be set to nullptr.
*/
extern JS_PUBLIC_API(bool)
JS_CompileScript(JSContext* cx, const char* ascii, size_t length,
const JS::CompileOptions& options,
JS::MutableHandleScript script);
/**
* |script| will always be set. On failure, it will be set to nullptr.
*/
extern JS_PUBLIC_API(bool)
JS_CompileUCScript(JSContext* cx, const char16_t* chars, size_t length,
const JS::CompileOptions& options,
JS::MutableHandleScript script);
extern JS_PUBLIC_API(JSObject*)
JS_GetGlobalFromScript(JSScript* script);
extern JS_PUBLIC_API(const char*)
JS_GetScriptFilename(JSScript* script);
extern JS_PUBLIC_API(unsigned)
JS_GetScriptBaseLineNumber(JSContext* cx, JSScript* script);
extern JS_PUBLIC_API(JSScript*)
JS_GetFunctionScript(JSContext* cx, JS::HandleFunction fun);
namespace JS {
/* Options for JavaScript compilation. */
/*
* In the most common use case, a CompileOptions instance is allocated on the
* stack, and holds non-owning references to non-POD option values: strings;
* principals; objects; and so on. The code declaring the instance guarantees
* that such option values will outlive the CompileOptions itself: objects are
* otherwise rooted; principals have had their reference counts bumped; strings
* will not be freed until the CompileOptions goes out of scope. In this
* situation, CompileOptions only refers to things others own, so it can be
* lightweight.
*
* In some cases, however, we need to hold compilation options with a
* non-stack-like lifetime. For example, JS::CompileOffThread needs to save
* compilation options where a worker thread can find them, and then return
* immediately. The worker thread will come along at some later point, and use
* the options.
*
* The compiler itself just needs to be able to access a collection of options;
* it doesn't care who owns them, or what's keeping them alive. It does its own
* addrefs/copies/tracing/etc.
*
* Furthermore, in some cases compile options are propagated from one entity to
* another (e.g. from a scriipt to a function defined in that script). This
* involves copying over some, but not all, of the options.
*
* So, we have a class hierarchy that reflects these four use cases:
*
* - TransitiveCompileOptions is the common base class, representing options
* that should get propagated from a script to functions defined in that
* script. This is never instantiated directly.
*
* - ReadOnlyCompileOptions is the only subclass of TransitiveCompileOptions,
* representing a full set of compile options. It can be used by code that
* simply needs to access options set elsewhere, like the compiler. This,
* again, is never instantiated directly.
*
* - The usual CompileOptions class must be stack-allocated, and holds
* non-owning references to the filename, element, and so on. It's derived
* from ReadOnlyCompileOptions, so the compiler can use it.
*
* - OwningCompileOptions roots / copies / reference counts of all its values,
* and unroots / frees / releases them when it is destructed. It too is
* derived from ReadOnlyCompileOptions, so the compiler accepts it.
*/
enum class AsmJSOption : uint8_t { Enabled, Disabled, DisabledByDebugger };
/**
* The common base class for the CompileOptions hierarchy.
*
* Use this in code that needs to propagate compile options from one compilation
* unit to another.
*/
class JS_FRIEND_API(TransitiveCompileOptions)
{
protected:
// The Web Platform allows scripts to be loaded from arbitrary cross-origin
// sources. This allows an attack by which a malicious website loads a
// sensitive file (say, a bank statement) cross-origin (using the user's
// cookies), and sniffs the generated syntax errors (via a window.onerror
// handler) for juicy morsels of its contents.
//
// To counter this attack, HTML5 specifies that script errors should be
// sanitized ("muted") when the script is not same-origin with the global
// for which it is loaded. Callers should set this flag for cross-origin
// scripts, and it will be propagated appropriately to child scripts and
// passed back in JSErrorReports.
bool mutedErrors_;
const char* filename_;
const char* introducerFilename_;
const char16_t* sourceMapURL_;
// This constructor leaves 'version' set to JSVERSION_UNKNOWN. The structure
// is unusable until that's set to something more specific; the derived
// classes' constructors take care of that, in ways appropriate to their
// purpose.
TransitiveCompileOptions()
: mutedErrors_(false),
filename_(nullptr),
introducerFilename_(nullptr),
sourceMapURL_(nullptr),
version(JSVERSION_UNKNOWN),
versionSet(false),
utf8(false),
selfHostingMode(false),
canLazilyParse(true),
strictOption(false),
extraWarningsOption(false),
werrorOption(false),
asmJSOption(AsmJSOption::Disabled),
throwOnAsmJSValidationFailureOption(false),
forceAsync(false),
installedFile(false),
sourceIsLazy(false),
introductionType(nullptr),
introductionLineno(0),
introductionOffset(0),
hasIntroductionInfo(false)
{ }
// Set all POD options (those not requiring reference counts, copies,
// rooting, or other hand-holding) to their values in |rhs|.
void copyPODTransitiveOptions(const TransitiveCompileOptions& rhs);
public:
// Read-only accessors for non-POD options. The proper way to set these
// depends on the derived type.
bool mutedErrors() const { return mutedErrors_; }
const char* filename() const { return filename_; }
const char* introducerFilename() const { return introducerFilename_; }
const char16_t* sourceMapURL() const { return sourceMapURL_; }
virtual JSObject* element() const = 0;
virtual JSString* elementAttributeName() const = 0;
virtual JSScript* introductionScript() const = 0;
// POD options.
JSVersion version;
bool versionSet;
bool utf8;
bool selfHostingMode;
bool canLazilyParse;
bool strictOption;
bool extraWarningsOption;
bool werrorOption;
AsmJSOption asmJSOption;
bool throwOnAsmJSValidationFailureOption;
bool forceAsync;
bool installedFile; // 'true' iff pre-compiling js file in packaged app
bool sourceIsLazy;
// |introductionType| is a statically allocated C string:
// one of "eval", "Function", or "GeneratorFunction".
const char* introductionType;
unsigned introductionLineno;
uint32_t introductionOffset;
bool hasIntroductionInfo;
private:
void operator=(const TransitiveCompileOptions&) = delete;
};
/**
* The class representing a full set of compile options.
*
* Use this in code that only needs to access compilation options created
* elsewhere, like the compiler. Don't instantiate this class (the constructor
* is protected anyway); instead, create instances only of the derived classes:
* CompileOptions and OwningCompileOptions.
*/
class JS_FRIEND_API(ReadOnlyCompileOptions) : public TransitiveCompileOptions
{
friend class CompileOptions;
protected:
ReadOnlyCompileOptions()
: TransitiveCompileOptions(),
lineno(1),
column(0),
isRunOnce(false),
noScriptRval(false)
{ }
// Set all POD options (those not requiring reference counts, copies,
// rooting, or other hand-holding) to their values in |rhs|.
void copyPODOptions(const ReadOnlyCompileOptions& rhs);
public:
// Read-only accessors for non-POD options. The proper way to set these
// depends on the derived type.
bool mutedErrors() const { return mutedErrors_; }
const char* filename() const { return filename_; }
const char* introducerFilename() const { return introducerFilename_; }
const char16_t* sourceMapURL() const { return sourceMapURL_; }
virtual JSObject* element() const = 0;
virtual JSString* elementAttributeName() const = 0;
virtual JSScript* introductionScript() const = 0;
// POD options.
unsigned lineno;
unsigned column;
// isRunOnce only applies to non-function scripts.
bool isRunOnce;
bool noScriptRval;
private:
void operator=(const ReadOnlyCompileOptions&) = delete;
};
/**
* Compilation options, with dynamic lifetime. An instance of this type
* makes a copy of / holds / roots all dynamically allocated resources
* (principals; elements; strings) that it refers to. Its destructor frees
* / drops / unroots them. This is heavier than CompileOptions, below, but
* unlike CompileOptions, it can outlive any given stack frame.
*
* Note that this *roots* any JS values it refers to - they're live
* unconditionally. Thus, instances of this type can't be owned, directly
* or indirectly, by a JavaScript object: if any value that this roots ever
* comes to refer to the object that owns this, then the whole cycle, and
* anything else it entrains, will never be freed.
*/
class JS_FRIEND_API(OwningCompileOptions) : public ReadOnlyCompileOptions
{
PersistentRootedObject elementRoot;
PersistentRootedString elementAttributeNameRoot;
PersistentRootedScript introductionScriptRoot;
public:
// A minimal constructor, for use with OwningCompileOptions::copy. This
// leaves |this.version| set to JSVERSION_UNKNOWN; the instance
// shouldn't be used until we've set that to something real (as |copy|
// will).
explicit OwningCompileOptions(JSContext* cx);
~OwningCompileOptions();
JSObject* element() const override { return elementRoot; }
JSString* elementAttributeName() const override { return elementAttributeNameRoot; }
JSScript* introductionScript() const override { return introductionScriptRoot; }
// Set this to a copy of |rhs|. Return false on OOM.
bool copy(JSContext* cx, const ReadOnlyCompileOptions& rhs);
/* These setters make copies of their string arguments, and are fallible. */
bool setFile(JSContext* cx, const char* f);
bool setFileAndLine(JSContext* cx, const char* f, unsigned l);
bool setSourceMapURL(JSContext* cx, const char16_t* s);
bool setIntroducerFilename(JSContext* cx, const char* s);
/* These setters are infallible, and can be chained. */
OwningCompileOptions& setLine(unsigned l) { lineno = l; return *this; }
OwningCompileOptions& setElement(JSObject* e) {
elementRoot = e;
return *this;
}
OwningCompileOptions& setElementAttributeName(JSString* p) {
elementAttributeNameRoot = p;
return *this;
}
OwningCompileOptions& setIntroductionScript(JSScript* s) {
introductionScriptRoot = s;
return *this;
}
OwningCompileOptions& setMutedErrors(bool mute) {
mutedErrors_ = mute;
return *this;
}
OwningCompileOptions& setVersion(JSVersion v) {
version = v;
versionSet = true;
return *this;
}
OwningCompileOptions& setUTF8(bool u) { utf8 = u; return *this; }
OwningCompileOptions& setColumn(unsigned c) { column = c; return *this; }
OwningCompileOptions& setIsRunOnce(bool once) { isRunOnce = once; return *this; }
OwningCompileOptions& setNoScriptRval(bool nsr) { noScriptRval = nsr; return *this; }
OwningCompileOptions& setSelfHostingMode(bool shm) { selfHostingMode = shm; return *this; }
OwningCompileOptions& setCanLazilyParse(bool clp) { canLazilyParse = clp; return *this; }
OwningCompileOptions& setSourceIsLazy(bool l) { sourceIsLazy = l; return *this; }
OwningCompileOptions& setIntroductionType(const char* t) { introductionType = t; return *this; }
bool setIntroductionInfo(JSContext* cx, const char* introducerFn, const char* intro,
unsigned line, JSScript* script, uint32_t offset)
{
if (!setIntroducerFilename(cx, introducerFn))
return false;
introductionType = intro;
introductionLineno = line;
introductionScriptRoot = script;
introductionOffset = offset;
hasIntroductionInfo = true;
return true;
}
private:
void operator=(const CompileOptions& rhs) = delete;
};
/**
* Compilation options stored on the stack. An instance of this type
* simply holds references to dynamically allocated resources (element;
* filename; source map URL) that are owned by something else. If you
* create an instance of this type, it's up to you to guarantee that
* everything you store in it will outlive it.
*/
class MOZ_STACK_CLASS JS_FRIEND_API(CompileOptions) final : public ReadOnlyCompileOptions
{
RootedObject elementRoot;
RootedString elementAttributeNameRoot;
RootedScript introductionScriptRoot;
public:
explicit CompileOptions(JSContext* cx, JSVersion version = JSVERSION_UNKNOWN);
CompileOptions(js::ContextFriendFields* cx, const ReadOnlyCompileOptions& rhs)
: ReadOnlyCompileOptions(), elementRoot(cx), elementAttributeNameRoot(cx),
introductionScriptRoot(cx)
{
copyPODOptions(rhs);
filename_ = rhs.filename();
introducerFilename_ = rhs.introducerFilename();
sourceMapURL_ = rhs.sourceMapURL();
elementRoot = rhs.element();
elementAttributeNameRoot = rhs.elementAttributeName();
introductionScriptRoot = rhs.introductionScript();
}
CompileOptions(js::ContextFriendFields* cx, const TransitiveCompileOptions& rhs)
: ReadOnlyCompileOptions(), elementRoot(cx), elementAttributeNameRoot(cx),
introductionScriptRoot(cx)
{
copyPODTransitiveOptions(rhs);
filename_ = rhs.filename();
introducerFilename_ = rhs.introducerFilename();
sourceMapURL_ = rhs.sourceMapURL();
elementRoot = rhs.element();
elementAttributeNameRoot = rhs.elementAttributeName();
introductionScriptRoot = rhs.introductionScript();
}
JSObject* element() const override { return elementRoot; }
JSString* elementAttributeName() const override { return elementAttributeNameRoot; }
JSScript* introductionScript() const override { return introductionScriptRoot; }
CompileOptions& setFile(const char* f) { filename_ = f; return *this; }
CompileOptions& setLine(unsigned l) { lineno = l; return *this; }
CompileOptions& setFileAndLine(const char* f, unsigned l) {
filename_ = f; lineno = l; return *this;
}
CompileOptions& setSourceMapURL(const char16_t* s) { sourceMapURL_ = s; return *this; }
CompileOptions& setElement(JSObject* e) { elementRoot = e; return *this; }
CompileOptions& setElementAttributeName(JSString* p) {
elementAttributeNameRoot = p;
return *this;
}
CompileOptions& setIntroductionScript(JSScript* s) {
introductionScriptRoot = s;
return *this;
}
CompileOptions& setMutedErrors(bool mute) {
mutedErrors_ = mute;
return *this;
}
CompileOptions& setVersion(JSVersion v) {
version = v;
versionSet = true;
return *this;
}
CompileOptions& setUTF8(bool u) { utf8 = u; return *this; }
CompileOptions& setColumn(unsigned c) { column = c; return *this; }
CompileOptions& setIsRunOnce(bool once) { isRunOnce = once; return *this; }
CompileOptions& setNoScriptRval(bool nsr) { noScriptRval = nsr; return *this; }
CompileOptions& setSelfHostingMode(bool shm) { selfHostingMode = shm; return *this; }
CompileOptions& setCanLazilyParse(bool clp) { canLazilyParse = clp; return *this; }
CompileOptions& setSourceIsLazy(bool l) { sourceIsLazy = l; return *this; }
CompileOptions& setIntroductionType(const char* t) { introductionType = t; return *this; }
CompileOptions& setIntroductionInfo(const char* introducerFn, const char* intro,
unsigned line, JSScript* script, uint32_t offset)
{
introducerFilename_ = introducerFn;
introductionType = intro;
introductionLineno = line;
introductionScriptRoot = script;
introductionOffset = offset;
hasIntroductionInfo = true;
return *this;
}
CompileOptions& maybeMakeStrictMode(bool strict) {
strictOption = strictOption || strict;
return *this;
}
private:
void operator=(const CompileOptions& rhs) = delete;
};
/**
* |script| will always be set. On failure, it will be set to nullptr.
*/
extern JS_PUBLIC_API(bool)
Compile(JSContext* cx, const ReadOnlyCompileOptions& options,
SourceBufferHolder& srcBuf, JS::MutableHandleScript script);
extern JS_PUBLIC_API(bool)
Compile(JSContext* cx, const ReadOnlyCompileOptions& options,
const char* bytes, size_t length, JS::MutableHandleScript script);
extern JS_PUBLIC_API(bool)
Compile(JSContext* cx, const ReadOnlyCompileOptions& options,
const char16_t* chars, size_t length, JS::MutableHandleScript script);
extern JS_PUBLIC_API(bool)
Compile(JSContext* cx, const ReadOnlyCompileOptions& options,
FILE* file, JS::MutableHandleScript script);
extern JS_PUBLIC_API(bool)
Compile(JSContext* cx, const ReadOnlyCompileOptions& options,
const char* filename, JS::MutableHandleScript script);
extern JS_PUBLIC_API(bool)
CompileForNonSyntacticScope(JSContext* cx, const ReadOnlyCompileOptions& options,
SourceBufferHolder& srcBuf, JS::MutableHandleScript script);
extern JS_PUBLIC_API(bool)
CompileForNonSyntacticScope(JSContext* cx, const ReadOnlyCompileOptions& options,
const char* bytes, size_t length, JS::MutableHandleScript script);
extern JS_PUBLIC_API(bool)
CompileForNonSyntacticScope(JSContext* cx, const ReadOnlyCompileOptions& options,
const char16_t* chars, size_t length, JS::MutableHandleScript script);
extern JS_PUBLIC_API(bool)
CompileForNonSyntacticScope(JSContext* cx, const ReadOnlyCompileOptions& options,
FILE* file, JS::MutableHandleScript script);
extern JS_PUBLIC_API(bool)
CompileForNonSyntacticScope(JSContext* cx, const ReadOnlyCompileOptions& options,
const char* filename, JS::MutableHandleScript script);
extern JS_PUBLIC_API(bool)
CanCompileOffThread(JSContext* cx, const ReadOnlyCompileOptions& options, size_t length);
/*
* Off thread compilation control flow.
*
* After successfully triggering an off thread compile of a script, the
* callback will eventually be invoked with the specified data and a token
* for the compilation. The callback will be invoked while off the main thread,
* so must ensure that its operations are thread safe. Afterwards, one of the
* following functions must be invoked on the main thread:
*
* - FinishOffThreadScript, to get the result script (or nullptr on failure).
* - CancelOffThreadScript, to free the resources without creating a script.
*
* The characters passed in to CompileOffThread must remain live until the
* callback is invoked, and the resulting script will be rooted until the call
* to FinishOffThreadScript.
*/
extern JS_PUBLIC_API(bool)
CompileOffThread(JSContext* cx, const ReadOnlyCompileOptions& options,
const char16_t* chars, size_t length,
OffThreadCompileCallback callback, void* callbackData);
extern JS_PUBLIC_API(JSScript*)
FinishOffThreadScript(JSContext* cx, void* token);
extern JS_PUBLIC_API(void)
CancelOffThreadScript(JSContext* cx, void* token);
extern JS_PUBLIC_API(bool)
CompileOffThreadModule(JSContext* cx, const ReadOnlyCompileOptions& options,
const char16_t* chars, size_t length,
OffThreadCompileCallback callback, void* callbackData);
extern JS_PUBLIC_API(JSObject*)
FinishOffThreadModule(JSContext* cx, void* token);
extern JS_PUBLIC_API(void)
CancelOffThreadModule(JSContext* cx, void* token);
/**
* Compile a function with envChain plus the global as its scope chain.
* envChain must contain objects in the current compartment of cx. The actual
* scope chain used for the function will consist of With wrappers for those
* objects, followed by the current global of the compartment cx is in. This
* global must not be explicitly included in the scope chain.
*/
extern JS_PUBLIC_API(bool)
CompileFunction(JSContext* cx, AutoObjectVector& envChain,
const ReadOnlyCompileOptions& options,
const char* name, unsigned nargs, const char* const* argnames,
const char16_t* chars, size_t length, JS::MutableHandleFunction fun);
/**
* Same as above, but taking a SourceBufferHolder for the function body.
*/
extern JS_PUBLIC_API(bool)
CompileFunction(JSContext* cx, AutoObjectVector& envChain,
const ReadOnlyCompileOptions& options,
const char* name, unsigned nargs, const char* const* argnames,
SourceBufferHolder& srcBuf, JS::MutableHandleFunction fun);
/**
* Same as above, but taking a const char * for the function body.
*/
extern JS_PUBLIC_API(bool)
CompileFunction(JSContext* cx, AutoObjectVector& envChain,
const ReadOnlyCompileOptions& options,
const char* name, unsigned nargs, const char* const* argnames,
const char* bytes, size_t length, JS::MutableHandleFunction fun);
} /* namespace JS */
extern JS_PUBLIC_API(JSString*)
JS_DecompileScript(JSContext* cx, JS::Handle<JSScript*> script, const char* name, unsigned indent);
/*
* API extension: OR this into indent to avoid pretty-printing the decompiled
* source resulting from JS_DecompileFunction.
*/
#define JS_DONT_PRETTY_PRINT ((unsigned)0x8000)
extern JS_PUBLIC_API(JSString*)
JS_DecompileFunction(JSContext* cx, JS::Handle<JSFunction*> fun, unsigned indent);
/*
* NB: JS_ExecuteScript and the JS::Evaluate APIs come in two flavors: either
* they use the global as the scope, or they take an AutoObjectVector of objects
* to use as the scope chain. In the former case, the global is also used as
* the "this" keyword value and the variables object (ECMA parlance for where
* 'var' and 'function' bind names) of the execution context for script. In the
* latter case, the first object in the provided list is used, unless the list
* is empty, in which case the global is used.
*
* Why a runtime option? The alternative is to add APIs duplicating those
* for the other value of flags, and that doesn't seem worth the code bloat
* cost. Such new entry points would probably have less obvious names, too, so
* would not tend to be used. The ContextOptionsRef adjustment, OTOH, can be
* more easily hacked into existing code that does not depend on the bug; such
* code can continue to use the familiar JS::Evaluate, etc., entry points.
*/
/**
* Evaluate a script in the scope of the current global of cx.
*/
extern JS_PUBLIC_API(bool)
JS_ExecuteScript(JSContext* cx, JS::HandleScript script, JS::MutableHandleValue rval);
extern JS_PUBLIC_API(bool)
JS_ExecuteScript(JSContext* cx, JS::HandleScript script);
/**
* As above, but providing an explicit scope chain. envChain must not include
* the global object on it; that's implicit. It needs to contain the other
* objects that should end up on the script's scope chain.
*/
extern JS_PUBLIC_API(bool)
JS_ExecuteScript(JSContext* cx, JS::AutoObjectVector& envChain,
JS::HandleScript script, JS::MutableHandleValue rval);
extern JS_PUBLIC_API(bool)
JS_ExecuteScript(JSContext* cx, JS::AutoObjectVector& envChain, JS::HandleScript script);
namespace JS {
/**
* Like the above, but handles a cross-compartment script. If the script is
* cross-compartment, it is cloned into the current compartment before executing.
*/
extern JS_PUBLIC_API(bool)
CloneAndExecuteScript(JSContext* cx, JS::Handle<JSScript*> script,
JS::MutableHandleValue rval);
} /* namespace JS */
namespace JS {
/**
* Evaluate the given source buffer in the scope of the current global of cx.
*/
extern JS_PUBLIC_API(bool)
Evaluate(JSContext* cx, const ReadOnlyCompileOptions& options,
SourceBufferHolder& srcBuf, JS::MutableHandleValue rval);
/**
* As above, but providing an explicit scope chain. envChain must not include
* the global object on it; that's implicit. It needs to contain the other
* objects that should end up on the script's scope chain.
*/
extern JS_PUBLIC_API(bool)
Evaluate(JSContext* cx, AutoObjectVector& envChain, const ReadOnlyCompileOptions& options,
SourceBufferHolder& srcBuf, JS::MutableHandleValue rval);
/**
* Evaluate the given character buffer in the scope of the current global of cx.
*/
extern JS_PUBLIC_API(bool)
Evaluate(JSContext* cx, const ReadOnlyCompileOptions& options,
const char16_t* chars, size_t length, JS::MutableHandleValue rval);
/**
* As above, but providing an explicit scope chain. envChain must not include
* the global object on it; that's implicit. It needs to contain the other
* objects that should end up on the script's scope chain.
*/
extern JS_PUBLIC_API(bool)
Evaluate(JSContext* cx, AutoObjectVector& envChain, const ReadOnlyCompileOptions& options,
const char16_t* chars, size_t length, JS::MutableHandleValue rval);
/**
* Evaluate the given byte buffer in the scope of the current global of cx.
*/
extern JS_PUBLIC_API(bool)
Evaluate(JSContext* cx, const ReadOnlyCompileOptions& options,
const char* bytes, size_t length, JS::MutableHandleValue rval);
/**
* Evaluate the given file in the scope of the current global of cx.
*/
extern JS_PUBLIC_API(bool)
Evaluate(JSContext* cx, const ReadOnlyCompileOptions& options,
const char* filename, JS::MutableHandleValue rval);
/**
* Get the HostResolveImportedModule hook for a global.
*/
extern JS_PUBLIC_API(JSFunction*)
GetModuleResolveHook(JSContext* cx);
/**
* Set the HostResolveImportedModule hook for a global to the given function.
*/
extern JS_PUBLIC_API(void)
SetModuleResolveHook(JSContext* cx, JS::HandleFunction func);
/**
* Parse the given source buffer as a module in the scope of the current global
* of cx and return a source text module record.
*/
extern JS_PUBLIC_API(bool)
CompileModule(JSContext* cx, const ReadOnlyCompileOptions& options,
SourceBufferHolder& srcBuf, JS::MutableHandleObject moduleRecord);
/**
* Set the [[HostDefined]] field of a source text module record to the given
* value.
*/
extern JS_PUBLIC_API(void)
SetModuleHostDefinedField(JSObject* module, const JS::Value& value);
/**
* Get the [[HostDefined]] field of a source text module record.
*/
extern JS_PUBLIC_API(JS::Value)
GetModuleHostDefinedField(JSObject* module);
/*
* Perform the ModuleDeclarationInstantiation operation on on the give source
* text module record.
*
* This transitively resolves all module dependencies (calling the
* HostResolveImportedModule hook) and initializes the environment record for
* the module.
*/
extern JS_PUBLIC_API(bool)
ModuleDeclarationInstantiation(JSContext* cx, JS::HandleObject moduleRecord);
/*
* Perform the ModuleEvaluation operation on on the give source text module
* record.
*
* This does nothing if this module has already been evaluated. Otherwise, it
* transitively evaluates all dependences of this module and then evaluates this
* module.
*
* ModuleDeclarationInstantiation must have completed prior to calling this.
*/
extern JS_PUBLIC_API(bool)
ModuleEvaluation(JSContext* cx, JS::HandleObject moduleRecord);
/*
* Get a list of the module specifiers used by a source text module
* record to request importation of modules.
*
* The result is a JavaScript array of string values. To extract the individual
* values use only JS_GetArrayLength and JS_GetElement with indices 0 to
* length - 1.
*/
extern JS_PUBLIC_API(JSObject*)
GetRequestedModules(JSContext* cx, JS::HandleObject moduleRecord);
/*
* Get the script associated with a module.
*/
extern JS_PUBLIC_API(JSScript*)
GetModuleScript(JSContext* cx, JS::HandleObject moduleRecord);
} /* namespace JS */
extern JS_PUBLIC_API(bool)
JS_CheckForInterrupt(JSContext* cx);
/*
* These functions allow setting an interrupt callback that will be called
* from the JS thread some time after any thread triggered the callback using
* JS_RequestInterruptCallback(cx).
*
* To schedule the GC and for other activities the engine internally triggers
* interrupt callbacks. The embedding should thus not rely on callbacks being
* triggered through the external API only.
*
* Important note: Additional callbacks can occur inside the callback handler
* if it re-enters the JS engine. The embedding must ensure that the callback
* is disconnected before attempting such re-entry.
*/
extern JS_PUBLIC_API(bool)
JS_AddInterruptCallback(JSContext* cx, JSInterruptCallback callback);
extern JS_PUBLIC_API(bool)
JS_DisableInterruptCallback(JSContext* cx);
extern JS_PUBLIC_API(void)
JS_ResetInterruptCallback(JSContext* cx, bool enable);
extern JS_PUBLIC_API(void)
JS_RequestInterruptCallback(JSContext* cx);
namespace JS {
/**
* Sets the callback that's invoked whenever an incumbent global is required.
*
* SpiderMonkey doesn't itself have a notion of incumbent globals as defined
* by the html spec, so we need the embedding to provide this.
* See dom/base/ScriptSettings.h for details.
*/
extern JS_PUBLIC_API(void)
SetGetIncumbentGlobalCallback(JSContext* cx, JSGetIncumbentGlobalCallback callback);
/**
* Sets the callback that's invoked whenever a Promise job should be enqeued.
*
* SpiderMonkey doesn't schedule Promise resolution jobs itself; instead,
* using this function the embedding can provide a callback to do that
* scheduling. The provided `callback` is invoked with the promise job,
* the corresponding Promise's allocation stack, and the `data` pointer
* passed here as arguments.
*/
extern JS_PUBLIC_API(void)
SetEnqueuePromiseJobCallback(JSContext* cx, JSEnqueuePromiseJobCallback callback,
void* data = nullptr);
/**
* Sets the callback that's invoked whenever a Promise is rejected without
* a rejection handler, and when a Promise that was previously rejected
* without a handler gets a handler attached.
*/
extern JS_PUBLIC_API(void)
SetPromiseRejectionTrackerCallback(JSContext* cx, JSPromiseRejectionTrackerCallback callback,
void* data = nullptr);
/**
* Returns a new instance of the Promise builtin class in the current
* compartment, with the right slot layout. If a `proto` is passed, that gets
* set as the instance's [[Prototype]] instead of the original value of
* `Promise.prototype`.
*/
extern JS_PUBLIC_API(JSObject*)
NewPromiseObject(JSContext* cx, JS::HandleObject executor, JS::HandleObject proto = nullptr);
/**
* Returns true if the given object is an unwrapped PromiseObject, false
* otherwise.
*/
extern JS_PUBLIC_API(bool)
IsPromiseObject(JS::HandleObject obj);
/**
* Returns the current compartment's original Promise constructor.
*/
extern JS_PUBLIC_API(JSObject*)
GetPromiseConstructor(JSContext* cx);
/**
* Returns the current compartment's original Promise.prototype.
*/
extern JS_PUBLIC_API(JSObject*)
GetPromisePrototype(JSContext* cx);
// Keep this in sync with the PROMISE_STATE defines in SelfHostingDefines.h.
enum class PromiseState {
Pending,
Fulfilled,
Rejected
};
/**
* Returns the given Promise's state as a JS::PromiseState enum value.
*
* Returns JS::PromiseState::Pending if the given object is a wrapper that
* can't safely be unwrapped.
*/
extern JS_PUBLIC_API(PromiseState)
GetPromiseState(JS::HandleObject promise);
/**
* Returns the given Promise's process-unique ID.
*/
JS_PUBLIC_API(uint64_t)
GetPromiseID(JS::HandleObject promise);
/**
* Returns the given Promise's result: either the resolution value for
* fulfilled promises, or the rejection reason for rejected ones.
*/
extern JS_PUBLIC_API(JS::Value)
GetPromiseResult(JS::HandleObject promise);
/**
* Returns a js::SavedFrame linked list of the stack that lead to the given
* Promise's allocation.
*/
extern JS_PUBLIC_API(JSObject*)
GetPromiseAllocationSite(JS::HandleObject promise);
extern JS_PUBLIC_API(JSObject*)
GetPromiseResolutionSite(JS::HandleObject promise);
#ifdef DEBUG
extern JS_PUBLIC_API(void)
DumpPromiseAllocationSite(JSContext* cx, JS::HandleObject promise);
extern JS_PUBLIC_API(void)
DumpPromiseResolutionSite(JSContext* cx, JS::HandleObject promise);
#endif
/**
* Calls the current compartment's original Promise.resolve on the original
* Promise constructor, with `resolutionValue` passed as an argument.
*/
extern JS_PUBLIC_API(JSObject*)
CallOriginalPromiseResolve(JSContext* cx, JS::HandleValue resolutionValue);
/**
* Calls the current compartment's original Promise.reject on the original
* Promise constructor, with `resolutionValue` passed as an argument.
*/
extern JS_PUBLIC_API(JSObject*)
CallOriginalPromiseReject(JSContext* cx, JS::HandleValue rejectionValue);
/**
* Resolves the given Promise with the given `resolutionValue`.
*
* Calls the `resolve` function that was passed to the executor function when
* the Promise was created.
*/
extern JS_PUBLIC_API(bool)
ResolvePromise(JSContext* cx, JS::HandleObject promise, JS::HandleValue resolutionValue);
/**
* Rejects the given `promise` with the given `rejectionValue`.
*
* Calls the `reject` function that was passed to the executor function when
* the Promise was created.
*/
extern JS_PUBLIC_API(bool)
RejectPromise(JSContext* cx, JS::HandleObject promise, JS::HandleValue rejectionValue);
/**
* Calls the current compartment's original Promise.prototype.then on the
* given `promise`, with `onResolve` and `onReject` passed as arguments.
*
* Asserts if the passed-in `promise` object isn't an unwrapped instance of
* `Promise` or a subclass or `onResolve` and `onReject` aren't both either
* `nullptr` or callable objects.
*/
extern JS_PUBLIC_API(JSObject*)
CallOriginalPromiseThen(JSContext* cx, JS::HandleObject promise,
JS::HandleObject onResolve, JS::HandleObject onReject);
/**
* Unforgeable, optimized version of the JS builtin Promise.prototype.then.
*
* Takes a Promise instance and `onResolve`, `onReject` callables to enqueue
* as reactions for that promise. In difference to Promise.prototype.then,
* this doesn't create and return a new Promise instance.
*
* Asserts if the passed-in `promise` object isn't an unwrapped instance of
* `Promise` or a subclass or `onResolve` and `onReject` aren't both callable
* objects.
*/
extern JS_PUBLIC_API(bool)
AddPromiseReactions(JSContext* cx, JS::HandleObject promise,
JS::HandleObject onResolve, JS::HandleObject onReject);
/**
* Unforgeable version of the JS builtin Promise.all.
*
* Takes an AutoObjectVector of Promise objects and returns a promise that's
* resolved with an array of resolution values when all those promises have
* been resolved, or rejected with the rejection value of the first rejected
* promise.
*
* Asserts that all objects in the `promises` vector are, maybe wrapped,
* instances of `Promise` or a subclass of `Promise`.
*/
extern JS_PUBLIC_API(JSObject*)
GetWaitForAllPromise(JSContext* cx, const JS::AutoObjectVector& promises);
/**
* An AsyncTask represents a SpiderMonkey-internal operation that starts on a
* JSContext's owner thread, possibly executes on other threads, completes, and
* then needs to be scheduled to run again on the JSContext's owner thread. The
* embedding provides for this final dispatch back to the JSContext's owner
* thread by calling methods on this interface when requested.
*/
struct JS_PUBLIC_API(AsyncTask)
{
AsyncTask() : user(nullptr) {}
virtual ~AsyncTask() {}
/**
* After the FinishAsyncTaskCallback is called and succeeds, one of these
* two functions will be called on the original JSContext's owner thread.
*/
virtual void finish(JSContext* cx) = 0;
virtual void cancel(JSContext* cx) = 0;
/* The embedding may use this field to attach arbitrary data to a task. */
void* user;
};
/**
* A new AsyncTask object, created inside SpiderMonkey on the JSContext's owner
* thread, will be passed to the StartAsyncTaskCallback before it is dispatched
* to another thread. The embedding may use the AsyncTask::user field to attach
* additional task state.
*
* If this function succeeds, SpiderMonkey will call the FinishAsyncTaskCallback
* at some point in the future. Otherwise, FinishAsyncTaskCallback will *not*
* be called. SpiderMonkey assumes that, if StartAsyncTaskCallback fails, it is
* because the JSContext is being shut down.
*/
typedef bool
(*StartAsyncTaskCallback)(JSContext* cx, AsyncTask* task);
/**
* The FinishAsyncTaskCallback may be called from any thread and will only be
* passed AsyncTasks that have already been started via StartAsyncTaskCallback.
* If the embedding returns 'true', indicating success, the embedding must call
* either task->finish() or task->cancel() on the JSContext's owner thread at
* some point in the future.
*/
typedef bool
(*FinishAsyncTaskCallback)(AsyncTask* task);
/**
* Set the above callbacks for the given context.
*/
extern JS_PUBLIC_API(void)
SetAsyncTaskCallbacks(JSContext* cx, StartAsyncTaskCallback start, FinishAsyncTaskCallback finish);
} // namespace JS
extern JS_PUBLIC_API(bool)
JS_IsRunning(JSContext* cx);
namespace JS {
/**
* This class can be used to store a pointer to the youngest frame of a saved
* stack in the specified JSContext. This reference will be picked up by any new
* calls performed until the class is destroyed, with the specified asyncCause,
* that must not be empty.
*
* Any stack capture initiated during these new calls will go through the async
* stack instead of the current stack.
*
* Capturing the stack before a new call is performed will not be affected.
*
* The provided chain of SavedFrame objects can live in any compartment,
* although it will be copied to the compartment where the stack is captured.
*
* See also `js/src/doc/SavedFrame/SavedFrame.md` for documentation on async
* stack frames.
*/
class MOZ_STACK_CLASS JS_PUBLIC_API(AutoSetAsyncStackForNewCalls)
{
JSContext* cx;
RootedObject oldAsyncStack;
const char* oldAsyncCause;
bool oldAsyncCallIsExplicit;
public:
enum class AsyncCallKind {
// The ordinary kind of call, where we may apply an async
// parent if there is no ordinary parent.
IMPLICIT,
// An explicit async parent, e.g., callFunctionWithAsyncStack,
// where we always want to override any ordinary parent.
EXPLICIT
};
// The stack parameter cannot be null by design, because it would be
// ambiguous whether that would clear any scheduled async stack and make the
// normal stack reappear in the new call, or just keep the async stack
// already scheduled for the new call, if any.
//
// asyncCause is owned by the caller and its lifetime must outlive the
// lifetime of the AutoSetAsyncStackForNewCalls object. It is strongly
// encouraged that asyncCause be a string constant or similar statically
// allocated string.
AutoSetAsyncStackForNewCalls(JSContext* cx, HandleObject stack,
const char* asyncCause,
AsyncCallKind kind = AsyncCallKind::IMPLICIT);
~AutoSetAsyncStackForNewCalls();
};
} // namespace JS
/************************************************************************/
/*
* Strings.
*
* NB: JS_NewUCString takes ownership of bytes on success, avoiding a copy;
* but on error (signified by null return), it leaves chars owned by the
* caller. So the caller must free bytes in the error case, if it has no use
* for them. In contrast, all the JS_New*StringCopy* functions do not take
* ownership of the character memory passed to them -- they copy it.
*/
extern JS_PUBLIC_API(JSString*)
JS_NewStringCopyN(JSContext* cx, const char* s, size_t n);
extern JS_PUBLIC_API(JSString*)
JS_NewStringCopyZ(JSContext* cx, const char* s);
extern JS_PUBLIC_API(JSString*)
JS_NewStringCopyUTF8Z(JSContext* cx, const JS::ConstUTF8CharsZ s);
extern JS_PUBLIC_API(JSString*)
JS_NewStringCopyUTF8N(JSContext* cx, const JS::UTF8Chars s);
extern JS_PUBLIC_API(JSString*)
JS_AtomizeAndPinJSString(JSContext* cx, JS::HandleString str);
extern JS_PUBLIC_API(JSString*)
JS_AtomizeStringN(JSContext* cx, const char* s, size_t length);
extern JS_PUBLIC_API(JSString*)
JS_AtomizeString(JSContext* cx, const char* s);
extern JS_PUBLIC_API(JSString*)
JS_AtomizeAndPinStringN(JSContext* cx, const char* s, size_t length);
extern JS_PUBLIC_API(JSString*)
JS_AtomizeAndPinString(JSContext* cx, const char* s);
extern JS_PUBLIC_API(JSString*)
JS_NewUCString(JSContext* cx, char16_t* chars, size_t length);
extern JS_PUBLIC_API(JSString*)
JS_NewUCStringCopyN(JSContext* cx, const char16_t* s, size_t n);
extern JS_PUBLIC_API(JSString*)
JS_NewUCStringCopyZ(JSContext* cx, const char16_t* s);
extern JS_PUBLIC_API(JSString*)
JS_AtomizeUCStringN(JSContext* cx, const char16_t* s, size_t length);
extern JS_PUBLIC_API(JSString*)
JS_AtomizeUCString(JSContext* cx, const char16_t* s);
extern JS_PUBLIC_API(JSString*)
JS_AtomizeAndPinUCStringN(JSContext* cx, const char16_t* s, size_t length);
extern JS_PUBLIC_API(JSString*)
JS_AtomizeAndPinUCString(JSContext* cx, const char16_t* s);
extern JS_PUBLIC_API(bool)
JS_CompareStrings(JSContext* cx, JSString* str1, JSString* str2, int32_t* result);
extern JS_PUBLIC_API(bool)
JS_StringEqualsAscii(JSContext* cx, JSString* str, const char* asciiBytes, bool* match);
extern JS_PUBLIC_API(size_t)
JS_PutEscapedString(JSContext* cx, char* buffer, size_t size, JSString* str, char quote);
extern JS_PUBLIC_API(bool)
JS_FileEscapedString(FILE* fp, JSString* str, char quote);
/*
* Extracting string characters and length.
*
* While getting the length of a string is infallible, getting the chars can
* fail. As indicated by the lack of a JSContext parameter, there are two
* special cases where getting the chars is infallible:
*
* The first case is for strings that have been atomized, e.g. directly by
* JS_AtomizeAndPinString or implicitly because it is stored in a jsid.
*
* The second case is "flat" strings that have been explicitly prepared in a
* fallible context by JS_FlattenString. To catch errors, a separate opaque
* JSFlatString type is returned by JS_FlattenString and expected by
* JS_GetFlatStringChars. Note, though, that this is purely a syntactic
* distinction: the input and output of JS_FlattenString are the same actual
* GC-thing. If a JSString is known to be flat, JS_ASSERT_STRING_IS_FLAT can be
* used to make a debug-checked cast. Example:
*
* // in a fallible context
* JSFlatString* fstr = JS_FlattenString(cx, str);
* if (!fstr)
* return false;
* MOZ_ASSERT(fstr == JS_ASSERT_STRING_IS_FLAT(str));
*
* // in an infallible context, for the same 'str'
* AutoCheckCannotGC nogc;
* const char16_t* chars = JS_GetTwoByteFlatStringChars(nogc, fstr)
* MOZ_ASSERT(chars);
*
* Flat strings and interned strings are always null-terminated, so
* JS_FlattenString can be used to get a null-terminated string.
*
* Additionally, string characters are stored as either Latin1Char (8-bit)
* or char16_t (16-bit). Clients can use JS_StringHasLatin1Chars and can then
* call either the Latin1* or TwoByte* functions. Some functions like
* JS_CopyStringChars and JS_GetStringCharAt accept both Latin1 and TwoByte
* strings.
*/
extern JS_PUBLIC_API(size_t)
JS_GetStringLength(JSString* str);
extern JS_PUBLIC_API(bool)
JS_StringIsFlat(JSString* str);
/** Returns true iff the string's characters are stored as Latin1. */
extern JS_PUBLIC_API(bool)
JS_StringHasLatin1Chars(JSString* str);
extern JS_PUBLIC_API(const JS::Latin1Char*)
JS_GetLatin1StringCharsAndLength(JSContext* cx, const JS::AutoCheckCannotGC& nogc, JSString* str,
size_t* length);
extern JS_PUBLIC_API(const char16_t*)
JS_GetTwoByteStringCharsAndLength(JSContext* cx, const JS::AutoCheckCannotGC& nogc, JSString* str,
size_t* length);
extern JS_PUBLIC_API(bool)
JS_GetStringCharAt(JSContext* cx, JSString* str, size_t index, char16_t* res);
extern JS_PUBLIC_API(char16_t)
JS_GetFlatStringCharAt(JSFlatString* str, size_t index);
extern JS_PUBLIC_API(const char16_t*)
JS_GetTwoByteExternalStringChars(JSString* str);
extern JS_PUBLIC_API(bool)
JS_CopyStringChars(JSContext* cx, mozilla::Range<char16_t> dest, JSString* str);
extern JS_PUBLIC_API(JSFlatString*)
JS_FlattenString(JSContext* cx, JSString* str);
extern JS_PUBLIC_API(const JS::Latin1Char*)
JS_GetLatin1FlatStringChars(const JS::AutoCheckCannotGC& nogc, JSFlatString* str);
extern JS_PUBLIC_API(const char16_t*)
JS_GetTwoByteFlatStringChars(const JS::AutoCheckCannotGC& nogc, JSFlatString* str);
static MOZ_ALWAYS_INLINE JSFlatString*
JSID_TO_FLAT_STRING(jsid id)
{
MOZ_ASSERT(JSID_IS_STRING(id));
return (JSFlatString*)(JSID_BITS(id));
}
static MOZ_ALWAYS_INLINE JSFlatString*
JS_ASSERT_STRING_IS_FLAT(JSString* str)
{
MOZ_ASSERT(JS_StringIsFlat(str));
return (JSFlatString*)str;
}
static MOZ_ALWAYS_INLINE JSString*
JS_FORGET_STRING_FLATNESS(JSFlatString* fstr)
{
return (JSString*)fstr;
}
/*
* Additional APIs that avoid fallibility when given a flat string.
*/
extern JS_PUBLIC_API(bool)
JS_FlatStringEqualsAscii(JSFlatString* str, const char* asciiBytes);
extern JS_PUBLIC_API(size_t)
JS_PutEscapedFlatString(char* buffer, size_t size, JSFlatString* str, char quote);
/**
* Create a dependent string, i.e., a string that owns no character storage,
* but that refers to a slice of another string's chars. Dependent strings
* are mutable by definition, so the thread safety comments above apply.
*/
extern JS_PUBLIC_API(JSString*)
JS_NewDependentString(JSContext* cx, JS::HandleString str, size_t start,
size_t length);
/**
* Concatenate two strings, possibly resulting in a rope.
* See above for thread safety comments.
*/
extern JS_PUBLIC_API(JSString*)
JS_ConcatStrings(JSContext* cx, JS::HandleString left, JS::HandleString right);
/**
* For JS_DecodeBytes, set *dstlenp to the size of the destination buffer before
* the call; on return, *dstlenp contains the number of characters actually
* stored. To determine the necessary destination buffer size, make a sizing
* call that passes nullptr for dst.
*
* On errors, the functions report the error. In that case, *dstlenp contains
* the number of characters or bytes transferred so far. If cx is nullptr, no
* error is reported on failure, and the functions simply return false.
*
* NB: This function does not store an additional zero byte or char16_t after the
* transcoded string.
*/
JS_PUBLIC_API(bool)
JS_DecodeBytes(JSContext* cx, const char* src, size_t srclen, char16_t* dst,
size_t* dstlenp);
/**
* A variation on JS_EncodeCharacters where a null terminated string is
* returned that you are expected to call JS_free on when done.
*/
JS_PUBLIC_API(char*)
JS_EncodeString(JSContext* cx, JSString* str);
/**
* Same behavior as JS_EncodeString(), but encode into UTF-8 string
*/
JS_PUBLIC_API(char*)
JS_EncodeStringToUTF8(JSContext* cx, JS::HandleString str);
/**
* Get number of bytes in the string encoding (without accounting for a
* terminating zero bytes. The function returns (size_t) -1 if the string
* can not be encoded into bytes and reports an error using cx accordingly.
*/
JS_PUBLIC_API(size_t)
JS_GetStringEncodingLength(JSContext* cx, JSString* str);
/**
* Encode string into a buffer. The function does not stores an additional
* zero byte. The function returns (size_t) -1 if the string can not be
* encoded into bytes with no error reported. Otherwise it returns the number
* of bytes that are necessary to encode the string. If that exceeds the
* length parameter, the string will be cut and only length bytes will be
* written into the buffer.
*/
JS_PUBLIC_API(size_t)
JS_EncodeStringToBuffer(JSContext* cx, JSString* str, char* buffer, size_t length);
class MOZ_RAII JSAutoByteString
{
public:
JSAutoByteString(JSContext* cx, JSString* str
MOZ_GUARD_OBJECT_NOTIFIER_PARAM)
: mBytes(JS_EncodeString(cx, str))
{
MOZ_ASSERT(cx);
MOZ_GUARD_OBJECT_NOTIFIER_INIT;
}
explicit JSAutoByteString(MOZ_GUARD_OBJECT_NOTIFIER_ONLY_PARAM)
: mBytes(nullptr)
{
MOZ_GUARD_OBJECT_NOTIFIER_INIT;
}
~JSAutoByteString() {
JS_free(nullptr, mBytes);
}
/* Take ownership of the given byte array. */
void initBytes(char* bytes) {
MOZ_ASSERT(!mBytes);
mBytes = bytes;
}
char* encodeLatin1(JSContext* cx, JSString* str) {
MOZ_ASSERT(!mBytes);
MOZ_ASSERT(cx);
mBytes = JS_EncodeString(cx, str);
return mBytes;
}
char* encodeLatin1(js::ExclusiveContext* cx, JSString* str);
char* encodeUtf8(JSContext* cx, JS::HandleString str) {
MOZ_ASSERT(!mBytes);
MOZ_ASSERT(cx);
mBytes = JS_EncodeStringToUTF8(cx, str);
return mBytes;
}
void clear() {
js_free(mBytes);
mBytes = nullptr;
}
char* ptr() const {
return mBytes;
}
bool operator!() const {
return !mBytes;
}
size_t length() const {
if (!mBytes)
return 0;
return strlen(mBytes);
}
private:
char* mBytes;
MOZ_DECL_USE_GUARD_OBJECT_NOTIFIER
/* Copy and assignment are not supported. */
JSAutoByteString(const JSAutoByteString& another);
JSAutoByteString& operator=(const JSAutoByteString& another);
};
namespace JS {
extern JS_PUBLIC_API(JSAddonId*)
NewAddonId(JSContext* cx, JS::HandleString str);
extern JS_PUBLIC_API(JSString*)
StringOfAddonId(JSAddonId* id);
extern JS_PUBLIC_API(JSAddonId*)
AddonIdOfObject(JSObject* obj);
} // namespace JS
/************************************************************************/
/*
* Symbols
*/
namespace JS {
/**
* Create a new Symbol with the given description. This function never returns
* a Symbol that is in the Runtime-wide symbol registry.
*
* If description is null, the new Symbol's [[Description]] attribute is
* undefined.
*/
JS_PUBLIC_API(Symbol*)
NewSymbol(JSContext* cx, HandleString description);
/**
* Symbol.for as specified in ES6.
*
* Get a Symbol with the description 'key' from the Runtime-wide symbol registry.
* If there is not already a Symbol with that description in the registry, a new
* Symbol is created and registered. 'key' must not be null.
*/
JS_PUBLIC_API(Symbol*)
GetSymbolFor(JSContext* cx, HandleString key);
/**
* Get the [[Description]] attribute of the given symbol.
*
* This function is infallible. If it returns null, that means the symbol's
* [[Description]] is undefined.
*/
JS_PUBLIC_API(JSString*)
GetSymbolDescription(HandleSymbol symbol);
/* Well-known symbols. */
#define JS_FOR_EACH_WELL_KNOWN_SYMBOL(macro) \
macro(isConcatSpreadable) \
macro(iterator) \
macro(match) \
macro(replace) \
macro(search) \
macro(species) \
macro(hasInstance) \
macro(split) \
macro(toPrimitive) \
macro(toStringTag) \
macro(unscopables)
enum class SymbolCode : uint32_t {
// There is one SymbolCode for each well-known symbol.
#define JS_DEFINE_SYMBOL_ENUM(name) name,
JS_FOR_EACH_WELL_KNOWN_SYMBOL(JS_DEFINE_SYMBOL_ENUM) // SymbolCode::iterator, etc.
#undef JS_DEFINE_SYMBOL_ENUM
Limit,
InSymbolRegistry = 0xfffffffe, // created by Symbol.for() or JS::GetSymbolFor()
UniqueSymbol = 0xffffffff // created by Symbol() or JS::NewSymbol()
};
/* For use in loops that iterate over the well-known symbols. */
const size_t WellKnownSymbolLimit = size_t(SymbolCode::Limit);
/**
* Return the SymbolCode telling what sort of symbol `symbol` is.
*
* A symbol's SymbolCode never changes once it is created.
*/
JS_PUBLIC_API(SymbolCode)
GetSymbolCode(Handle<Symbol*> symbol);
/**
* Get one of the well-known symbols defined by ES6. A single set of well-known
* symbols is shared by all compartments in a JSRuntime.
*
* `which` must be in the range [0, WellKnownSymbolLimit).
*/
JS_PUBLIC_API(Symbol*)
GetWellKnownSymbol(JSContext* cx, SymbolCode which);
/**
* Return true if the given JSPropertySpec::name or JSFunctionSpec::name value
* is actually a symbol code and not a string. See JS_SYM_FN.
*/
inline bool
PropertySpecNameIsSymbol(const char* name)
{
uintptr_t u = reinterpret_cast<uintptr_t>(name);
return u != 0 && u - 1 < WellKnownSymbolLimit;
}
JS_PUBLIC_API(bool)
PropertySpecNameEqualsId(const char* name, HandleId id);
/**
* Create a jsid that does not need to be marked for GC.
*
* 'name' is a JSPropertySpec::name or JSFunctionSpec::name value. The
* resulting jsid, on success, is either an interned string or a well-known
* symbol; either way it is immune to GC so there is no need to visit *idp
* during GC marking.
*/
JS_PUBLIC_API(bool)
PropertySpecNameToPermanentId(JSContext* cx, const char* name, jsid* idp);
} /* namespace JS */
/************************************************************************/
/*
* JSON functions
*/
typedef bool (* JSONWriteCallback)(const char16_t* buf, uint32_t len, void* data);
/**
* JSON.stringify as specified by ES5.
*/
JS_PUBLIC_API(bool)
JS_Stringify(JSContext* cx, JS::MutableHandleValue value, JS::HandleObject replacer,
JS::HandleValue space, JSONWriteCallback callback, void* data);
namespace JS {
/**
* An API akin to JS_Stringify but with the goal of not having observable
* side-effects when the stringification is performed. This means it does not
* allow a replacer or a custom space, and has the following constraints on its
* input:
*
* 1) The input must be a plain object or array, not an abitrary value.
* 2) Every value in the graph reached by the algorithm starting with this
* object must be one of the following: null, undefined, a string (NOT a
* string object!), a boolean, a finite number (i.e. no NaN or Infinity or
* -Infinity), a plain object with no accessor properties, or an Array with
* no holes.
*
* The actual behavior differs from JS_Stringify only in asserting the above and
* NOT attempting to get the "toJSON" property from things, since that could
* clearly have side-effects.
*/
JS_PUBLIC_API(bool)
ToJSONMaybeSafely(JSContext* cx, JS::HandleObject input,
JSONWriteCallback callback, void* data);
} /* namespace JS */
/**
* JSON.parse as specified by ES5.
*/
JS_PUBLIC_API(bool)
JS_ParseJSON(JSContext* cx, const char16_t* chars, uint32_t len, JS::MutableHandleValue vp);
JS_PUBLIC_API(bool)
JS_ParseJSON(JSContext* cx, JS::HandleString str, JS::MutableHandleValue vp);
JS_PUBLIC_API(bool)
JS_ParseJSONWithReviver(JSContext* cx, const char16_t* chars, uint32_t len, JS::HandleValue reviver,
JS::MutableHandleValue vp);
JS_PUBLIC_API(bool)
JS_ParseJSONWithReviver(JSContext* cx, JS::HandleString str, JS::HandleValue reviver,
JS::MutableHandleValue vp);
/************************************************************************/
/**
* The default locale for the ECMAScript Internationalization API
* (Intl.Collator, Intl.NumberFormat, Intl.DateTimeFormat).
* Note that the Internationalization API encourages clients to
* specify their own locales.
* The locale string remains owned by the caller.
*/
extern JS_PUBLIC_API(bool)
JS_SetDefaultLocale(JSContext* cx, const char* locale);
/**
* Look up the default locale for the ECMAScript Internationalization API.
*/
extern JS_PUBLIC_API(JS::UniqueChars)
JS_GetDefaultLocale(JSContext* cx);
/**
* Reset the default locale to OS defaults.
*/
extern JS_PUBLIC_API(void)
JS_ResetDefaultLocale(JSContext* cx);
/**
* Locale specific string conversion and error message callbacks.
*/
struct JSLocaleCallbacks {
JSLocaleToUpperCase localeToUpperCase;
JSLocaleToLowerCase localeToLowerCase;
JSLocaleCompare localeCompare; // not used #if EXPOSE_INTL_API
JSLocaleToUnicode localeToUnicode;
};
/**
* Establish locale callbacks. The pointer must persist as long as the
* JSContext. Passing nullptr restores the default behaviour.
*/
extern JS_PUBLIC_API(void)
JS_SetLocaleCallbacks(JSContext* cx, const JSLocaleCallbacks* callbacks);
/**
* Return the address of the current locale callbacks struct, which may
* be nullptr.
*/
extern JS_PUBLIC_API(const JSLocaleCallbacks*)
JS_GetLocaleCallbacks(JSContext* cx);
/************************************************************************/
/*
* Error reporting.
*/
namespace JS {
const uint16_t MaxNumErrorArguments = 10;
};
/**
* Report an exception represented by the sprintf-like conversion of format
* and its arguments.
*/
extern JS_PUBLIC_API(void)
JS_ReportErrorASCII(JSContext* cx, const char* format, ...)
MOZ_FORMAT_PRINTF(2, 3);
extern JS_PUBLIC_API(void)
JS_ReportErrorLatin1(JSContext* cx, const char* format, ...)
MOZ_FORMAT_PRINTF(2, 3);
extern JS_PUBLIC_API(void)
JS_ReportErrorUTF8(JSContext* cx, const char* format, ...)
MOZ_FORMAT_PRINTF(2, 3);
/*
* Use an errorNumber to retrieve the format string, args are char*
*/
extern JS_PUBLIC_API(void)
JS_ReportErrorNumberASCII(JSContext* cx, JSErrorCallback errorCallback,
void* userRef, const unsigned errorNumber, ...);
extern JS_PUBLIC_API(void)
JS_ReportErrorNumberASCIIVA(JSContext* cx, JSErrorCallback errorCallback,
void* userRef, const unsigned errorNumber, va_list ap);
extern JS_PUBLIC_API(void)
JS_ReportErrorNumberLatin1(JSContext* cx, JSErrorCallback errorCallback,
void* userRef, const unsigned errorNumber, ...);
#ifdef va_start
extern JS_PUBLIC_API(void)
JS_ReportErrorNumberLatin1VA(JSContext* cx, JSErrorCallback errorCallback,
void* userRef, const unsigned errorNumber, va_list ap);
#endif
extern JS_PUBLIC_API(void)
JS_ReportErrorNumberUTF8(JSContext* cx, JSErrorCallback errorCallback,
void* userRef, const unsigned errorNumber, ...);
#ifdef va_start
extern JS_PUBLIC_API(void)
JS_ReportErrorNumberUTF8VA(JSContext* cx, JSErrorCallback errorCallback,
void* userRef, const unsigned errorNumber, va_list ap);
#endif
/*
* Use an errorNumber to retrieve the format string, args are char16_t*
*/
extern JS_PUBLIC_API(void)
JS_ReportErrorNumberUC(JSContext* cx, JSErrorCallback errorCallback,
void* userRef, const unsigned errorNumber, ...);
extern JS_PUBLIC_API(void)
JS_ReportErrorNumberUCArray(JSContext* cx, JSErrorCallback errorCallback,
void* userRef, const unsigned errorNumber,
const char16_t** args);
/**
* As above, but report a warning instead (JSREPORT_IS_WARNING(report.flags)).
* Return true if there was no error trying to issue the warning, and if the
* warning was not converted into an error due to the JSOPTION_WERROR option
* being set, false otherwise.
*/
extern JS_PUBLIC_API(bool)
JS_ReportWarningASCII(JSContext* cx, const char* format, ...)
MOZ_FORMAT_PRINTF(2, 3);
extern JS_PUBLIC_API(bool)
JS_ReportWarningLatin1(JSContext* cx, const char* format, ...)
MOZ_FORMAT_PRINTF(2, 3);
extern JS_PUBLIC_API(bool)
JS_ReportWarningUTF8(JSContext* cx, const char* format, ...)
MOZ_FORMAT_PRINTF(2, 3);
extern JS_PUBLIC_API(bool)
JS_ReportErrorFlagsAndNumberASCII(JSContext* cx, unsigned flags,
JSErrorCallback errorCallback, void* userRef,
const unsigned errorNumber, ...);
extern JS_PUBLIC_API(bool)
JS_ReportErrorFlagsAndNumberLatin1(JSContext* cx, unsigned flags,
JSErrorCallback errorCallback, void* userRef,
const unsigned errorNumber, ...);
extern JS_PUBLIC_API(bool)
JS_ReportErrorFlagsAndNumberUTF8(JSContext* cx, unsigned flags,
JSErrorCallback errorCallback, void* userRef,
const unsigned errorNumber, ...);
extern JS_PUBLIC_API(bool)
JS_ReportErrorFlagsAndNumberUC(JSContext* cx, unsigned flags,
JSErrorCallback errorCallback, void* userRef,
const unsigned errorNumber, ...);
/**
* Complain when out of memory.
*/
extern JS_PUBLIC_API(void)
JS_ReportOutOfMemory(JSContext* cx);
/**
* Complain when an allocation size overflows the maximum supported limit.
*/
extern JS_PUBLIC_API(void)
JS_ReportAllocationOverflow(JSContext* cx);
class JSErrorReport
{
// The (default) error message.
// If ownsMessage_ is true, the it is freed in destructor.
JS::ConstUTF8CharsZ message_;
// Offending source line without final '\n'.
// If ownsLinebuf__ is true, the buffer is freed in destructor.
const char16_t* linebuf_;
// Number of chars in linebuf_. Does not include trailing '\0'.
size_t linebufLength_;
// The 0-based offset of error token in linebuf_.
size_t tokenOffset_;
public:
JSErrorReport()
: linebuf_(nullptr), linebufLength_(0), tokenOffset_(0),
filename(nullptr), lineno(0), column(0),
flags(0), errorNumber(0),
exnType(0), isMuted(false),
ownsLinebuf_(false), ownsMessage_(false)
{}
~JSErrorReport() {
freeLinebuf();
freeMessage();
}
const char* filename; /* source file name, URL, etc., or null */
unsigned lineno; /* source line number */
unsigned column; /* zero-based column index in line */
unsigned flags; /* error/warning, etc. */
unsigned errorNumber; /* the error number, e.g. see js.msg */
int16_t exnType; /* One of the JSExnType constants */
bool isMuted : 1; /* See the comment in ReadOnlyCompileOptions. */
private:
bool ownsLinebuf_ : 1;
bool ownsMessage_ : 1;
public:
const char16_t* linebuf() const {
return linebuf_;
}
size_t linebufLength() const {
return linebufLength_;
}
size_t tokenOffset() const {
return tokenOffset_;
}
void initOwnedLinebuf(const char16_t* linebufArg, size_t linebufLengthArg, size_t tokenOffsetArg) {
initBorrowedLinebuf(linebufArg, linebufLengthArg, tokenOffsetArg);
ownsLinebuf_ = true;
}
void initBorrowedLinebuf(const char16_t* linebufArg, size_t linebufLengthArg, size_t tokenOffsetArg);
void freeLinebuf();
const JS::ConstUTF8CharsZ message() const {
return message_;
}
void initOwnedMessage(const char* messageArg) {
initBorrowedMessage(messageArg);
ownsMessage_ = true;
}
void initBorrowedMessage(const char* messageArg) {
MOZ_ASSERT(!message_);
message_ = JS::ConstUTF8CharsZ(messageArg, strlen(messageArg));
}
JSString* newMessageString(JSContext* cx);
void freeMessage();
};
/*
* JSErrorReport flag values. These may be freely composed.
*/
#define JSREPORT_ERROR 0x0 /* pseudo-flag for default case */
#define JSREPORT_WARNING 0x1 /* reported via JS_ReportWarning */
#define JSREPORT_EXCEPTION 0x2 /* exception was thrown */
#define JSREPORT_STRICT 0x4 /* error or warning due to strict option */
#define JSREPORT_USER_1 0x8 /* user-defined flag */
/*
* If JSREPORT_EXCEPTION is set, then a JavaScript-catchable exception
* has been thrown for this runtime error, and the host should ignore it.
* Exception-aware hosts should also check for JS_IsExceptionPending if
* JS_ExecuteScript returns failure, and signal or propagate the exception, as
* appropriate.
*/
#define JSREPORT_IS_WARNING(flags) (((flags) & JSREPORT_WARNING) != 0)
#define JSREPORT_IS_EXCEPTION(flags) (((flags) & JSREPORT_EXCEPTION) != 0)
#define JSREPORT_IS_STRICT(flags) (((flags) & JSREPORT_STRICT) != 0)
namespace JS {
using WarningReporter = void (*)(JSContext* cx, JSErrorReport* report);
extern JS_PUBLIC_API(WarningReporter)
SetWarningReporter(JSContext* cx, WarningReporter reporter);
extern JS_PUBLIC_API(WarningReporter)
GetWarningReporter(JSContext* cx);
extern JS_PUBLIC_API(bool)
CreateError(JSContext* cx, JSExnType type, HandleObject stack,
HandleString fileName, uint32_t lineNumber, uint32_t columnNumber,
JSErrorReport* report, HandleString message, MutableHandleValue rval);
/************************************************************************/
/*
* Weak Maps.
*/
extern JS_PUBLIC_API(JSObject*)
NewWeakMapObject(JSContext* cx);
extern JS_PUBLIC_API(bool)
IsWeakMapObject(JSObject* obj);
extern JS_PUBLIC_API(bool)
GetWeakMapEntry(JSContext* cx, JS::HandleObject mapObj, JS::HandleObject key,
JS::MutableHandleValue val);
extern JS_PUBLIC_API(bool)
SetWeakMapEntry(JSContext* cx, JS::HandleObject mapObj, JS::HandleObject key,
JS::HandleValue val);
/*
* Map
*/
extern JS_PUBLIC_API(JSObject*)
NewMapObject(JSContext* cx);
extern JS_PUBLIC_API(uint32_t)
MapSize(JSContext* cx, HandleObject obj);
extern JS_PUBLIC_API(bool)
MapGet(JSContext* cx, HandleObject obj,
HandleValue key, MutableHandleValue rval);
extern JS_PUBLIC_API(bool)
MapHas(JSContext* cx, HandleObject obj, HandleValue key, bool* rval);
extern JS_PUBLIC_API(bool)
MapSet(JSContext* cx, HandleObject obj, HandleValue key, HandleValue val);
extern JS_PUBLIC_API(bool)
MapDelete(JSContext *cx, HandleObject obj, HandleValue key, bool *rval);
extern JS_PUBLIC_API(bool)
MapClear(JSContext* cx, HandleObject obj);
extern JS_PUBLIC_API(bool)
MapKeys(JSContext* cx, HandleObject obj, MutableHandleValue rval);
extern JS_PUBLIC_API(bool)
MapValues(JSContext* cx, HandleObject obj, MutableHandleValue rval);
extern JS_PUBLIC_API(bool)
MapEntries(JSContext* cx, HandleObject obj, MutableHandleValue rval);
extern JS_PUBLIC_API(bool)
MapForEach(JSContext *cx, HandleObject obj, HandleValue callbackFn, HandleValue thisVal);
/*
* Set
*/
extern JS_PUBLIC_API(JSObject *)
NewSetObject(JSContext *cx);
extern JS_PUBLIC_API(uint32_t)
SetSize(JSContext *cx, HandleObject obj);
extern JS_PUBLIC_API(bool)
SetHas(JSContext *cx, HandleObject obj, HandleValue key, bool *rval);
extern JS_PUBLIC_API(bool)
SetDelete(JSContext *cx, HandleObject obj, HandleValue key, bool *rval);
extern JS_PUBLIC_API(bool)
SetAdd(JSContext *cx, HandleObject obj, HandleValue key);
extern JS_PUBLIC_API(bool)
SetClear(JSContext *cx, HandleObject obj);
extern JS_PUBLIC_API(bool)
SetKeys(JSContext *cx, HandleObject obj, MutableHandleValue rval);
extern JS_PUBLIC_API(bool)
SetValues(JSContext *cx, HandleObject obj, MutableHandleValue rval);
extern JS_PUBLIC_API(bool)
SetEntries(JSContext *cx, HandleObject obj, MutableHandleValue rval);
extern JS_PUBLIC_API(bool)
SetForEach(JSContext *cx, HandleObject obj, HandleValue callbackFn, HandleValue thisVal);
} /* namespace JS */
/*
* Dates.
*/
extern JS_PUBLIC_API(JSObject*)
JS_NewDateObject(JSContext* cx, int year, int mon, int mday, int hour, int min, int sec);
/**
* Returns true and sets |*isDate| indicating whether |obj| is a Date object or
* a wrapper around one, otherwise returns false on failure.
*
* This method returns true with |*isDate == false| when passed a proxy whose
* target is a Date, or when passed a revoked proxy.
*/
extern JS_PUBLIC_API(bool)
JS_ObjectIsDate(JSContext* cx, JS::HandleObject obj, bool* isDate);
/************************************************************************/
/*
* Regular Expressions.
*/
#define JSREG_FOLD 0x01u /* fold uppercase to lowercase */
#define JSREG_GLOB 0x02u /* global exec, creates array of matches */
#define JSREG_MULTILINE 0x04u /* treat ^ and $ as begin and end of line */
#define JSREG_STICKY 0x08u /* only match starting at lastIndex */
#define JSREG_UNICODE 0x10u /* unicode */
extern JS_PUBLIC_API(JSObject*)
JS_NewRegExpObject(JSContext* cx, const char* bytes, size_t length, unsigned flags);
extern JS_PUBLIC_API(JSObject*)
JS_NewUCRegExpObject(JSContext* cx, const char16_t* chars, size_t length, unsigned flags);
extern JS_PUBLIC_API(bool)
JS_SetRegExpInput(JSContext* cx, JS::HandleObject obj, JS::HandleString input);
extern JS_PUBLIC_API(bool)
JS_ClearRegExpStatics(JSContext* cx, JS::HandleObject obj);
extern JS_PUBLIC_API(bool)
JS_ExecuteRegExp(JSContext* cx, JS::HandleObject obj, JS::HandleObject reobj,
char16_t* chars, size_t length, size_t* indexp, bool test,
JS::MutableHandleValue rval);
/* RegExp interface for clients without a global object. */
extern JS_PUBLIC_API(bool)
JS_ExecuteRegExpNoStatics(JSContext* cx, JS::HandleObject reobj, char16_t* chars, size_t length,
size_t* indexp, bool test, JS::MutableHandleValue rval);
/**
* Returns true and sets |*isRegExp| indicating whether |obj| is a RegExp
* object or a wrapper around one, otherwise returns false on failure.
*
* This method returns true with |*isRegExp == false| when passed a proxy whose
* target is a RegExp, or when passed a revoked proxy.
*/
extern JS_PUBLIC_API(bool)
JS_ObjectIsRegExp(JSContext* cx, JS::HandleObject obj, bool* isRegExp);
extern JS_PUBLIC_API(unsigned)
JS_GetRegExpFlags(JSContext* cx, JS::HandleObject obj);
extern JS_PUBLIC_API(JSString*)
JS_GetRegExpSource(JSContext* cx, JS::HandleObject obj);
/************************************************************************/
extern JS_PUBLIC_API(bool)
JS_IsExceptionPending(JSContext* cx);
extern JS_PUBLIC_API(bool)
JS_GetPendingException(JSContext* cx, JS::MutableHandleValue vp);
extern JS_PUBLIC_API(void)
JS_SetPendingException(JSContext* cx, JS::HandleValue v);
extern JS_PUBLIC_API(void)
JS_ClearPendingException(JSContext* cx);
namespace JS {
/**
* Save and later restore the current exception state of a given JSContext.
* This is useful for implementing behavior in C++ that's like try/catch
* or try/finally in JS.
*
* Typical usage:
*
* bool ok = JS::Evaluate(cx, ...);
* AutoSaveExceptionState savedExc(cx);
* ... cleanup that might re-enter JS ...
* return ok;
*/
class JS_PUBLIC_API(AutoSaveExceptionState)
{
private:
JSContext* context;
bool wasPropagatingForcedReturn;
bool wasOverRecursed;
bool wasThrowing;
RootedValue exceptionValue;
public:
/*
* Take a snapshot of cx's current exception state. Then clear any current
* pending exception in cx.
*/
explicit AutoSaveExceptionState(JSContext* cx);
/*
* If neither drop() nor restore() was called, restore the exception
* state only if no exception is currently pending on cx.
*/
~AutoSaveExceptionState();
/*
* Discard any stored exception state.
* If this is called, the destructor is a no-op.
*/
void drop() {
wasPropagatingForcedReturn = false;
wasOverRecursed = false;
wasThrowing = false;
exceptionValue.setUndefined();
}
/*
* Replace cx's exception state with the stored exception state. Then
* discard the stored exception state. If this is called, the
* destructor is a no-op.
*/
void restore();
};
} /* namespace JS */
/* Deprecated API. Use AutoSaveExceptionState instead. */
extern JS_PUBLIC_API(JSExceptionState*)
JS_SaveExceptionState(JSContext* cx);
extern JS_PUBLIC_API(void)
JS_RestoreExceptionState(JSContext* cx, JSExceptionState* state);
extern JS_PUBLIC_API(void)
JS_DropExceptionState(JSContext* cx, JSExceptionState* state);
/**
* If the given object is an exception object, the exception will have (or be
* able to lazily create) an error report struct, and this function will return
* the address of that struct. Otherwise, it returns nullptr. The lifetime
* of the error report struct that might be returned is the same as the
* lifetime of the exception object.
*/
extern JS_PUBLIC_API(JSErrorReport*)
JS_ErrorFromException(JSContext* cx, JS::HandleObject obj);
/**
* If the given object is an exception object (or an unwrappable
* cross-compartment wrapper for one), return the stack for that exception, if
* any. Will return null if the given object is not an exception object
* (including if it's null or a security wrapper that can't be unwrapped) or if
* the exception has no stack.
*/
extern JS_PUBLIC_API(JSObject*)
ExceptionStackOrNull(JS::HandleObject obj);
/*
* Throws a StopIteration exception on cx.
*/
extern JS_PUBLIC_API(bool)
JS_ThrowStopIteration(JSContext* cx);
extern JS_PUBLIC_API(bool)
JS_IsStopIteration(const JS::Value& v);
/**
* A JS context always has an "owner thread". The owner thread is set when the
* context is created (to the current thread) and practically all entry points
* into the JS engine check that a context (or anything contained in the
* context: runtime, compartment, object, etc) is only touched by its owner
* thread. Embeddings may check this invariant outside the JS engine by calling
* JS_AbortIfWrongThread (which will abort if not on the owner thread, even for
* non-debug builds).
*/
extern JS_PUBLIC_API(void)
JS_AbortIfWrongThread(JSContext* cx);
/************************************************************************/
/**
* A constructor can request that the JS engine create a default new 'this'
* object of the given class, using the callee to determine parentage and
* [[Prototype]].
*/
extern JS_PUBLIC_API(JSObject*)
JS_NewObjectForConstructor(JSContext* cx, const JSClass* clasp, const JS::CallArgs& args);
/************************************************************************/
#ifdef JS_GC_ZEAL
#define JS_DEFAULT_ZEAL_FREQ 100
extern JS_PUBLIC_API(void)
JS_GetGCZealBits(JSContext* cx, uint32_t* zealBits, uint32_t* frequency, uint32_t* nextScheduled);
extern JS_PUBLIC_API(void)
JS_SetGCZeal(JSContext* cx, uint8_t zeal, uint32_t frequency);
extern JS_PUBLIC_API(void)
JS_ScheduleGC(JSContext* cx, uint32_t count);
#endif
extern JS_PUBLIC_API(void)
JS_SetParallelParsingEnabled(JSContext* cx, bool enabled);
extern JS_PUBLIC_API(void)
JS_SetOffthreadIonCompilationEnabled(JSContext* cx, bool enabled);
#define JIT_COMPILER_OPTIONS(Register) \
Register(BASELINE_WARMUP_TRIGGER, "baseline.warmup.trigger") \
Register(ION_WARMUP_TRIGGER, "ion.warmup.trigger") \
Register(ION_GVN_ENABLE, "ion.gvn.enable") \
Register(ION_FORCE_IC, "ion.forceinlineCaches") \
Register(ION_ENABLE, "ion.enable") \
Register(ION_INTERRUPT_WITHOUT_SIGNAL, "ion.interrupt-without-signals") \
Register(ION_CHECK_RANGE_ANALYSIS, "ion.check-range-analysis") \
Register(BASELINE_ENABLE, "baseline.enable") \
Register(OFFTHREAD_COMPILATION_ENABLE, "offthread-compilation.enable") \
Register(JUMP_THRESHOLD, "jump-threshold") \
Register(ASMJS_ATOMICS_ENABLE, "asmjs.atomics.enable") \
Register(WASM_TEST_MODE, "wasm.test-mode") \
Register(WASM_FOLD_OFFSETS, "wasm.fold-offsets")
typedef enum JSJitCompilerOption {
#define JIT_COMPILER_DECLARE(key, str) \
JSJITCOMPILER_ ## key,
JIT_COMPILER_OPTIONS(JIT_COMPILER_DECLARE)
#undef JIT_COMPILER_DECLARE
JSJITCOMPILER_NOT_AN_OPTION
} JSJitCompilerOption;
extern JS_PUBLIC_API(void)
JS_SetGlobalJitCompilerOption(JSContext* cx, JSJitCompilerOption opt, uint32_t value);
extern JS_PUBLIC_API(bool)
JS_GetGlobalJitCompilerOption(JSContext* cx, JSJitCompilerOption opt, uint32_t* valueOut);
/**
* Convert a uint32_t index into a jsid.
*/
extern JS_PUBLIC_API(bool)
JS_IndexToId(JSContext* cx, uint32_t index, JS::MutableHandleId);
/**
* Convert chars into a jsid.
*
* |chars| may not be an index.
*/
extern JS_PUBLIC_API(bool)
JS_CharsToId(JSContext* cx, JS::TwoByteChars chars, JS::MutableHandleId);
/**
* Test if the given string is a valid ECMAScript identifier
*/
extern JS_PUBLIC_API(bool)
JS_IsIdentifier(JSContext* cx, JS::HandleString str, bool* isIdentifier);
/**
* Test whether the given chars + length are a valid ECMAScript identifier.
* This version is infallible, so just returns whether the chars are an
* identifier.
*/
extern JS_PUBLIC_API(bool)
JS_IsIdentifier(const char16_t* chars, size_t length);
namespace js {
class ScriptSource;
} // namespace js
namespace JS {
class MOZ_RAII JS_PUBLIC_API(AutoFilename)
{
private:
js::ScriptSource* ss_;
mozilla::Variant<const char*, UniqueChars> filename_;
AutoFilename(const AutoFilename&) = delete;
AutoFilename& operator=(const AutoFilename&) = delete;
public:
AutoFilename()
: ss_(nullptr),
filename_(mozilla::AsVariant<const char*>(nullptr))
{}
~AutoFilename() {
reset();
}
void reset();
void setOwned(UniqueChars&& filename);
void setUnowned(const char* filename);
void setScriptSource(js::ScriptSource* ss);
const char* get() const;
};
/**
* Return the current filename, line number and column number of the most
* currently running frame. Returns true if a scripted frame was found, false
* otherwise.
*
* If a the embedding has hidden the scripted caller for the topmost activation
* record, this will also return false.
*/
extern JS_PUBLIC_API(bool)
DescribeScriptedCaller(JSContext* cx, AutoFilename* filename = nullptr,
unsigned* lineno = nullptr, unsigned* column = nullptr);
extern JS_PUBLIC_API(JSObject*)
GetScriptedCallerGlobal(JSContext* cx);
/**
* Informs the JS engine that the scripted caller should be hidden. This can be
* used by the embedding to maintain an override of the scripted caller in its
* calculations, by hiding the scripted caller in the JS engine and pushing data
* onto a separate stack, which it inspects when DescribeScriptedCaller returns
* null.
*
* We maintain a counter on each activation record. Add() increments the counter
* of the topmost activation, and Remove() decrements it. The count may never
* drop below zero, and must always be exactly zero when the activation is
* popped from the stack.
*/
extern JS_PUBLIC_API(void)
HideScriptedCaller(JSContext* cx);
extern JS_PUBLIC_API(void)
UnhideScriptedCaller(JSContext* cx);
class MOZ_RAII AutoHideScriptedCaller
{
public:
explicit AutoHideScriptedCaller(JSContext* cx
MOZ_GUARD_OBJECT_NOTIFIER_PARAM)
: mContext(cx)
{
MOZ_GUARD_OBJECT_NOTIFIER_INIT;
HideScriptedCaller(mContext);
}
~AutoHideScriptedCaller() {
UnhideScriptedCaller(mContext);
}
protected:
JSContext* mContext;
MOZ_DECL_USE_GUARD_OBJECT_NOTIFIER
};
/*
* Encode/Decode interpreted scripts and functions to/from memory.
*/
typedef mozilla::Vector<uint8_t> TranscodeBuffer;
enum TranscodeResult
{
// Successful encoding / decoding.
TranscodeResult_Ok = 0,
// A warning message, is set to the message out-param.
TranscodeResult_Failure = 0x100,
TranscodeResult_Failure_BadBuildId = TranscodeResult_Failure | 0x1,
TranscodeResult_Failure_RunOnceNotSupported = TranscodeResult_Failure | 0x2,
TranscodeResult_Failure_AsmJSNotSupported = TranscodeResult_Failure | 0x3,
TranscodeResult_Failure_UnknownClassKind = TranscodeResult_Failure | 0x4,
// A error, the JSContext has a pending exception.
TranscodeResult_Throw = 0x200
};
extern JS_PUBLIC_API(TranscodeResult)
EncodeScript(JSContext* cx, TranscodeBuffer& buffer, JS::HandleScript script);
extern JS_PUBLIC_API(TranscodeResult)
EncodeInterpretedFunction(JSContext* cx, TranscodeBuffer& buffer, JS::HandleObject funobj);
extern JS_PUBLIC_API(TranscodeResult)
DecodeScript(JSContext* cx, TranscodeBuffer& buffer, JS::MutableHandleScript scriptp,
size_t cursorIndex = 0);
extern JS_PUBLIC_API(TranscodeResult)
DecodeInterpretedFunction(JSContext* cx, TranscodeBuffer& buffer, JS::MutableHandleFunction funp,
size_t cursorIndex = 0);
} /* namespace JS */
namespace js {
enum class StackFormat { SpiderMonkey, V8, Default };
/*
* Sets the format used for stringifying Error stacks.
*
* The default format is StackFormat::SpiderMonkey. Use StackFormat::V8
* in order to emulate V8's stack formatting. StackFormat::Default can't be
* used here.
*/
extern JS_PUBLIC_API(void)
SetStackFormat(JSContext* cx, StackFormat format);
extern JS_PUBLIC_API(StackFormat)
GetStackFormat(JSContext* cx);
}
namespace JS {
/*
* This callback represents a request by the JS engine to open for reading the
* existing cache entry for the given global and char range that may contain a
* module. If a cache entry exists, the callback shall return 'true' and return
* the size, base address and an opaque file handle as outparams. If the
* callback returns 'true', the JS engine guarantees a call to
* CloseAsmJSCacheEntryForReadOp, passing the same base address, size and
* handle.
*/
typedef bool
(* OpenAsmJSCacheEntryForReadOp)(HandleObject global, const char16_t* begin, const char16_t* limit,
size_t* size, const uint8_t** memory, intptr_t* handle);
typedef void
(* CloseAsmJSCacheEntryForReadOp)(size_t size, const uint8_t* memory, intptr_t handle);
/** The list of reasons why an asm.js module may not be stored in the cache. */
enum AsmJSCacheResult
{
AsmJSCache_Success,
AsmJSCache_MIN = AsmJSCache_Success,
AsmJSCache_ModuleTooSmall,
AsmJSCache_SynchronousScript,
AsmJSCache_QuotaExceeded,
AsmJSCache_StorageInitFailure,
AsmJSCache_Disabled_Internal,
AsmJSCache_Disabled_ShellFlags,
AsmJSCache_Disabled_JitInspector,
AsmJSCache_InternalError,
AsmJSCache_Disabled_PrivateBrowsing,
AsmJSCache_ESR52,
AsmJSCache_LIMIT
};
/*
* This callback represents a request by the JS engine to open for writing a
* cache entry of the given size for the given global and char range containing
* the just-compiled module. If cache entry space is available, the callback
* shall return 'true' and return the base address and an opaque file handle as
* outparams. If the callback returns 'true', the JS engine guarantees a call
* to CloseAsmJSCacheEntryForWriteOp passing the same base address, size and
* handle.
*
* If 'installed' is true, then the cache entry is associated with a permanently
* installed JS file (e.g., in a packaged webapp). This information allows the
* embedding to store the cache entry in a installed location associated with
* the principal of 'global' where it will not be evicted until the associated
* installed JS file is removed.
*/
typedef AsmJSCacheResult
(* OpenAsmJSCacheEntryForWriteOp)(HandleObject global, bool installed,
const char16_t* begin, const char16_t* end,
size_t size, uint8_t** memory, intptr_t* handle);
typedef void
(* CloseAsmJSCacheEntryForWriteOp)(size_t size, uint8_t* memory, intptr_t handle);
struct AsmJSCacheOps
{
OpenAsmJSCacheEntryForReadOp openEntryForRead;
CloseAsmJSCacheEntryForReadOp closeEntryForRead;
OpenAsmJSCacheEntryForWriteOp openEntryForWrite;
CloseAsmJSCacheEntryForWriteOp closeEntryForWrite;
};
extern JS_PUBLIC_API(void)
SetAsmJSCacheOps(JSContext* cx, const AsmJSCacheOps* callbacks);
/**
* Return the buildId (represented as a sequence of characters) associated with
* the currently-executing build. If the JS engine is embedded such that a
* single cache entry can be observed by different compiled versions of the JS
* engine, it is critical that the buildId shall change for each new build of
* the JS engine.
*/
typedef js::Vector<char, 0, js::SystemAllocPolicy> BuildIdCharVector;
typedef bool
(* BuildIdOp)(BuildIdCharVector* buildId);
extern JS_PUBLIC_API(void)
SetBuildIdOp(JSContext* cx, BuildIdOp buildIdOp);
/**
* The WasmModule interface allows the embedding to hold a reference to the
* underying C++ implementation of a JS WebAssembly.Module object for purposes
* of (de)serialization off the object's JSRuntime's thread.
*
* - Serialization starts when WebAssembly.Module is passed to the
* structured-clone algorithm. JS::GetWasmModule is called on the JSRuntime
* thread that initiated the structured clone to get the JS::WasmModule.
* This interface is then taken to a background thread where serializedSize()
* and serialize() are called to write the object to two files: a bytecode file
* that always allows successful deserialization and a compiled-code file keyed
* on cpu- and build-id that may become invalid if either of these change between
* serialization and deserialization. After serialization, the reference is
* dropped from the background thread.
*
* - Deserialization starts when the structured clone algorithm encounters a
* serialized WebAssembly.Module. On a background thread, the compiled-code file
* is opened and CompiledWasmModuleAssumptionsMatch is called to see if it is
* still valid (as described above). DeserializeWasmModule is then called to
* construct a JS::WasmModule (also on the background thread), passing the
* bytecode file descriptor and, if valid, the compiled-code file descriptor.
* The JS::WasmObject is then transported to the JSRuntime thread (which
* originated the request) and the wrapping WebAssembly.Module object is created
* by calling createObject().
*/
struct WasmModule : mozilla::external::AtomicRefCounted<WasmModule>
{
MOZ_DECLARE_REFCOUNTED_TYPENAME(WasmModule)
virtual ~WasmModule() {}
virtual void serializedSize(size_t* maybeBytecodeSize, size_t* maybeCompiledSize) const = 0;
virtual void serialize(uint8_t* maybeBytecodeBegin, size_t maybeBytecodeSize,
uint8_t* maybeCompiledBegin, size_t maybeCompiledSize) const = 0;
virtual JSObject* createObject(JSContext* cx) = 0;
};
extern JS_PUBLIC_API(bool)
IsWasmModuleObject(HandleObject obj);
extern JS_PUBLIC_API(RefPtr<WasmModule>)
GetWasmModule(HandleObject obj);
extern JS_PUBLIC_API(bool)
CompiledWasmModuleAssumptionsMatch(PRFileDesc* compiled, BuildIdCharVector&& buildId);
extern JS_PUBLIC_API(RefPtr<WasmModule>)
DeserializeWasmModule(PRFileDesc* bytecode, PRFileDesc* maybeCompiled, BuildIdCharVector&& buildId,
JS::UniqueChars filename, unsigned line, unsigned column);
/**
* Convenience class for imitating a JS level for-of loop. Typical usage:
*
* ForOfIterator it(cx);
* if (!it.init(iterable))
* return false;
* RootedValue val(cx);
* while (true) {
* bool done;
* if (!it.next(&val, &done))
* return false;
* if (done)
* break;
* if (!DoStuff(cx, val))
* return false;
* }
*/
class MOZ_STACK_CLASS JS_PUBLIC_API(ForOfIterator) {
protected:
JSContext* cx_;
/*
* Use the ForOfPIC on the global object (see vm/GlobalObject.h) to try
* to optimize iteration across arrays.
*
* Case 1: Regular Iteration
* iterator - pointer to the iterator object.
* index - fixed to NOT_ARRAY (== UINT32_MAX)
*
* Case 2: Optimized Array Iteration
* iterator - pointer to the array object.
* index - current position in array.
*
* The cases are distinguished by whether or not |index| is equal to NOT_ARRAY.
*/
JS::RootedObject iterator;
uint32_t index;
static const uint32_t NOT_ARRAY = UINT32_MAX;
ForOfIterator(const ForOfIterator&) = delete;
ForOfIterator& operator=(const ForOfIterator&) = delete;
public:
explicit ForOfIterator(JSContext* cx) : cx_(cx), iterator(cx_), index(NOT_ARRAY) { }
enum NonIterableBehavior {
ThrowOnNonIterable,
AllowNonIterable
};
/**
* Initialize the iterator. If AllowNonIterable is passed then if getting
* the @@iterator property from iterable returns undefined init() will just
* return true instead of throwing. Callers must then check
* valueIsIterable() before continuing with the iteration.
*/
bool init(JS::HandleValue iterable,
NonIterableBehavior nonIterableBehavior = ThrowOnNonIterable);
/**
* Get the next value from the iterator. If false *done is true
* after this call, do not examine val.
*/
bool next(JS::MutableHandleValue val, bool* done);
/**
* If initialized with throwOnNonCallable = false, check whether
* the value is iterable.
*/
bool valueIsIterable() const {
return iterator;
}
private:
inline bool nextFromOptimizedArray(MutableHandleValue val, bool* done);
bool materializeArrayIterator();
};
/**
* If a large allocation fails when calling pod_{calloc,realloc}CanGC, the JS
* engine may call the large-allocation- failure callback, if set, to allow the
* embedding to flush caches, possibly perform shrinking GCs, etc. to make some
* room. The allocation will then be retried (and may still fail.)
*/
typedef void
(* LargeAllocationFailureCallback)(void* data);
extern JS_PUBLIC_API(void)
SetLargeAllocationFailureCallback(JSContext* cx, LargeAllocationFailureCallback afc, void* data);
/**
* Unlike the error reporter, which is only called if the exception for an OOM
* bubbles up and is not caught, the OutOfMemoryCallback is called immediately
* at the OOM site to allow the embedding to capture the current state of heap
* allocation before anything is freed. If the large-allocation-failure callback
* is called at all (not all allocation sites call the large-allocation-failure
* callback on failure), it is called before the out-of-memory callback; the
* out-of-memory callback is only called if the allocation still fails after the
* large-allocation-failure callback has returned.
*/
typedef void
(* OutOfMemoryCallback)(JSContext* cx, void* data);
extern JS_PUBLIC_API(void)
SetOutOfMemoryCallback(JSContext* cx, OutOfMemoryCallback cb, void* data);
/**
* Capture all frames.
*/
struct AllFrames { };
/**
* Capture at most this many frames.
*/
struct MaxFrames
{
uint32_t maxFrames;
explicit MaxFrames(uint32_t max)
: maxFrames(max)
{
MOZ_ASSERT(max > 0);
}
};
/**
* Capture the first frame with the given principals. By default, do not
* consider self-hosted frames with the given principals as satisfying the stack
* capture.
*/
struct JS_PUBLIC_API(FirstSubsumedFrame)
{
JSContext* cx;
JSPrincipals* principals;
bool ignoreSelfHosted;
/**
* Use the cx's current compartment's principals.
*/
explicit FirstSubsumedFrame(JSContext* cx, bool ignoreSelfHostedFrames = true);
explicit FirstSubsumedFrame(JSContext* ctx, JSPrincipals* p, bool ignoreSelfHostedFrames = true)
: cx(ctx)
, principals(p)
, ignoreSelfHosted(ignoreSelfHostedFrames)
{
if (principals)
JS_HoldPrincipals(principals);
}
// No copying because we want to avoid holding and dropping principals
// unnecessarily.
FirstSubsumedFrame(const FirstSubsumedFrame&) = delete;
FirstSubsumedFrame& operator=(const FirstSubsumedFrame&) = delete;
FirstSubsumedFrame(FirstSubsumedFrame&& rhs)
: principals(rhs.principals)
, ignoreSelfHosted(rhs.ignoreSelfHosted)
{
MOZ_ASSERT(this != &rhs, "self move disallowed");
rhs.principals = nullptr;
}
FirstSubsumedFrame& operator=(FirstSubsumedFrame&& rhs) {
new (this) FirstSubsumedFrame(mozilla::Move(rhs));
return *this;
}
~FirstSubsumedFrame() {
if (principals)
JS_DropPrincipals(cx, principals);
}
};
using StackCapture = mozilla::Variant<AllFrames, MaxFrames, FirstSubsumedFrame>;
/**
* Capture the current call stack as a chain of SavedFrame JSObjects, and set
* |stackp| to the SavedFrame for the youngest stack frame, or nullptr if there
* are no JS frames on the stack.
*
* The |capture| parameter describes the portion of the JS stack to capture:
*
* * |JS::AllFrames|: Capture all frames on the stack.
*
* * |JS::MaxFrames|: Capture no more than |JS::MaxFrames::maxFrames| from the
* stack.
*
* * |JS::FirstSubsumedFrame|: Capture the first frame whose principals are
* subsumed by |JS::FirstSubsumedFrame::principals|. By default, do not
* consider self-hosted frames; this can be controlled via the
* |JS::FirstSubsumedFrame::ignoreSelfHosted| flag. Do not capture any async
* stack.
*/
extern JS_PUBLIC_API(bool)
CaptureCurrentStack(JSContext* cx, MutableHandleObject stackp,
StackCapture&& capture = StackCapture(AllFrames()));
/*
* This is a utility function for preparing an async stack to be used
* by some other object. This may be used when you need to treat a
* given stack trace as an async parent. If you just need to capture
* the current stack, async parents and all, use CaptureCurrentStack
* instead.
*
* Here |asyncStack| is the async stack to prepare. It is copied into
* |cx|'s current compartment, and the newest frame is given
* |asyncCause| as its asynchronous cause. If |maxFrameCount| is
* non-zero, capture at most the youngest |maxFrameCount| frames. The
* new stack object is written to |stackp|. Returns true on success,
* or sets an exception and returns |false| on error.
*/
extern JS_PUBLIC_API(bool)
CopyAsyncStack(JSContext* cx, HandleObject asyncStack,
HandleString asyncCause, MutableHandleObject stackp,
unsigned maxFrameCount);
/*
* Accessors for working with SavedFrame JSObjects
*
* Each of these functions assert that if their `HandleObject savedFrame`
* argument is non-null, its JSClass is the SavedFrame class (or it is a
* cross-compartment or Xray wrapper around an object with the SavedFrame class)
* and the object is not the SavedFrame.prototype object.
*
* Each of these functions will find the first SavedFrame object in the chain
* whose underlying stack frame principals are subsumed by the cx's current
* compartment's principals, and operate on that SavedFrame object. This
* prevents leaking information about privileged frames to un-privileged
* callers. As a result, the SavedFrame in parameters do _NOT_ need to be in the
* same compartment as the cx, and the various out parameters are _NOT_
* guaranteed to be in the same compartment as cx.
*
* You may consider or skip over self-hosted frames by passing
* `SavedFrameSelfHosted::Include` or `SavedFrameSelfHosted::Exclude`
* respectively.
*
* Additionally, it may be the case that there is no such SavedFrame object
* whose captured frame's principals are subsumed by the caller's compartment's
* principals! If the `HandleObject savedFrame` argument is null, or the
* caller's principals do not subsume any of the chained SavedFrame object's
* principals, `SavedFrameResult::AccessDenied` is returned and a (hopefully)
* sane default value is chosen for the out param.
*
* See also `js/src/doc/SavedFrame/SavedFrame.md`.
*/
enum class SavedFrameResult {
Ok,
AccessDenied
};
enum class SavedFrameSelfHosted {
Include,
Exclude
};
/**
* Given a SavedFrame JSObject, get its source property. Defaults to the empty
* string.
*/
extern JS_PUBLIC_API(SavedFrameResult)
GetSavedFrameSource(JSContext* cx, HandleObject savedFrame, MutableHandleString sourcep,
SavedFrameSelfHosted selfHosted = SavedFrameSelfHosted::Include);
/**
* Given a SavedFrame JSObject, get its line property. Defaults to 0.
*/
extern JS_PUBLIC_API(SavedFrameResult)
GetSavedFrameLine(JSContext* cx, HandleObject savedFrame, uint32_t* linep,
SavedFrameSelfHosted selfHosted = SavedFrameSelfHosted::Include);
/**
* Given a SavedFrame JSObject, get its column property. Defaults to 0.
*/
extern JS_PUBLIC_API(SavedFrameResult)
GetSavedFrameColumn(JSContext* cx, HandleObject savedFrame, uint32_t* columnp,
SavedFrameSelfHosted selfHosted = SavedFrameSelfHosted::Include);
/**
* Given a SavedFrame JSObject, get its functionDisplayName string, or nullptr
* if SpiderMonkey was unable to infer a name for the captured frame's
* function. Defaults to nullptr.
*/
extern JS_PUBLIC_API(SavedFrameResult)
GetSavedFrameFunctionDisplayName(JSContext* cx, HandleObject savedFrame, MutableHandleString namep,
SavedFrameSelfHosted selfHosted = SavedFrameSelfHosted::Include);
/**
* Given a SavedFrame JSObject, get its asyncCause string. Defaults to nullptr.
*/
extern JS_PUBLIC_API(SavedFrameResult)
GetSavedFrameAsyncCause(JSContext* cx, HandleObject savedFrame, MutableHandleString asyncCausep,
SavedFrameSelfHosted selfHosted = SavedFrameSelfHosted::Include);
/**
* Given a SavedFrame JSObject, get its asyncParent SavedFrame object or nullptr
* if there is no asyncParent. The `asyncParentp` out parameter is _NOT_
* guaranteed to be in the cx's compartment. Defaults to nullptr.
*/
extern JS_PUBLIC_API(SavedFrameResult)
GetSavedFrameAsyncParent(JSContext* cx, HandleObject savedFrame, MutableHandleObject asyncParentp,
SavedFrameSelfHosted selfHosted = SavedFrameSelfHosted::Include);
/**
* Given a SavedFrame JSObject, get its parent SavedFrame object or nullptr if
* it is the oldest frame in the stack. The `parentp` out parameter is _NOT_
* guaranteed to be in the cx's compartment. Defaults to nullptr.
*/
extern JS_PUBLIC_API(SavedFrameResult)
GetSavedFrameParent(JSContext* cx, HandleObject savedFrame, MutableHandleObject parentp,
SavedFrameSelfHosted selfHosted = SavedFrameSelfHosted::Include);
/**
* Given a SavedFrame JSObject stack, stringify it in the same format as
* Error.prototype.stack. The stringified stack out parameter is placed in the
* cx's compartment. Defaults to the empty string.
*
* The same notes above about SavedFrame accessors applies here as well: cx
* doesn't need to be in stack's compartment, and stack can be null, a
* SavedFrame object, or a wrapper (CCW or Xray) around a SavedFrame object.
*
* Optional indent parameter specifies the number of white spaces to indent
* each line.
*/
extern JS_PUBLIC_API(bool)
BuildStackString(JSContext* cx, HandleObject stack, MutableHandleString stringp,
size_t indent = 0, js::StackFormat stackFormat = js::StackFormat::Default);
/**
* Return true iff the given object is either a SavedFrame object or wrapper
* around a SavedFrame object, and it is not the SavedFrame.prototype object.
*/
extern JS_PUBLIC_API(bool)
IsSavedFrame(JSObject* obj);
} /* namespace JS */
/* Stopwatch-based performance monitoring. */
namespace js {
class AutoStopwatch;
/**
* Abstract base class for a representation of the performance of a
* component. Embeddings interested in performance monitoring should
* provide a concrete implementation of this class, as well as the
* relevant callbacks (see below).
*/
struct JS_PUBLIC_API(PerformanceGroup) {
PerformanceGroup();
// The current iteration of the event loop.
uint64_t iteration() const;
// `true` if an instance of `AutoStopwatch` is already monitoring
// the performance of this performance group for this iteration
// of the event loop, `false` otherwise.
bool isAcquired(uint64_t it) const;
// `true` if a specific instance of `AutoStopwatch` is already monitoring
// the performance of this performance group for this iteration
// of the event loop, `false` otherwise.
bool isAcquired(uint64_t it, const AutoStopwatch* owner) const;
// Mark that an instance of `AutoStopwatch` is monitoring
// the performance of this group for a given iteration.
void acquire(uint64_t it, const AutoStopwatch* owner);
// Mark that no `AutoStopwatch` is monitoring the
// performance of this group for the iteration.
void release(uint64_t it, const AutoStopwatch* owner);
// The number of cycles spent in this group during this iteration
// of the event loop. Note that cycles are not a reliable measure,
// especially over short intervals. See Stopwatch.* for a more
// complete discussion on the imprecision of cycle measurement.
uint64_t recentCycles(uint64_t iteration) const;
void addRecentCycles(uint64_t iteration, uint64_t cycles);
// The number of times this group has been activated during this
// iteration of the event loop.
uint64_t recentTicks(uint64_t iteration) const;
void addRecentTicks(uint64_t iteration, uint64_t ticks);
// The number of microseconds spent doing CPOW during this
// iteration of the event loop.
uint64_t recentCPOW(uint64_t iteration) const;
void addRecentCPOW(uint64_t iteration, uint64_t CPOW);
// Get rid of any data that pretends to be recent.
void resetRecentData();
// `true` if new measures should be added to this group, `false`
// otherwise.
bool isActive() const;
void setIsActive(bool);
// `true` if this group has been used in the current iteration,
// `false` otherwise.
bool isUsedInThisIteration() const;
void setIsUsedInThisIteration(bool);
protected:
// An implementation of `delete` for this object. Must be provided
// by the embedding.
virtual void Delete() = 0;
private:
// The number of cycles spent in this group during this iteration
// of the event loop. Note that cycles are not a reliable measure,
// especially over short intervals. See Runtime.cpp for a more
// complete discussion on the imprecision of cycle measurement.
uint64_t recentCycles_;
// The number of times this group has been activated during this
// iteration of the event loop.
uint64_t recentTicks_;
// The number of microseconds spent doing CPOW during this
// iteration of the event loop.
uint64_t recentCPOW_;
// The current iteration of the event loop. If necessary,
// may safely overflow.
uint64_t iteration_;
// `true` if new measures should be added to this group, `false`
// otherwise.
bool isActive_;
// `true` if this group has been used in the current iteration,
// `false` otherwise.
bool isUsedInThisIteration_;
// The stopwatch currently monitoring the group,
// or `nullptr` if none. Used ony for comparison.
const AutoStopwatch* owner_;
public:
// Compatibility with RefPtr<>
void AddRef();
void Release();
uint64_t refCount_;
};
using PerformanceGroupVector = mozilla::Vector<RefPtr<js::PerformanceGroup>, 0, SystemAllocPolicy>;
/**
* Commit any Performance Monitoring data.
*
* Until `FlushMonitoring` has been called, all PerformanceMonitoring data is invisible
* to the outside world and can cancelled with a call to `ResetMonitoring`.
*/
extern JS_PUBLIC_API(bool)
FlushPerformanceMonitoring(JSContext*);
/**
* Cancel any measurement that hasn't been committed.
*/
extern JS_PUBLIC_API(void)
ResetPerformanceMonitoring(JSContext*);
/**
* Cleanup any memory used by performance monitoring.
*/
extern JS_PUBLIC_API(void)
DisposePerformanceMonitoring(JSContext*);
/**
* Turn on/off stopwatch-based CPU monitoring.
*
* `SetStopwatchIsMonitoringCPOW` or `SetStopwatchIsMonitoringJank`
* may return `false` if monitoring could not be activated, which may
* happen if we are out of memory.
*/
extern JS_PUBLIC_API(bool)
SetStopwatchIsMonitoringCPOW(JSContext*, bool);
extern JS_PUBLIC_API(bool)
GetStopwatchIsMonitoringCPOW(JSContext*);
extern JS_PUBLIC_API(bool)
SetStopwatchIsMonitoringJank(JSContext*, bool);
extern JS_PUBLIC_API(bool)
GetStopwatchIsMonitoringJank(JSContext*);
// Extract the CPU rescheduling data.
extern JS_PUBLIC_API(void)
GetPerfMonitoringTestCpuRescheduling(JSContext*, uint64_t* stayed, uint64_t* moved);
/**
* Add a number of microseconds to the time spent waiting on CPOWs
* since process start.
*/
extern JS_PUBLIC_API(void)
AddCPOWPerformanceDelta(JSContext*, uint64_t delta);
typedef bool
(*StopwatchStartCallback)(uint64_t, void*);
extern JS_PUBLIC_API(bool)
SetStopwatchStartCallback(JSContext*, StopwatchStartCallback, void*);
typedef bool
(*StopwatchCommitCallback)(uint64_t, PerformanceGroupVector&, void*);
extern JS_PUBLIC_API(bool)
SetStopwatchCommitCallback(JSContext*, StopwatchCommitCallback, void*);
typedef bool
(*GetGroupsCallback)(JSContext*, PerformanceGroupVector&, void*);
extern JS_PUBLIC_API(bool)
SetGetPerformanceGroupsCallback(JSContext*, GetGroupsCallback, void*);
} /* namespace js */
#endif /* jsapi_h */
|